mirror of
https://github.com/fluencelabs/tendermint
synced 2025-07-28 18:51:56 +00:00
Compare commits
39 Commits
Author | SHA1 | Date | |
---|---|---|---|
|
b771798d48 | ||
|
1abf34aa91 | ||
|
92dc5fc77a | ||
|
bef39f3346 | ||
|
94e63be922 | ||
|
9570ac4d3e | ||
|
99b9c9bf60 | ||
|
47a0669d12 | ||
|
fe3b97fd66 | ||
|
56052c0a87 | ||
|
98e442a8de | ||
|
b12488b5f1 | ||
|
b487feba42 | ||
|
72f86b5192 | ||
|
42592d9ae0 | ||
|
1610a05cbd | ||
|
2d525bf2b8 | ||
|
e9efbfe267 | ||
|
7b883a5457 | ||
|
fd8d1d6b69 | ||
|
5abdd254e7 | ||
|
22dcc92232 | ||
|
ccf6b2b512 | ||
|
1466a2cc9f | ||
|
6168b404a7 | ||
|
e6fc10faf6 | ||
|
60018d6148 | ||
|
0d5e0d2f13 | ||
|
2cfdef6111 | ||
|
b90e06a37c | ||
|
e6a0d098e8 | ||
|
d8ab8509de | ||
|
85bba82154 | ||
|
a676c71678 | ||
|
c033975a53 | ||
|
06225e332e | ||
|
b646437ec7 | ||
|
be8c2d5018 | ||
|
e93b492efe |
90
CHANGELOG.md
90
CHANGELOG.md
@@ -1,5 +1,95 @@
|
|||||||
# Changelog
|
# Changelog
|
||||||
|
|
||||||
|
## v0.26.4
|
||||||
|
|
||||||
|
*November 27th, 2018*
|
||||||
|
|
||||||
|
Special thanks to external contributors on this release:
|
||||||
|
ackratos, goolAdapter, james-ray, joe-bowman, kostko,
|
||||||
|
nagarajmanjunath, tomtau
|
||||||
|
|
||||||
|
|
||||||
|
Friendly reminder, we have a [bug bounty
|
||||||
|
program](https://hackerone.com/tendermint).
|
||||||
|
|
||||||
|
### FEATURES:
|
||||||
|
|
||||||
|
- [rpc] [\#2747](https://github.com/tendermint/tendermint/issues/2747) Enable subscription to tags emitted from `BeginBlock`/`EndBlock` (@kostko)
|
||||||
|
- [types] [\#2747](https://github.com/tendermint/tendermint/issues/2747) Add `ResultBeginBlock` and `ResultEndBlock` fields to `EventDataNewBlock`
|
||||||
|
and `EventDataNewBlockHeader` to support subscriptions (@kostko)
|
||||||
|
- [types] [\#2918](https://github.com/tendermint/tendermint/issues/2918) Add Marshal, MarshalTo, Unmarshal methods to various structs
|
||||||
|
to support Protobuf compatibility (@nagarajmanjunath)
|
||||||
|
|
||||||
|
### IMPROVEMENTS:
|
||||||
|
|
||||||
|
- [config] [\#2877](https://github.com/tendermint/tendermint/issues/2877) Add `blocktime_iota` to the config.toml (@ackratos)
|
||||||
|
- NOTE: this should be a ConsensusParam, not part of the config, and will be
|
||||||
|
removed from the config at a later date
|
||||||
|
([\#2920](https://github.com/tendermint/tendermint/issues/2920).
|
||||||
|
- [mempool] [\#2882](https://github.com/tendermint/tendermint/issues/2882) Add txs from Update to cache
|
||||||
|
- [mempool] [\#2891](https://github.com/tendermint/tendermint/issues/2891) Remove local int64 counter from being stored in every tx
|
||||||
|
- [node] [\#2866](https://github.com/tendermint/tendermint/issues/2866) Add ability to instantiate IPCVal (@joe-bowman)
|
||||||
|
|
||||||
|
### BUG FIXES:
|
||||||
|
|
||||||
|
- [blockchain] [\#2731](https://github.com/tendermint/tendermint/issues/2731) Retry both blocks if either is bad to avoid getting stuck during fast sync (@goolAdapter)
|
||||||
|
- [consensus] [\#2893](https://github.com/tendermint/tendermint/issues/2893) Use genDoc.Validators instead of state.NextValidators on replay when appHeight==0 (@james-ray)
|
||||||
|
- [log] [\#2868](https://github.com/tendermint/tendermint/issues/2868) Fix `module=main` setting overriding all others
|
||||||
|
- NOTE: this changes the default logging behaviour to be much less verbose.
|
||||||
|
Set `log_level="info"` to restore the previous behaviour.
|
||||||
|
- [rpc] [\#2808](https://github.com/tendermint/tendermint/issues/2808) Fix `accum` field in `/validators` by calling `IncrementAccum` if necessary
|
||||||
|
- [rpc] [\#2811](https://github.com/tendermint/tendermint/issues/2811) Allow integer IDs in JSON-RPC requests (@tomtau)
|
||||||
|
- [txindex/kv] [\#2759](https://github.com/tendermint/tendermint/issues/2759) Fix tx.height range queries
|
||||||
|
- [txindex/kv] [\#2775](https://github.com/tendermint/tendermint/issues/2775) Order tx results by index if height is the same
|
||||||
|
- [txindex/kv] [\#2908](https://github.com/tendermint/tendermint/issues/2908) Don't return false positives when searching for a prefix of a tag value
|
||||||
|
|
||||||
|
## v0.26.3
|
||||||
|
|
||||||
|
*November 17th, 2018*
|
||||||
|
|
||||||
|
Special thanks to external contributors on this release:
|
||||||
|
@danil-lashin, @kevlubkcm, @krhubert, @srmo
|
||||||
|
|
||||||
|
Friendly reminder, we have a [bug bounty
|
||||||
|
program](https://hackerone.com/tendermint).
|
||||||
|
|
||||||
|
### BREAKING CHANGES:
|
||||||
|
|
||||||
|
* Go API
|
||||||
|
- [rpc] [\#2791](https://github.com/tendermint/tendermint/issues/2791) Functions that start HTTP servers are now blocking:
|
||||||
|
- Impacts `StartHTTPServer`, `StartHTTPAndTLSServer`, and `StartGRPCServer`
|
||||||
|
- These functions now take a `net.Listener` instead of an address
|
||||||
|
- [rpc] [\#2767](https://github.com/tendermint/tendermint/issues/2767) Subscribing to events
|
||||||
|
`NewRound` and `CompleteProposal` return new types `EventDataNewRound` and
|
||||||
|
`EventDataCompleteProposal`, respectively, instead of the generic `EventDataRoundState`. (@kevlubkcm)
|
||||||
|
|
||||||
|
### FEATURES:
|
||||||
|
|
||||||
|
- [log] [\#2843](https://github.com/tendermint/tendermint/issues/2843) New `log_format` config option, which can be set to 'plain' for colored
|
||||||
|
text or 'json' for JSON output
|
||||||
|
- [types] [\#2767](https://github.com/tendermint/tendermint/issues/2767) New event types EventDataNewRound (with ProposerInfo) and EventDataCompleteProposal (with BlockID). (@kevlubkcm)
|
||||||
|
|
||||||
|
### IMPROVEMENTS:
|
||||||
|
|
||||||
|
- [dep] [\#2844](https://github.com/tendermint/tendermint/issues/2844) Dependencies are no longer pinned to an exact version in the
|
||||||
|
Gopkg.toml:
|
||||||
|
- Serialization libs are allowed to vary by patch release
|
||||||
|
- Other libs are allowed to vary by minor release
|
||||||
|
- [p2p] [\#2857](https://github.com/tendermint/tendermint/issues/2857) "Send failed" is logged at debug level instead of error.
|
||||||
|
- [rpc] [\#2780](https://github.com/tendermint/tendermint/issues/2780) Add read and write timeouts to HTTP servers
|
||||||
|
- [state] [\#2848](https://github.com/tendermint/tendermint/issues/2848) Make "Update to validators" msg value pretty (@danil-lashin)
|
||||||
|
|
||||||
|
### BUG FIXES:
|
||||||
|
- [consensus] [\#2819](https://github.com/tendermint/tendermint/issues/2819) Don't send proposalHearbeat if not a validator
|
||||||
|
- [docs] [\#2859](https://github.com/tendermint/tendermint/issues/2859) Fix ConsensusParams details in spec
|
||||||
|
- [libs/autofile] [\#2760](https://github.com/tendermint/tendermint/issues/2760) Comment out autofile permissions check - should fix
|
||||||
|
running Tendermint on Windows
|
||||||
|
- [p2p] [\#2869](https://github.com/tendermint/tendermint/issues/2869) Set connection config properly instead of always using default
|
||||||
|
- [p2p/pex] [\#2802](https://github.com/tendermint/tendermint/issues/2802) Seed mode fixes:
|
||||||
|
- Only disconnect from inbound peers
|
||||||
|
- Use FlushStop instead of Sleep to ensure all messages are sent before
|
||||||
|
disconnecting
|
||||||
|
|
||||||
## v0.26.2
|
## v0.26.2
|
||||||
|
|
||||||
*November 15th, 2018*
|
*November 15th, 2018*
|
||||||
|
@@ -1,6 +1,6 @@
|
|||||||
# Pending
|
# Pending
|
||||||
|
|
||||||
## v0.26.3
|
## v0.27.0
|
||||||
|
|
||||||
*TBD*
|
*TBD*
|
||||||
|
|
||||||
@@ -21,7 +21,6 @@ program](https://hackerone.com/tendermint).
|
|||||||
|
|
||||||
* P2P Protocol
|
* P2P Protocol
|
||||||
|
|
||||||
|
|
||||||
### FEATURES:
|
### FEATURES:
|
||||||
|
|
||||||
### IMPROVEMENTS:
|
### IMPROVEMENTS:
|
||||||
|
@@ -69,17 +69,40 @@ vagrant ssh
|
|||||||
make test
|
make test
|
||||||
```
|
```
|
||||||
|
|
||||||
## Testing
|
|
||||||
|
|
||||||
All repos should be hooked up to [CircleCI](https://circleci.com/).
|
|
||||||
|
|
||||||
If they have `.go` files in the root directory, they will be automatically
|
|
||||||
tested by circle using `go test -v -race ./...`. If not, they will need a
|
|
||||||
`circle.yml`. Ideally, every repo has a `Makefile` that defines `make test` and
|
|
||||||
includes its continuous integration status using a badge in the `README.md`.
|
|
||||||
|
|
||||||
## Changelog
|
## Changelog
|
||||||
|
|
||||||
|
Every fix, improvement, feature, or breaking change should be made in a
|
||||||
|
pull-request that includes an update to the `CHANGELOG_PENDING.md` file.
|
||||||
|
|
||||||
|
Changelog entries should be formatted as follows:
|
||||||
|
|
||||||
|
```
|
||||||
|
- [module] \#xxx Some description about the change (@contributor)
|
||||||
|
```
|
||||||
|
|
||||||
|
Here, `module` is the part of the code that changed (typically a
|
||||||
|
top-level Go package), `xxx` is the pull-request number, and `contributor`
|
||||||
|
is the author/s of the change.
|
||||||
|
|
||||||
|
It's also acceptable for `xxx` to refer to the relevent issue number, but pull-request
|
||||||
|
numbers are preferred.
|
||||||
|
Note this means pull-requests should be opened first so the changelog can then
|
||||||
|
be updated with the pull-request's number.
|
||||||
|
There is no need to include the full link, as this will be added
|
||||||
|
automatically during release. But please include the backslash and pound, eg. `\#2313`.
|
||||||
|
|
||||||
|
Changelog entries should be ordered alphabetically according to the
|
||||||
|
`module`, and numerically according to the pull-request number.
|
||||||
|
|
||||||
|
Changes with multiple classifications should be doubly included (eg. a bug fix
|
||||||
|
that is also a breaking change should be recorded under both).
|
||||||
|
|
||||||
|
Breaking changes are further subdivided according to the APIs/users they impact.
|
||||||
|
Any change that effects multiple APIs/users should be recorded multiply - for
|
||||||
|
instance, a change to the `Blockchain Protocol` that removes a field from the
|
||||||
|
header should also be recorded under `CLI/RPC/Config` since the field will be
|
||||||
|
removed from the header in rpc responses as well.
|
||||||
|
|
||||||
## Branching Model and Release
|
## Branching Model and Release
|
||||||
|
|
||||||
All repos should adhere to the branching model: http://nvie.com/posts/a-successful-git-branching-model/.
|
All repos should adhere to the branching model: http://nvie.com/posts/a-successful-git-branching-model/.
|
||||||
@@ -104,13 +127,14 @@ master constitutes a tagged release.
|
|||||||
- start on `develop`
|
- start on `develop`
|
||||||
- run integration tests (see `test_integrations` in Makefile)
|
- run integration tests (see `test_integrations` in Makefile)
|
||||||
- prepare changelog:
|
- prepare changelog:
|
||||||
- copy `CHANGELOG_PENDING.md` to `CHANGELOG.md`
|
- copy `CHANGELOG_PENDING.md` to top of `CHANGELOG.md`
|
||||||
- run `python ./scripts/linkify_changelog.py CHANGELOG.md` to add links for
|
- run `python ./scripts/linkify_changelog.py CHANGELOG.md` to add links for
|
||||||
all issues
|
all issues
|
||||||
- run `bash ./scripts/authors.sh` to get a list of authors since the latest
|
- run `bash ./scripts/authors.sh` to get a list of authors since the latest
|
||||||
release, and add the github aliases of external contributors to the top of
|
release, and add the github aliases of external contributors to the top of
|
||||||
the changelog. To lookup an alias from an email, try `bash
|
the changelog. To lookup an alias from an email, try `bash
|
||||||
./scripts/authors.sh <email>`
|
./scripts/authors.sh <email>`
|
||||||
|
- reset the `CHANGELOG_PENDING.md`
|
||||||
- bump versions
|
- bump versions
|
||||||
- push to release/vX.X.X to run the extended integration tests on the CI
|
- push to release/vX.X.X to run the extended integration tests on the CI
|
||||||
- merge to master
|
- merge to master
|
||||||
@@ -127,3 +151,13 @@ master constitutes a tagged release.
|
|||||||
- merge hotfix-vX.X.X to master
|
- merge hotfix-vX.X.X to master
|
||||||
- merge hotfix-vX.X.X to develop
|
- merge hotfix-vX.X.X to develop
|
||||||
- delete the hotfix-vX.X.X branch
|
- delete the hotfix-vX.X.X branch
|
||||||
|
|
||||||
|
|
||||||
|
## Testing
|
||||||
|
|
||||||
|
All repos should be hooked up to [CircleCI](https://circleci.com/).
|
||||||
|
|
||||||
|
If they have `.go` files in the root directory, they will be automatically
|
||||||
|
tested by circle using `go test -v -race ./...`. If not, they will need a
|
||||||
|
`circle.yml`. Ideally, every repo has a `Makefile` that defines `make test` and
|
||||||
|
includes its continuous integration status using a badge in the `README.md`.
|
||||||
|
23
Gopkg.lock
generated
23
Gopkg.lock
generated
@@ -128,14 +128,6 @@
|
|||||||
revision = "ea4d1f681babbce9545c9c5f3d5194a789c89f5b"
|
revision = "ea4d1f681babbce9545c9c5f3d5194a789c89f5b"
|
||||||
version = "v1.2.0"
|
version = "v1.2.0"
|
||||||
|
|
||||||
[[projects]]
|
|
||||||
digest = "1:b0c25f00bad20d783d259af2af8666969e2fc343fa0dc9efe52936bbd67fb758"
|
|
||||||
name = "github.com/rs/cors"
|
|
||||||
packages = ["."]
|
|
||||||
pruneopts = "UT"
|
|
||||||
revision = "9a47f48565a795472d43519dd49aac781f3034fb"
|
|
||||||
version = "v1.6.0"
|
|
||||||
|
|
||||||
[[projects]]
|
[[projects]]
|
||||||
digest = "1:ea40c24cdbacd054a6ae9de03e62c5f252479b96c716375aace5c120d68647c8"
|
digest = "1:ea40c24cdbacd054a6ae9de03e62c5f252479b96c716375aace5c120d68647c8"
|
||||||
name = "github.com/hashicorp/hcl"
|
name = "github.com/hashicorp/hcl"
|
||||||
@@ -226,14 +218,16 @@
|
|||||||
version = "v1.0.0"
|
version = "v1.0.0"
|
||||||
|
|
||||||
[[projects]]
|
[[projects]]
|
||||||
digest = "1:c1a04665f9613e082e1209cf288bf64f4068dcd6c87a64bf1c4ff006ad422ba0"
|
digest = "1:26663fafdea73a38075b07e8e9d82fc0056379d2be8bb4e13899e8fda7c7dd23"
|
||||||
name = "github.com/prometheus/client_golang"
|
name = "github.com/prometheus/client_golang"
|
||||||
packages = [
|
packages = [
|
||||||
"prometheus",
|
"prometheus",
|
||||||
|
"prometheus/internal",
|
||||||
"prometheus/promhttp",
|
"prometheus/promhttp",
|
||||||
]
|
]
|
||||||
pruneopts = "UT"
|
pruneopts = "UT"
|
||||||
revision = "ae27198cdd90bf12cd134ad79d1366a6cf49f632"
|
revision = "abad2d1bd44235a26707c172eab6bca5bf2dbad3"
|
||||||
|
version = "v0.9.1"
|
||||||
|
|
||||||
[[projects]]
|
[[projects]]
|
||||||
branch = "master"
|
branch = "master"
|
||||||
@@ -275,6 +269,14 @@
|
|||||||
pruneopts = "UT"
|
pruneopts = "UT"
|
||||||
revision = "e2704e165165ec55d062f5919b4b29494e9fa790"
|
revision = "e2704e165165ec55d062f5919b4b29494e9fa790"
|
||||||
|
|
||||||
|
[[projects]]
|
||||||
|
digest = "1:b0c25f00bad20d783d259af2af8666969e2fc343fa0dc9efe52936bbd67fb758"
|
||||||
|
name = "github.com/rs/cors"
|
||||||
|
packages = ["."]
|
||||||
|
pruneopts = "UT"
|
||||||
|
revision = "9a47f48565a795472d43519dd49aac781f3034fb"
|
||||||
|
version = "v1.6.0"
|
||||||
|
|
||||||
[[projects]]
|
[[projects]]
|
||||||
digest = "1:6a4a11ba764a56d2758899ec6f3848d24698d48442ebce85ee7a3f63284526cd"
|
digest = "1:6a4a11ba764a56d2758899ec6f3848d24698d48442ebce85ee7a3f63284526cd"
|
||||||
name = "github.com/spf13/afero"
|
name = "github.com/spf13/afero"
|
||||||
@@ -524,6 +526,7 @@
|
|||||||
"github.com/prometheus/client_golang/prometheus",
|
"github.com/prometheus/client_golang/prometheus",
|
||||||
"github.com/prometheus/client_golang/prometheus/promhttp",
|
"github.com/prometheus/client_golang/prometheus/promhttp",
|
||||||
"github.com/rcrowley/go-metrics",
|
"github.com/rcrowley/go-metrics",
|
||||||
|
"github.com/rs/cors",
|
||||||
"github.com/spf13/cobra",
|
"github.com/spf13/cobra",
|
||||||
"github.com/spf13/viper",
|
"github.com/spf13/viper",
|
||||||
"github.com/stretchr/testify/assert",
|
"github.com/stretchr/testify/assert",
|
||||||
|
46
Gopkg.toml
46
Gopkg.toml
@@ -20,57 +20,60 @@
|
|||||||
# unused-packages = true
|
# unused-packages = true
|
||||||
#
|
#
|
||||||
###########################################################
|
###########################################################
|
||||||
# NOTE: All packages should be pinned to specific versions.
|
|
||||||
# Packages without releases must pin to a commit.
|
|
||||||
|
|
||||||
|
|
||||||
|
# Allow only patch releases for serialization libraries
|
||||||
[[constraint]]
|
[[constraint]]
|
||||||
name = "github.com/go-kit/kit"
|
name = "github.com/tendermint/go-amino"
|
||||||
version = "=0.6.0"
|
version = "~0.14.1"
|
||||||
|
|
||||||
[[constraint]]
|
[[constraint]]
|
||||||
name = "github.com/gogo/protobuf"
|
name = "github.com/gogo/protobuf"
|
||||||
version = "=1.1.1"
|
version = "~1.1.1"
|
||||||
|
|
||||||
[[constraint]]
|
[[constraint]]
|
||||||
name = "github.com/golang/protobuf"
|
name = "github.com/golang/protobuf"
|
||||||
version = "=1.1.0"
|
version = "~1.1.0"
|
||||||
|
|
||||||
|
# Allow only minor releases for other libraries
|
||||||
|
[[constraint]]
|
||||||
|
name = "github.com/go-kit/kit"
|
||||||
|
version = "^0.6.0"
|
||||||
|
|
||||||
[[constraint]]
|
[[constraint]]
|
||||||
name = "github.com/gorilla/websocket"
|
name = "github.com/gorilla/websocket"
|
||||||
version = "=1.2.0"
|
version = "^1.2.0"
|
||||||
|
|
||||||
[[constraint]]
|
[[constraint]]
|
||||||
name = "github.com/rs/cors"
|
name = "github.com/rs/cors"
|
||||||
version = "1.6.0"
|
version = "^1.6.0"
|
||||||
|
|
||||||
[[constraint]]
|
[[constraint]]
|
||||||
name = "github.com/pkg/errors"
|
name = "github.com/pkg/errors"
|
||||||
version = "=0.8.0"
|
version = "^0.8.0"
|
||||||
|
|
||||||
[[constraint]]
|
[[constraint]]
|
||||||
name = "github.com/spf13/cobra"
|
name = "github.com/spf13/cobra"
|
||||||
version = "=0.0.1"
|
version = "^0.0.1"
|
||||||
|
|
||||||
[[constraint]]
|
[[constraint]]
|
||||||
name = "github.com/spf13/viper"
|
name = "github.com/spf13/viper"
|
||||||
version = "=1.0.0"
|
version = "^1.0.0"
|
||||||
|
|
||||||
[[constraint]]
|
[[constraint]]
|
||||||
name = "github.com/stretchr/testify"
|
name = "github.com/stretchr/testify"
|
||||||
version = "=1.2.1"
|
version = "^1.2.1"
|
||||||
|
|
||||||
[[constraint]]
|
|
||||||
name = "github.com/tendermint/go-amino"
|
|
||||||
version = "v0.14.1"
|
|
||||||
|
|
||||||
[[constraint]]
|
[[constraint]]
|
||||||
name = "google.golang.org/grpc"
|
name = "google.golang.org/grpc"
|
||||||
version = "=1.13.0"
|
version = "^1.13.0"
|
||||||
|
|
||||||
[[constraint]]
|
[[constraint]]
|
||||||
name = "github.com/fortytw2/leaktest"
|
name = "github.com/fortytw2/leaktest"
|
||||||
version = "=1.2.0"
|
version = "^1.2.0"
|
||||||
|
|
||||||
|
[[constraint]]
|
||||||
|
name = "github.com/prometheus/client_golang"
|
||||||
|
version = "^0.9.1"
|
||||||
|
|
||||||
###################################
|
###################################
|
||||||
## Some repos dont have releases.
|
## Some repos dont have releases.
|
||||||
@@ -94,11 +97,6 @@
|
|||||||
name = "github.com/tendermint/btcd"
|
name = "github.com/tendermint/btcd"
|
||||||
revision = "e5840949ff4fff0c56f9b6a541e22b63581ea9df"
|
revision = "e5840949ff4fff0c56f9b6a541e22b63581ea9df"
|
||||||
|
|
||||||
# Haven't made a release since 2016.
|
|
||||||
[[constraint]]
|
|
||||||
name = "github.com/prometheus/client_golang"
|
|
||||||
revision = "ae27198cdd90bf12cd134ad79d1366a6cf49f632"
|
|
||||||
|
|
||||||
[[constraint]]
|
[[constraint]]
|
||||||
name = "github.com/rcrowley/go-metrics"
|
name = "github.com/rcrowley/go-metrics"
|
||||||
revision = "e2704e165165ec55d062f5919b4b29494e9fa790"
|
revision = "e2704e165165ec55d062f5919b4b29494e9fa790"
|
||||||
|
2
Vagrantfile
vendored
2
Vagrantfile
vendored
@@ -53,6 +53,6 @@ Vagrant.configure("2") do |config|
|
|||||||
|
|
||||||
# get all deps and tools, ready to install/test
|
# get all deps and tools, ready to install/test
|
||||||
su - vagrant -c 'source /home/vagrant/.bash_profile'
|
su - vagrant -c 'source /home/vagrant/.bash_profile'
|
||||||
su - vagrant -c 'cd /home/vagrant/go/src/github.com/tendermint/tendermint && make get_tools && make get_vendor_deps'
|
su - vagrant -c 'cd /home/vagrant/go/src/github.com/tendermint/tendermint && make get_tools && make get_dev_tools && make get_vendor_deps'
|
||||||
SHELL
|
SHELL
|
||||||
end
|
end
|
||||||
|
@@ -54,7 +54,7 @@ RETRY_LOOP:
|
|||||||
if cli.mustConnect {
|
if cli.mustConnect {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
cli.Logger.Error(fmt.Sprintf("abci.grpcClient failed to connect to %v. Retrying...\n", cli.addr))
|
cli.Logger.Error(fmt.Sprintf("abci.grpcClient failed to connect to %v. Retrying...\n", cli.addr), "err", err)
|
||||||
time.Sleep(time.Second * dialRetryIntervalSeconds)
|
time.Sleep(time.Second * dialRetryIntervalSeconds)
|
||||||
continue RETRY_LOOP
|
continue RETRY_LOOP
|
||||||
}
|
}
|
||||||
|
@@ -67,7 +67,7 @@ RETRY_LOOP:
|
|||||||
if cli.mustConnect {
|
if cli.mustConnect {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
cli.Logger.Error(fmt.Sprintf("abci.socketClient failed to connect to %v. Retrying...", cli.addr))
|
cli.Logger.Error(fmt.Sprintf("abci.socketClient failed to connect to %v. Retrying...", cli.addr), "err", err)
|
||||||
time.Sleep(time.Second * dialRetryIntervalSeconds)
|
time.Sleep(time.Second * dialRetryIntervalSeconds)
|
||||||
continue RETRY_LOOP
|
continue RETRY_LOOP
|
||||||
}
|
}
|
||||||
|
@@ -168,9 +168,12 @@ func (pool *BlockPool) IsCaughtUp() bool {
|
|||||||
return false
|
return false
|
||||||
}
|
}
|
||||||
|
|
||||||
// some conditions to determine if we're caught up
|
// Some conditions to determine if we're caught up.
|
||||||
receivedBlockOrTimedOut := (pool.height > 0 || time.Since(pool.startTime) > 5*time.Second)
|
// Ensures we've either received a block or waited some amount of time,
|
||||||
ourChainIsLongestAmongPeers := pool.maxPeerHeight == 0 || pool.height >= pool.maxPeerHeight
|
// and that we're synced to the highest known height. Note we use maxPeerHeight - 1
|
||||||
|
// because to sync block H requires block H+1 to verify the LastCommit.
|
||||||
|
receivedBlockOrTimedOut := pool.height > 0 || time.Since(pool.startTime) > 5*time.Second
|
||||||
|
ourChainIsLongestAmongPeers := pool.maxPeerHeight == 0 || pool.height >= (pool.maxPeerHeight-1)
|
||||||
isCaughtUp := receivedBlockOrTimedOut && ourChainIsLongestAmongPeers
|
isCaughtUp := receivedBlockOrTimedOut && ourChainIsLongestAmongPeers
|
||||||
return isCaughtUp
|
return isCaughtUp
|
||||||
}
|
}
|
||||||
@@ -252,7 +255,8 @@ func (pool *BlockPool) AddBlock(peerID p2p.ID, block *types.Block, blockSize int
|
|||||||
peer.decrPending(blockSize)
|
peer.decrPending(blockSize)
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
// Bad peer?
|
pool.Logger.Info("invalid peer", "peer", peerID, "blockHeight", block.Height)
|
||||||
|
pool.sendError(errors.New("invalid peer"), peerID)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -292,7 +296,7 @@ func (pool *BlockPool) RemovePeer(peerID p2p.ID) {
|
|||||||
func (pool *BlockPool) removePeer(peerID p2p.ID) {
|
func (pool *BlockPool) removePeer(peerID p2p.ID) {
|
||||||
for _, requester := range pool.requesters {
|
for _, requester := range pool.requesters {
|
||||||
if requester.getPeerID() == peerID {
|
if requester.getPeerID() == peerID {
|
||||||
requester.redo()
|
requester.redo(peerID)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
delete(pool.peers, peerID)
|
delete(pool.peers, peerID)
|
||||||
@@ -326,8 +330,11 @@ func (pool *BlockPool) makeNextRequester() {
|
|||||||
defer pool.mtx.Unlock()
|
defer pool.mtx.Unlock()
|
||||||
|
|
||||||
nextHeight := pool.height + pool.requestersLen()
|
nextHeight := pool.height + pool.requestersLen()
|
||||||
|
if nextHeight > pool.maxPeerHeight {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
|
||||||
request := newBPRequester(pool, nextHeight)
|
request := newBPRequester(pool, nextHeight)
|
||||||
// request.SetLogger(pool.Logger.With("height", nextHeight))
|
|
||||||
|
|
||||||
pool.requesters[nextHeight] = request
|
pool.requesters[nextHeight] = request
|
||||||
atomic.AddInt32(&pool.numPending, 1)
|
atomic.AddInt32(&pool.numPending, 1)
|
||||||
@@ -453,7 +460,7 @@ type bpRequester struct {
|
|||||||
pool *BlockPool
|
pool *BlockPool
|
||||||
height int64
|
height int64
|
||||||
gotBlockCh chan struct{}
|
gotBlockCh chan struct{}
|
||||||
redoCh chan struct{}
|
redoCh chan p2p.ID //redo may send multitime, add peerId to identify repeat
|
||||||
|
|
||||||
mtx sync.Mutex
|
mtx sync.Mutex
|
||||||
peerID p2p.ID
|
peerID p2p.ID
|
||||||
@@ -465,7 +472,7 @@ func newBPRequester(pool *BlockPool, height int64) *bpRequester {
|
|||||||
pool: pool,
|
pool: pool,
|
||||||
height: height,
|
height: height,
|
||||||
gotBlockCh: make(chan struct{}, 1),
|
gotBlockCh: make(chan struct{}, 1),
|
||||||
redoCh: make(chan struct{}, 1),
|
redoCh: make(chan p2p.ID, 1),
|
||||||
|
|
||||||
peerID: "",
|
peerID: "",
|
||||||
block: nil,
|
block: nil,
|
||||||
@@ -524,9 +531,9 @@ func (bpr *bpRequester) reset() {
|
|||||||
// Tells bpRequester to pick another peer and try again.
|
// Tells bpRequester to pick another peer and try again.
|
||||||
// NOTE: Nonblocking, and does nothing if another redo
|
// NOTE: Nonblocking, and does nothing if another redo
|
||||||
// was already requested.
|
// was already requested.
|
||||||
func (bpr *bpRequester) redo() {
|
func (bpr *bpRequester) redo(peerId p2p.ID) {
|
||||||
select {
|
select {
|
||||||
case bpr.redoCh <- struct{}{}:
|
case bpr.redoCh <- peerId:
|
||||||
default:
|
default:
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -565,9 +572,13 @@ OUTER_LOOP:
|
|||||||
return
|
return
|
||||||
case <-bpr.Quit():
|
case <-bpr.Quit():
|
||||||
return
|
return
|
||||||
case <-bpr.redoCh:
|
case peerID := <-bpr.redoCh:
|
||||||
|
if peerID == bpr.peerID {
|
||||||
bpr.reset()
|
bpr.reset()
|
||||||
continue OUTER_LOOP
|
continue OUTER_LOOP
|
||||||
|
} else {
|
||||||
|
continue WAIT_LOOP
|
||||||
|
}
|
||||||
case <-bpr.gotBlockCh:
|
case <-bpr.gotBlockCh:
|
||||||
// We got a block!
|
// We got a block!
|
||||||
// Continue the for-loop and wait til Quit.
|
// Continue the for-loop and wait til Quit.
|
||||||
|
@@ -18,14 +18,50 @@ func init() {
|
|||||||
type testPeer struct {
|
type testPeer struct {
|
||||||
id p2p.ID
|
id p2p.ID
|
||||||
height int64
|
height int64
|
||||||
|
inputChan chan inputData //make sure each peer's data is sequential
|
||||||
}
|
}
|
||||||
|
|
||||||
func makePeers(numPeers int, minHeight, maxHeight int64) map[p2p.ID]testPeer {
|
type inputData struct {
|
||||||
peers := make(map[p2p.ID]testPeer, numPeers)
|
t *testing.T
|
||||||
|
pool *BlockPool
|
||||||
|
request BlockRequest
|
||||||
|
}
|
||||||
|
|
||||||
|
func (p testPeer) runInputRoutine() {
|
||||||
|
go func() {
|
||||||
|
for input := range p.inputChan {
|
||||||
|
p.simulateInput(input)
|
||||||
|
}
|
||||||
|
}()
|
||||||
|
}
|
||||||
|
|
||||||
|
// Request desired, pretend like we got the block immediately.
|
||||||
|
func (p testPeer) simulateInput(input inputData) {
|
||||||
|
block := &types.Block{Header: types.Header{Height: input.request.Height}}
|
||||||
|
input.pool.AddBlock(input.request.PeerID, block, 123)
|
||||||
|
input.t.Logf("Added block from peer %v (height: %v)", input.request.PeerID, input.request.Height)
|
||||||
|
}
|
||||||
|
|
||||||
|
type testPeers map[p2p.ID]testPeer
|
||||||
|
|
||||||
|
func (ps testPeers) start() {
|
||||||
|
for _, v := range ps {
|
||||||
|
v.runInputRoutine()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (ps testPeers) stop() {
|
||||||
|
for _, v := range ps {
|
||||||
|
close(v.inputChan)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func makePeers(numPeers int, minHeight, maxHeight int64) testPeers {
|
||||||
|
peers := make(testPeers, numPeers)
|
||||||
for i := 0; i < numPeers; i++ {
|
for i := 0; i < numPeers; i++ {
|
||||||
peerID := p2p.ID(cmn.RandStr(12))
|
peerID := p2p.ID(cmn.RandStr(12))
|
||||||
height := minHeight + cmn.RandInt63n(maxHeight-minHeight)
|
height := minHeight + cmn.RandInt63n(maxHeight-minHeight)
|
||||||
peers[peerID] = testPeer{peerID, height}
|
peers[peerID] = testPeer{peerID, height, make(chan inputData, 10)}
|
||||||
}
|
}
|
||||||
return peers
|
return peers
|
||||||
}
|
}
|
||||||
@@ -45,6 +81,9 @@ func TestBasic(t *testing.T) {
|
|||||||
|
|
||||||
defer pool.Stop()
|
defer pool.Stop()
|
||||||
|
|
||||||
|
peers.start()
|
||||||
|
defer peers.stop()
|
||||||
|
|
||||||
// Introduce each peer.
|
// Introduce each peer.
|
||||||
go func() {
|
go func() {
|
||||||
for _, peer := range peers {
|
for _, peer := range peers {
|
||||||
@@ -77,12 +116,8 @@ func TestBasic(t *testing.T) {
|
|||||||
if request.Height == 300 {
|
if request.Height == 300 {
|
||||||
return // Done!
|
return // Done!
|
||||||
}
|
}
|
||||||
// Request desired, pretend like we got the block immediately.
|
|
||||||
go func() {
|
peers[request.PeerID].inputChan <- inputData{t, pool, request}
|
||||||
block := &types.Block{Header: types.Header{Height: request.Height}}
|
|
||||||
pool.AddBlock(request.PeerID, block, 123)
|
|
||||||
t.Logf("Added block from peer %v (height: %v)", request.PeerID, request.Height)
|
|
||||||
}()
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@@ -264,8 +264,12 @@ FOR_LOOP:
|
|||||||
bcR.Logger.Info("Time to switch to consensus reactor!", "height", height)
|
bcR.Logger.Info("Time to switch to consensus reactor!", "height", height)
|
||||||
bcR.pool.Stop()
|
bcR.pool.Stop()
|
||||||
|
|
||||||
conR := bcR.Switch.Reactor("CONSENSUS").(consensusReactor)
|
conR, ok := bcR.Switch.Reactor("CONSENSUS").(consensusReactor)
|
||||||
|
if ok {
|
||||||
conR.SwitchToConsensus(state, blocksSynced)
|
conR.SwitchToConsensus(state, blocksSynced)
|
||||||
|
} else {
|
||||||
|
// should only happen during testing
|
||||||
|
}
|
||||||
|
|
||||||
break FOR_LOOP
|
break FOR_LOOP
|
||||||
}
|
}
|
||||||
@@ -314,6 +318,13 @@ FOR_LOOP:
|
|||||||
// still need to clean up the rest.
|
// still need to clean up the rest.
|
||||||
bcR.Switch.StopPeerForError(peer, fmt.Errorf("BlockchainReactor validation error: %v", err))
|
bcR.Switch.StopPeerForError(peer, fmt.Errorf("BlockchainReactor validation error: %v", err))
|
||||||
}
|
}
|
||||||
|
peerID2 := bcR.pool.RedoRequest(second.Height)
|
||||||
|
peer2 := bcR.Switch.Peers().Get(peerID2)
|
||||||
|
if peer2 != nil && peer2 != peer {
|
||||||
|
// NOTE: we've already removed the peer's request, but we
|
||||||
|
// still need to clean up the rest.
|
||||||
|
bcR.Switch.StopPeerForError(peer2, fmt.Errorf("BlockchainReactor validation error: %v", err))
|
||||||
|
}
|
||||||
continue FOR_LOOP
|
continue FOR_LOOP
|
||||||
} else {
|
} else {
|
||||||
bcR.pool.PopRequest()
|
bcR.pool.PopRequest()
|
||||||
|
@@ -1,72 +1,151 @@
|
|||||||
package blockchain
|
package blockchain
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"net"
|
"sort"
|
||||||
"testing"
|
"testing"
|
||||||
|
"time"
|
||||||
|
|
||||||
|
"github.com/stretchr/testify/assert"
|
||||||
|
|
||||||
|
abci "github.com/tendermint/tendermint/abci/types"
|
||||||
|
cfg "github.com/tendermint/tendermint/config"
|
||||||
cmn "github.com/tendermint/tendermint/libs/common"
|
cmn "github.com/tendermint/tendermint/libs/common"
|
||||||
dbm "github.com/tendermint/tendermint/libs/db"
|
dbm "github.com/tendermint/tendermint/libs/db"
|
||||||
"github.com/tendermint/tendermint/libs/log"
|
"github.com/tendermint/tendermint/libs/log"
|
||||||
|
|
||||||
cfg "github.com/tendermint/tendermint/config"
|
|
||||||
"github.com/tendermint/tendermint/p2p"
|
"github.com/tendermint/tendermint/p2p"
|
||||||
"github.com/tendermint/tendermint/proxy"
|
"github.com/tendermint/tendermint/proxy"
|
||||||
sm "github.com/tendermint/tendermint/state"
|
sm "github.com/tendermint/tendermint/state"
|
||||||
"github.com/tendermint/tendermint/types"
|
"github.com/tendermint/tendermint/types"
|
||||||
|
tmtime "github.com/tendermint/tendermint/types/time"
|
||||||
)
|
)
|
||||||
|
|
||||||
func makeStateAndBlockStore(logger log.Logger) (sm.State, *BlockStore) {
|
var config *cfg.Config
|
||||||
config := cfg.ResetTestRoot("blockchain_reactor_test")
|
|
||||||
// blockDB := dbm.NewDebugDB("blockDB", dbm.NewMemDB())
|
func randGenesisDoc(numValidators int, randPower bool, minPower int64) (*types.GenesisDoc, []types.PrivValidator) {
|
||||||
// stateDB := dbm.NewDebugDB("stateDB", dbm.NewMemDB())
|
validators := make([]types.GenesisValidator, numValidators)
|
||||||
|
privValidators := make([]types.PrivValidator, numValidators)
|
||||||
|
for i := 0; i < numValidators; i++ {
|
||||||
|
val, privVal := types.RandValidator(randPower, minPower)
|
||||||
|
validators[i] = types.GenesisValidator{
|
||||||
|
PubKey: val.PubKey,
|
||||||
|
Power: val.VotingPower,
|
||||||
|
}
|
||||||
|
privValidators[i] = privVal
|
||||||
|
}
|
||||||
|
sort.Sort(types.PrivValidatorsByAddress(privValidators))
|
||||||
|
|
||||||
|
return &types.GenesisDoc{
|
||||||
|
GenesisTime: tmtime.Now(),
|
||||||
|
ChainID: config.ChainID(),
|
||||||
|
Validators: validators,
|
||||||
|
}, privValidators
|
||||||
|
}
|
||||||
|
|
||||||
|
func makeVote(header *types.Header, blockID types.BlockID, valset *types.ValidatorSet, privVal types.PrivValidator) *types.Vote {
|
||||||
|
addr := privVal.GetAddress()
|
||||||
|
idx, _ := valset.GetByAddress(addr)
|
||||||
|
vote := &types.Vote{
|
||||||
|
ValidatorAddress: addr,
|
||||||
|
ValidatorIndex: idx,
|
||||||
|
Height: header.Height,
|
||||||
|
Round: 1,
|
||||||
|
Timestamp: tmtime.Now(),
|
||||||
|
Type: types.PrecommitType,
|
||||||
|
BlockID: blockID,
|
||||||
|
}
|
||||||
|
|
||||||
|
privVal.SignVote(header.ChainID, vote)
|
||||||
|
|
||||||
|
return vote
|
||||||
|
}
|
||||||
|
|
||||||
|
type BlockchainReactorPair struct {
|
||||||
|
reactor *BlockchainReactor
|
||||||
|
app proxy.AppConns
|
||||||
|
}
|
||||||
|
|
||||||
|
func newBlockchainReactor(logger log.Logger, genDoc *types.GenesisDoc, privVals []types.PrivValidator, maxBlockHeight int64) BlockchainReactorPair {
|
||||||
|
if len(privVals) != 1 {
|
||||||
|
panic("only support one validator")
|
||||||
|
}
|
||||||
|
|
||||||
|
app := &testApp{}
|
||||||
|
cc := proxy.NewLocalClientCreator(app)
|
||||||
|
proxyApp := proxy.NewAppConns(cc)
|
||||||
|
err := proxyApp.Start()
|
||||||
|
if err != nil {
|
||||||
|
panic(cmn.ErrorWrap(err, "error start app"))
|
||||||
|
}
|
||||||
|
|
||||||
blockDB := dbm.NewMemDB()
|
blockDB := dbm.NewMemDB()
|
||||||
stateDB := dbm.NewMemDB()
|
stateDB := dbm.NewMemDB()
|
||||||
blockStore := NewBlockStore(blockDB)
|
blockStore := NewBlockStore(blockDB)
|
||||||
state, err := sm.LoadStateFromDBOrGenesisFile(stateDB, config.GenesisFile())
|
|
||||||
|
state, err := sm.LoadStateFromDBOrGenesisDoc(stateDB, genDoc)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
panic(cmn.ErrorWrap(err, "error constructing state from genesis file"))
|
panic(cmn.ErrorWrap(err, "error constructing state from genesis file"))
|
||||||
}
|
}
|
||||||
return state, blockStore
|
|
||||||
|
// Make the BlockchainReactor itself.
|
||||||
|
// NOTE we have to create and commit the blocks first because
|
||||||
|
// pool.height is determined from the store.
|
||||||
|
fastSync := true
|
||||||
|
blockExec := sm.NewBlockExecutor(dbm.NewMemDB(), log.TestingLogger(), proxyApp.Consensus(),
|
||||||
|
sm.MockMempool{}, sm.MockEvidencePool{})
|
||||||
|
|
||||||
|
// let's add some blocks in
|
||||||
|
for blockHeight := int64(1); blockHeight <= maxBlockHeight; blockHeight++ {
|
||||||
|
lastCommit := &types.Commit{}
|
||||||
|
if blockHeight > 1 {
|
||||||
|
lastBlockMeta := blockStore.LoadBlockMeta(blockHeight - 1)
|
||||||
|
lastBlock := blockStore.LoadBlock(blockHeight - 1)
|
||||||
|
|
||||||
|
vote := makeVote(&lastBlock.Header, lastBlockMeta.BlockID, state.Validators, privVals[0])
|
||||||
|
lastCommit = &types.Commit{Precommits: []*types.Vote{vote}, BlockID: lastBlockMeta.BlockID}
|
||||||
}
|
}
|
||||||
|
|
||||||
func newBlockchainReactor(logger log.Logger, maxBlockHeight int64) *BlockchainReactor {
|
thisBlock := makeBlock(blockHeight, state, lastCommit)
|
||||||
state, blockStore := makeStateAndBlockStore(logger)
|
|
||||||
|
|
||||||
// Make the blockchainReactor itself
|
thisParts := thisBlock.MakePartSet(types.BlockPartSizeBytes)
|
||||||
fastSync := true
|
blockID := types.BlockID{thisBlock.Hash(), thisParts.Header()}
|
||||||
var nilApp proxy.AppConnConsensus
|
|
||||||
blockExec := sm.NewBlockExecutor(dbm.NewMemDB(), log.TestingLogger(), nilApp,
|
state, err = blockExec.ApplyBlock(state, blockID, thisBlock)
|
||||||
sm.MockMempool{}, sm.MockEvidencePool{})
|
if err != nil {
|
||||||
|
panic(cmn.ErrorWrap(err, "error apply block"))
|
||||||
|
}
|
||||||
|
|
||||||
|
blockStore.SaveBlock(thisBlock, thisParts, lastCommit)
|
||||||
|
}
|
||||||
|
|
||||||
bcReactor := NewBlockchainReactor(state.Copy(), blockExec, blockStore, fastSync)
|
bcReactor := NewBlockchainReactor(state.Copy(), blockExec, blockStore, fastSync)
|
||||||
bcReactor.SetLogger(logger.With("module", "blockchain"))
|
bcReactor.SetLogger(logger.With("module", "blockchain"))
|
||||||
|
|
||||||
// Next: we need to set a switch in order for peers to be added in
|
return BlockchainReactorPair{bcReactor, proxyApp}
|
||||||
bcReactor.Switch = p2p.NewSwitch(cfg.DefaultP2PConfig(), nil)
|
|
||||||
|
|
||||||
// Lastly: let's add some blocks in
|
|
||||||
for blockHeight := int64(1); blockHeight <= maxBlockHeight; blockHeight++ {
|
|
||||||
firstBlock := makeBlock(blockHeight, state)
|
|
||||||
secondBlock := makeBlock(blockHeight+1, state)
|
|
||||||
firstParts := firstBlock.MakePartSet(types.BlockPartSizeBytes)
|
|
||||||
blockStore.SaveBlock(firstBlock, firstParts, secondBlock.LastCommit)
|
|
||||||
}
|
|
||||||
|
|
||||||
return bcReactor
|
|
||||||
}
|
}
|
||||||
|
|
||||||
func TestNoBlockResponse(t *testing.T) {
|
func TestNoBlockResponse(t *testing.T) {
|
||||||
maxBlockHeight := int64(20)
|
config = cfg.ResetTestRoot("blockchain_reactor_test")
|
||||||
|
genDoc, privVals := randGenesisDoc(1, false, 30)
|
||||||
|
|
||||||
bcr := newBlockchainReactor(log.TestingLogger(), maxBlockHeight)
|
maxBlockHeight := int64(65)
|
||||||
bcr.Start()
|
|
||||||
defer bcr.Stop()
|
|
||||||
|
|
||||||
// Add some peers in
|
reactorPairs := make([]BlockchainReactorPair, 2)
|
||||||
peer := newbcrTestPeer(p2p.ID(cmn.RandStr(12)))
|
|
||||||
bcr.AddPeer(peer)
|
|
||||||
|
|
||||||
chID := byte(0x01)
|
reactorPairs[0] = newBlockchainReactor(log.TestingLogger(), genDoc, privVals, maxBlockHeight)
|
||||||
|
reactorPairs[1] = newBlockchainReactor(log.TestingLogger(), genDoc, privVals, 0)
|
||||||
|
|
||||||
|
p2p.MakeConnectedSwitches(config.P2P, 2, func(i int, s *p2p.Switch) *p2p.Switch {
|
||||||
|
s.AddReactor("BLOCKCHAIN", reactorPairs[i].reactor)
|
||||||
|
return s
|
||||||
|
|
||||||
|
}, p2p.Connect2Switches)
|
||||||
|
|
||||||
|
defer func() {
|
||||||
|
for _, r := range reactorPairs {
|
||||||
|
r.reactor.Stop()
|
||||||
|
r.app.Stop()
|
||||||
|
}
|
||||||
|
}()
|
||||||
|
|
||||||
tests := []struct {
|
tests := []struct {
|
||||||
height int64
|
height int64
|
||||||
@@ -78,72 +157,100 @@ func TestNoBlockResponse(t *testing.T) {
|
|||||||
{100, false},
|
{100, false},
|
||||||
}
|
}
|
||||||
|
|
||||||
// receive a request message from peer,
|
for {
|
||||||
// wait for our response to be received on the peer
|
if reactorPairs[1].reactor.pool.IsCaughtUp() {
|
||||||
|
break
|
||||||
|
}
|
||||||
|
|
||||||
|
time.Sleep(10 * time.Millisecond)
|
||||||
|
}
|
||||||
|
|
||||||
|
assert.Equal(t, maxBlockHeight, reactorPairs[0].reactor.store.Height())
|
||||||
|
|
||||||
for _, tt := range tests {
|
for _, tt := range tests {
|
||||||
reqBlockMsg := &bcBlockRequestMessage{tt.height}
|
block := reactorPairs[1].reactor.store.LoadBlock(tt.height)
|
||||||
reqBlockBytes := cdc.MustMarshalBinaryBare(reqBlockMsg)
|
|
||||||
bcr.Receive(chID, peer, reqBlockBytes)
|
|
||||||
msg := peer.lastBlockchainMessage()
|
|
||||||
|
|
||||||
if tt.existent {
|
if tt.existent {
|
||||||
if blockMsg, ok := msg.(*bcBlockResponseMessage); !ok {
|
assert.True(t, block != nil)
|
||||||
t.Fatalf("Expected to receive a block response for height %d", tt.height)
|
|
||||||
} else if blockMsg.Block.Height != tt.height {
|
|
||||||
t.Fatalf("Expected response to be for height %d, got %d", tt.height, blockMsg.Block.Height)
|
|
||||||
}
|
|
||||||
} else {
|
} else {
|
||||||
if noBlockMsg, ok := msg.(*bcNoBlockResponseMessage); !ok {
|
assert.True(t, block == nil)
|
||||||
t.Fatalf("Expected to receive a no block response for height %d", tt.height)
|
|
||||||
} else if noBlockMsg.Height != tt.height {
|
|
||||||
t.Fatalf("Expected response to be for height %d, got %d", tt.height, noBlockMsg.Height)
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/*
|
|
||||||
// NOTE: This is too hard to test without
|
// NOTE: This is too hard to test without
|
||||||
// an easy way to add test peer to switch
|
// an easy way to add test peer to switch
|
||||||
// or without significant refactoring of the module.
|
// or without significant refactoring of the module.
|
||||||
// Alternatively we could actually dial a TCP conn but
|
// Alternatively we could actually dial a TCP conn but
|
||||||
// that seems extreme.
|
// that seems extreme.
|
||||||
func TestBadBlockStopsPeer(t *testing.T) {
|
func TestBadBlockStopsPeer(t *testing.T) {
|
||||||
maxBlockHeight := int64(20)
|
config = cfg.ResetTestRoot("blockchain_reactor_test")
|
||||||
|
genDoc, privVals := randGenesisDoc(1, false, 30)
|
||||||
|
|
||||||
bcr := newBlockchainReactor(log.TestingLogger(), maxBlockHeight)
|
maxBlockHeight := int64(148)
|
||||||
bcr.Start()
|
|
||||||
defer bcr.Stop()
|
|
||||||
|
|
||||||
// Add some peers in
|
otherChain := newBlockchainReactor(log.TestingLogger(), genDoc, privVals, maxBlockHeight)
|
||||||
peer := newbcrTestPeer(p2p.ID(cmn.RandStr(12)))
|
defer func() {
|
||||||
|
otherChain.reactor.Stop()
|
||||||
|
otherChain.app.Stop()
|
||||||
|
}()
|
||||||
|
|
||||||
// XXX: This doesn't add the peer to anything,
|
reactorPairs := make([]BlockchainReactorPair, 4)
|
||||||
// so it's hard to check that it's later removed
|
|
||||||
bcr.AddPeer(peer)
|
|
||||||
assert.True(t, bcr.Switch.Peers().Size() > 0)
|
|
||||||
|
|
||||||
// send a bad block from the peer
|
reactorPairs[0] = newBlockchainReactor(log.TestingLogger(), genDoc, privVals, maxBlockHeight)
|
||||||
// default blocks already dont have commits, so should fail
|
reactorPairs[1] = newBlockchainReactor(log.TestingLogger(), genDoc, privVals, 0)
|
||||||
block := bcr.store.LoadBlock(3)
|
reactorPairs[2] = newBlockchainReactor(log.TestingLogger(), genDoc, privVals, 0)
|
||||||
msg := &bcBlockResponseMessage{Block: block}
|
reactorPairs[3] = newBlockchainReactor(log.TestingLogger(), genDoc, privVals, 0)
|
||||||
peer.Send(BlockchainChannel, struct{ BlockchainMessage }{msg})
|
|
||||||
|
switches := p2p.MakeConnectedSwitches(config.P2P, 4, func(i int, s *p2p.Switch) *p2p.Switch {
|
||||||
|
s.AddReactor("BLOCKCHAIN", reactorPairs[i].reactor)
|
||||||
|
return s
|
||||||
|
|
||||||
|
}, p2p.Connect2Switches)
|
||||||
|
|
||||||
|
defer func() {
|
||||||
|
for _, r := range reactorPairs {
|
||||||
|
r.reactor.Stop()
|
||||||
|
r.app.Stop()
|
||||||
|
}
|
||||||
|
}()
|
||||||
|
|
||||||
ticker := time.NewTicker(time.Millisecond * 10)
|
|
||||||
timer := time.NewTimer(time.Second * 2)
|
|
||||||
LOOP:
|
|
||||||
for {
|
for {
|
||||||
select {
|
if reactorPairs[3].reactor.pool.IsCaughtUp() {
|
||||||
case <-ticker.C:
|
break
|
||||||
if bcr.Switch.Peers().Size() == 0 {
|
|
||||||
break LOOP
|
|
||||||
}
|
}
|
||||||
case <-timer.C:
|
|
||||||
t.Fatal("Timed out waiting to disconnect peer")
|
time.Sleep(1 * time.Second)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
//at this time, reactors[0-3] is the newest
|
||||||
|
assert.Equal(t, 3, reactorPairs[1].reactor.Switch.Peers().Size())
|
||||||
|
|
||||||
|
//mark reactorPairs[3] is an invalid peer
|
||||||
|
reactorPairs[3].reactor.store = otherChain.reactor.store
|
||||||
|
|
||||||
|
lastReactorPair := newBlockchainReactor(log.TestingLogger(), genDoc, privVals, 0)
|
||||||
|
reactorPairs = append(reactorPairs, lastReactorPair)
|
||||||
|
|
||||||
|
switches = append(switches, p2p.MakeConnectedSwitches(config.P2P, 1, func(i int, s *p2p.Switch) *p2p.Switch {
|
||||||
|
s.AddReactor("BLOCKCHAIN", reactorPairs[len(reactorPairs)-1].reactor)
|
||||||
|
return s
|
||||||
|
|
||||||
|
}, p2p.Connect2Switches)...)
|
||||||
|
|
||||||
|
for i := 0; i < len(reactorPairs)-1; i++ {
|
||||||
|
p2p.Connect2Switches(switches, i, len(reactorPairs)-1)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
for {
|
||||||
|
if lastReactorPair.reactor.pool.IsCaughtUp() || lastReactorPair.reactor.Switch.Peers().Size() == 0 {
|
||||||
|
break
|
||||||
|
}
|
||||||
|
|
||||||
|
time.Sleep(1 * time.Second)
|
||||||
|
}
|
||||||
|
|
||||||
|
assert.True(t, lastReactorPair.reactor.Switch.Peers().Size() < len(reactorPairs)-1)
|
||||||
}
|
}
|
||||||
*/
|
|
||||||
|
|
||||||
//----------------------------------------------
|
//----------------------------------------------
|
||||||
// utility funcs
|
// utility funcs
|
||||||
@@ -155,55 +262,41 @@ func makeTxs(height int64) (txs []types.Tx) {
|
|||||||
return txs
|
return txs
|
||||||
}
|
}
|
||||||
|
|
||||||
func makeBlock(height int64, state sm.State) *types.Block {
|
func makeBlock(height int64, state sm.State, lastCommit *types.Commit) *types.Block {
|
||||||
block, _ := state.MakeBlock(height, makeTxs(height), new(types.Commit), nil, state.Validators.GetProposer().Address)
|
block, _ := state.MakeBlock(height, makeTxs(height), lastCommit, nil, state.Validators.GetProposer().Address)
|
||||||
return block
|
return block
|
||||||
}
|
}
|
||||||
|
|
||||||
// The Test peer
|
type testApp struct {
|
||||||
type bcrTestPeer struct {
|
abci.BaseApplication
|
||||||
cmn.BaseService
|
|
||||||
id p2p.ID
|
|
||||||
ch chan interface{}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
var _ p2p.Peer = (*bcrTestPeer)(nil)
|
var _ abci.Application = (*testApp)(nil)
|
||||||
|
|
||||||
func newbcrTestPeer(id p2p.ID) *bcrTestPeer {
|
func (app *testApp) Info(req abci.RequestInfo) (resInfo abci.ResponseInfo) {
|
||||||
bcr := &bcrTestPeer{
|
return abci.ResponseInfo{}
|
||||||
id: id,
|
|
||||||
ch: make(chan interface{}, 2),
|
|
||||||
}
|
|
||||||
bcr.BaseService = *cmn.NewBaseService(nil, "bcrTestPeer", bcr)
|
|
||||||
return bcr
|
|
||||||
}
|
}
|
||||||
|
|
||||||
func (tp *bcrTestPeer) lastBlockchainMessage() interface{} { return <-tp.ch }
|
func (app *testApp) BeginBlock(req abci.RequestBeginBlock) abci.ResponseBeginBlock {
|
||||||
|
return abci.ResponseBeginBlock{}
|
||||||
func (tp *bcrTestPeer) TrySend(chID byte, msgBytes []byte) bool {
|
|
||||||
var msg BlockchainMessage
|
|
||||||
err := cdc.UnmarshalBinaryBare(msgBytes, &msg)
|
|
||||||
if err != nil {
|
|
||||||
panic(cmn.ErrorWrap(err, "Error while trying to parse a BlockchainMessage"))
|
|
||||||
}
|
|
||||||
if _, ok := msg.(*bcStatusResponseMessage); ok {
|
|
||||||
// Discard status response messages since they skew our results
|
|
||||||
// We only want to deal with:
|
|
||||||
// + bcBlockResponseMessage
|
|
||||||
// + bcNoBlockResponseMessage
|
|
||||||
} else {
|
|
||||||
tp.ch <- msg
|
|
||||||
}
|
|
||||||
return true
|
|
||||||
}
|
}
|
||||||
|
|
||||||
func (tp *bcrTestPeer) Send(chID byte, msgBytes []byte) bool { return tp.TrySend(chID, msgBytes) }
|
func (app *testApp) EndBlock(req abci.RequestEndBlock) abci.ResponseEndBlock {
|
||||||
func (tp *bcrTestPeer) NodeInfo() p2p.NodeInfo { return p2p.DefaultNodeInfo{} }
|
return abci.ResponseEndBlock{}
|
||||||
func (tp *bcrTestPeer) Status() p2p.ConnectionStatus { return p2p.ConnectionStatus{} }
|
}
|
||||||
func (tp *bcrTestPeer) ID() p2p.ID { return tp.id }
|
|
||||||
func (tp *bcrTestPeer) IsOutbound() bool { return false }
|
func (app *testApp) DeliverTx(tx []byte) abci.ResponseDeliverTx {
|
||||||
func (tp *bcrTestPeer) IsPersistent() bool { return true }
|
return abci.ResponseDeliverTx{Tags: []cmn.KVPair{}}
|
||||||
func (tp *bcrTestPeer) Get(s string) interface{} { return s }
|
}
|
||||||
func (tp *bcrTestPeer) Set(string, interface{}) {}
|
|
||||||
func (tp *bcrTestPeer) RemoteIP() net.IP { return []byte{127, 0, 0, 1} }
|
func (app *testApp) CheckTx(tx []byte) abci.ResponseCheckTx {
|
||||||
func (tp *bcrTestPeer) OriginalAddr() *p2p.NetAddress { return nil }
|
return abci.ResponseCheckTx{}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (app *testApp) Commit() abci.ResponseCommit {
|
||||||
|
return abci.ResponseCommit{}
|
||||||
|
}
|
||||||
|
|
||||||
|
func (app *testApp) Query(reqQuery abci.RequestQuery) (resQuery abci.ResponseQuery) {
|
||||||
|
return
|
||||||
|
}
|
||||||
|
@@ -9,13 +9,30 @@ import (
|
|||||||
|
|
||||||
"github.com/stretchr/testify/assert"
|
"github.com/stretchr/testify/assert"
|
||||||
"github.com/stretchr/testify/require"
|
"github.com/stretchr/testify/require"
|
||||||
|
cfg "github.com/tendermint/tendermint/config"
|
||||||
|
cmn "github.com/tendermint/tendermint/libs/common"
|
||||||
"github.com/tendermint/tendermint/libs/db"
|
"github.com/tendermint/tendermint/libs/db"
|
||||||
|
dbm "github.com/tendermint/tendermint/libs/db"
|
||||||
"github.com/tendermint/tendermint/libs/log"
|
"github.com/tendermint/tendermint/libs/log"
|
||||||
|
sm "github.com/tendermint/tendermint/state"
|
||||||
|
|
||||||
"github.com/tendermint/tendermint/types"
|
"github.com/tendermint/tendermint/types"
|
||||||
tmtime "github.com/tendermint/tendermint/types/time"
|
tmtime "github.com/tendermint/tendermint/types/time"
|
||||||
)
|
)
|
||||||
|
|
||||||
|
func makeStateAndBlockStore(logger log.Logger) (sm.State, *BlockStore) {
|
||||||
|
config := cfg.ResetTestRoot("blockchain_reactor_test")
|
||||||
|
// blockDB := dbm.NewDebugDB("blockDB", dbm.NewMemDB())
|
||||||
|
// stateDB := dbm.NewDebugDB("stateDB", dbm.NewMemDB())
|
||||||
|
blockDB := dbm.NewMemDB()
|
||||||
|
stateDB := dbm.NewMemDB()
|
||||||
|
state, err := sm.LoadStateFromDBOrGenesisFile(stateDB, config.GenesisFile())
|
||||||
|
if err != nil {
|
||||||
|
panic(cmn.ErrorWrap(err, "error constructing state from genesis file"))
|
||||||
|
}
|
||||||
|
return state, NewBlockStore(blockDB)
|
||||||
|
}
|
||||||
|
|
||||||
func TestLoadBlockStoreStateJSON(t *testing.T) {
|
func TestLoadBlockStoreStateJSON(t *testing.T) {
|
||||||
db := db.NewMemDB()
|
db := db.NewMemDB()
|
||||||
|
|
||||||
@@ -65,7 +82,7 @@ func freshBlockStore() (*BlockStore, db.DB) {
|
|||||||
var (
|
var (
|
||||||
state, _ = makeStateAndBlockStore(log.NewTMLogger(new(bytes.Buffer)))
|
state, _ = makeStateAndBlockStore(log.NewTMLogger(new(bytes.Buffer)))
|
||||||
|
|
||||||
block = makeBlock(1, state)
|
block = makeBlock(1, state, new(types.Commit))
|
||||||
partSet = block.MakePartSet(2)
|
partSet = block.MakePartSet(2)
|
||||||
part1 = partSet.GetPart(0)
|
part1 = partSet.GetPart(0)
|
||||||
part2 = partSet.GetPart(1)
|
part2 = partSet.GetPart(1)
|
||||||
@@ -88,7 +105,7 @@ func TestBlockStoreSaveLoadBlock(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// save a block
|
// save a block
|
||||||
block := makeBlock(bs.Height()+1, state)
|
block := makeBlock(bs.Height()+1, state, new(types.Commit))
|
||||||
validPartSet := block.MakePartSet(2)
|
validPartSet := block.MakePartSet(2)
|
||||||
seenCommit := &types.Commit{Precommits: []*types.Vote{{Height: 10,
|
seenCommit := &types.Commit{Precommits: []*types.Vote{{Height: 10,
|
||||||
Timestamp: tmtime.Now()}}}
|
Timestamp: tmtime.Now()}}}
|
||||||
@@ -331,7 +348,7 @@ func TestLoadBlockMeta(t *testing.T) {
|
|||||||
func TestBlockFetchAtHeight(t *testing.T) {
|
func TestBlockFetchAtHeight(t *testing.T) {
|
||||||
state, bs := makeStateAndBlockStore(log.NewTMLogger(new(bytes.Buffer)))
|
state, bs := makeStateAndBlockStore(log.NewTMLogger(new(bytes.Buffer)))
|
||||||
require.Equal(t, bs.Height(), int64(0), "initially the height should be zero")
|
require.Equal(t, bs.Height(), int64(0), "initially the height should be zero")
|
||||||
block := makeBlock(bs.Height()+1, state)
|
block := makeBlock(bs.Height()+1, state, new(types.Commit))
|
||||||
|
|
||||||
partSet := block.MakePartSet(2)
|
partSet := block.MakePartSet(2)
|
||||||
seenCommit := &types.Commit{Precommits: []*types.Vote{{Height: 10,
|
seenCommit := &types.Commit{Precommits: []*types.Vote{{Height: 10,
|
||||||
|
@@ -54,6 +54,9 @@ var RootCmd = &cobra.Command{
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
if config.LogFormat == cfg.LogFormatJSON {
|
||||||
|
logger = log.NewTMJSONLogger(log.NewSyncWriter(os.Stdout))
|
||||||
|
}
|
||||||
logger, err = tmflags.ParseLogLevel(config.LogLevel, logger, cfg.DefaultLogLevel())
|
logger, err = tmflags.ParseLogLevel(config.LogLevel, logger, cfg.DefaultLogLevel())
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
|
@@ -14,6 +14,11 @@ const (
|
|||||||
FuzzModeDrop = iota
|
FuzzModeDrop = iota
|
||||||
// FuzzModeDelay is a mode in which we randomly sleep
|
// FuzzModeDelay is a mode in which we randomly sleep
|
||||||
FuzzModeDelay
|
FuzzModeDelay
|
||||||
|
|
||||||
|
// LogFormatPlain is a format for colored text
|
||||||
|
LogFormatPlain = "plain"
|
||||||
|
// LogFormatJSON is a format for json output
|
||||||
|
LogFormatJSON = "json"
|
||||||
)
|
)
|
||||||
|
|
||||||
// NOTE: Most of the structs & relevant comments + the
|
// NOTE: Most of the structs & relevant comments + the
|
||||||
@@ -94,6 +99,9 @@ func (cfg *Config) SetRoot(root string) *Config {
|
|||||||
// ValidateBasic performs basic validation (checking param bounds, etc.) and
|
// ValidateBasic performs basic validation (checking param bounds, etc.) and
|
||||||
// returns an error if any check fails.
|
// returns an error if any check fails.
|
||||||
func (cfg *Config) ValidateBasic() error {
|
func (cfg *Config) ValidateBasic() error {
|
||||||
|
if err := cfg.BaseConfig.ValidateBasic(); err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
if err := cfg.RPC.ValidateBasic(); err != nil {
|
if err := cfg.RPC.ValidateBasic(); err != nil {
|
||||||
return errors.Wrap(err, "Error in [rpc] section")
|
return errors.Wrap(err, "Error in [rpc] section")
|
||||||
}
|
}
|
||||||
@@ -145,6 +153,9 @@ type BaseConfig struct {
|
|||||||
// Output level for logging
|
// Output level for logging
|
||||||
LogLevel string `mapstructure:"log_level"`
|
LogLevel string `mapstructure:"log_level"`
|
||||||
|
|
||||||
|
// Output format: 'plain' (colored text) or 'json'
|
||||||
|
LogFormat string `mapstructure:"log_format"`
|
||||||
|
|
||||||
// Path to the JSON file containing the initial validator set and other meta data
|
// Path to the JSON file containing the initial validator set and other meta data
|
||||||
Genesis string `mapstructure:"genesis_file"`
|
Genesis string `mapstructure:"genesis_file"`
|
||||||
|
|
||||||
@@ -179,6 +190,7 @@ func DefaultBaseConfig() BaseConfig {
|
|||||||
ProxyApp: "tcp://127.0.0.1:26658",
|
ProxyApp: "tcp://127.0.0.1:26658",
|
||||||
ABCI: "socket",
|
ABCI: "socket",
|
||||||
LogLevel: DefaultPackageLogLevels(),
|
LogLevel: DefaultPackageLogLevels(),
|
||||||
|
LogFormat: LogFormatPlain,
|
||||||
ProfListenAddress: "",
|
ProfListenAddress: "",
|
||||||
FastSync: true,
|
FastSync: true,
|
||||||
FilterPeers: false,
|
FilterPeers: false,
|
||||||
@@ -221,6 +233,17 @@ func (cfg BaseConfig) DBDir() string {
|
|||||||
return rootify(cfg.DBPath, cfg.RootDir)
|
return rootify(cfg.DBPath, cfg.RootDir)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// ValidateBasic performs basic validation (checking param bounds, etc.) and
|
||||||
|
// returns an error if any check fails.
|
||||||
|
func (cfg BaseConfig) ValidateBasic() error {
|
||||||
|
switch cfg.LogFormat {
|
||||||
|
case LogFormatPlain, LogFormatJSON:
|
||||||
|
default:
|
||||||
|
return errors.New("unknown log_format (must be 'plain' or 'json')")
|
||||||
|
}
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
// DefaultLogLevel returns a default log level of "error"
|
// DefaultLogLevel returns a default log level of "error"
|
||||||
func DefaultLogLevel() string {
|
func DefaultLogLevel() string {
|
||||||
return "error"
|
return "error"
|
||||||
|
@@ -86,6 +86,9 @@ db_dir = "{{ js .BaseConfig.DBPath }}"
|
|||||||
# Output level for logging, including package level options
|
# Output level for logging, including package level options
|
||||||
log_level = "{{ .BaseConfig.LogLevel }}"
|
log_level = "{{ .BaseConfig.LogLevel }}"
|
||||||
|
|
||||||
|
# Output format: 'plain' (colored text) or 'json'
|
||||||
|
log_format = "{{ .BaseConfig.LogFormat }}"
|
||||||
|
|
||||||
##### additional base config options #####
|
##### additional base config options #####
|
||||||
|
|
||||||
# Path to the JSON file containing the initial validator set and other meta data
|
# Path to the JSON file containing the initial validator set and other meta data
|
||||||
@@ -257,6 +260,9 @@ create_empty_blocks_interval = "{{ .Consensus.CreateEmptyBlocksInterval }}"
|
|||||||
peer_gossip_sleep_duration = "{{ .Consensus.PeerGossipSleepDuration }}"
|
peer_gossip_sleep_duration = "{{ .Consensus.PeerGossipSleepDuration }}"
|
||||||
peer_query_maj23_sleep_duration = "{{ .Consensus.PeerQueryMaj23SleepDuration }}"
|
peer_query_maj23_sleep_duration = "{{ .Consensus.PeerQueryMaj23SleepDuration }}"
|
||||||
|
|
||||||
|
# Block time parameters. Corresponds to the minimum time increment between consecutive blocks.
|
||||||
|
blocktime_iota = "{{ .Consensus.BlockTimeIota }}"
|
||||||
|
|
||||||
##### transactions indexer configuration options #####
|
##### transactions indexer configuration options #####
|
||||||
[tx_index]
|
[tx_index]
|
||||||
|
|
||||||
|
@@ -405,8 +405,38 @@ func ensureNewVote(voteCh <-chan interface{}, height int64, round int) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func ensureNewRound(roundCh <-chan interface{}, height int64, round int) {
|
func ensureNewRound(roundCh <-chan interface{}, height int64, round int) {
|
||||||
ensureNewEvent(roundCh, height, round, ensureTimeout,
|
select {
|
||||||
"Timeout expired while waiting for NewRound event")
|
case <-time.After(ensureTimeout):
|
||||||
|
panic("Timeout expired while waiting for NewRound event")
|
||||||
|
case ev := <-roundCh:
|
||||||
|
rs, ok := ev.(types.EventDataNewRound)
|
||||||
|
if !ok {
|
||||||
|
panic(
|
||||||
|
fmt.Sprintf(
|
||||||
|
"expected a EventDataNewRound, got %v.Wrong subscription channel?",
|
||||||
|
reflect.TypeOf(rs)))
|
||||||
|
}
|
||||||
|
if rs.Height != height {
|
||||||
|
panic(fmt.Sprintf("expected height %v, got %v", height, rs.Height))
|
||||||
|
}
|
||||||
|
if rs.Round != round {
|
||||||
|
panic(fmt.Sprintf("expected round %v, got %v", round, rs.Round))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func ensureProposalHeartbeat(heartbeatCh <-chan interface{}) {
|
||||||
|
select {
|
||||||
|
case <-time.After(ensureTimeout):
|
||||||
|
panic("Timeout expired while waiting for ProposalHeartbeat event")
|
||||||
|
case ev := <-heartbeatCh:
|
||||||
|
heartbeat, ok := ev.(types.EventDataProposalHeartbeat)
|
||||||
|
if !ok {
|
||||||
|
panic(fmt.Sprintf("expected a *types.EventDataProposalHeartbeat, "+
|
||||||
|
"got %v. wrong subscription channel?",
|
||||||
|
reflect.TypeOf(heartbeat)))
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
func ensureNewTimeout(timeoutCh <-chan interface{}, height int64, round int, timeout int64) {
|
func ensureNewTimeout(timeoutCh <-chan interface{}, height int64, round int, timeout int64) {
|
||||||
@@ -416,8 +446,24 @@ func ensureNewTimeout(timeoutCh <-chan interface{}, height int64, round int, tim
|
|||||||
}
|
}
|
||||||
|
|
||||||
func ensureNewProposal(proposalCh <-chan interface{}, height int64, round int) {
|
func ensureNewProposal(proposalCh <-chan interface{}, height int64, round int) {
|
||||||
ensureNewEvent(proposalCh, height, round, ensureTimeout,
|
select {
|
||||||
"Timeout expired while waiting for NewProposal event")
|
case <-time.After(ensureTimeout):
|
||||||
|
panic("Timeout expired while waiting for NewProposal event")
|
||||||
|
case ev := <-proposalCh:
|
||||||
|
rs, ok := ev.(types.EventDataCompleteProposal)
|
||||||
|
if !ok {
|
||||||
|
panic(
|
||||||
|
fmt.Sprintf(
|
||||||
|
"expected a EventDataCompleteProposal, got %v.Wrong subscription channel?",
|
||||||
|
reflect.TypeOf(rs)))
|
||||||
|
}
|
||||||
|
if rs.Height != height {
|
||||||
|
panic(fmt.Sprintf("expected height %v, got %v", height, rs.Height))
|
||||||
|
}
|
||||||
|
if rs.Round != round {
|
||||||
|
panic(fmt.Sprintf("expected round %v, got %v", round, rs.Round))
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
func ensureNewValidBlock(validBlockCh <-chan interface{}, height int64, round int) {
|
func ensureNewValidBlock(validBlockCh <-chan interface{}, height int64, round int) {
|
||||||
@@ -492,6 +538,30 @@ func ensureVote(voteCh <-chan interface{}, height int64, round int,
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func ensureProposal(proposalCh <-chan interface{}, height int64, round int, propId types.BlockID) {
|
||||||
|
select {
|
||||||
|
case <-time.After(ensureTimeout):
|
||||||
|
panic("Timeout expired while waiting for NewProposal event")
|
||||||
|
case ev := <-proposalCh:
|
||||||
|
rs, ok := ev.(types.EventDataCompleteProposal)
|
||||||
|
if !ok {
|
||||||
|
panic(
|
||||||
|
fmt.Sprintf(
|
||||||
|
"expected a EventDataCompleteProposal, got %v.Wrong subscription channel?",
|
||||||
|
reflect.TypeOf(rs)))
|
||||||
|
}
|
||||||
|
if rs.Height != height {
|
||||||
|
panic(fmt.Sprintf("expected height %v, got %v", height, rs.Height))
|
||||||
|
}
|
||||||
|
if rs.Round != round {
|
||||||
|
panic(fmt.Sprintf("expected round %v, got %v", round, rs.Round))
|
||||||
|
}
|
||||||
|
if !rs.BlockID.Equals(propId) {
|
||||||
|
panic("Proposed block does not match expected block")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
func ensurePrecommit(voteCh <-chan interface{}, height int64, round int) {
|
func ensurePrecommit(voteCh <-chan interface{}, height int64, round int) {
|
||||||
ensureVote(voteCh, height, round, types.PrecommitType)
|
ensureVote(voteCh, height, round, types.PrecommitType)
|
||||||
}
|
}
|
||||||
|
@@ -71,18 +71,18 @@ func TestMempoolProgressInHigherRound(t *testing.T) {
|
|||||||
}
|
}
|
||||||
startTestRound(cs, height, round)
|
startTestRound(cs, height, round)
|
||||||
|
|
||||||
ensureNewRoundStep(newRoundCh, height, round) // first round at first height
|
ensureNewRound(newRoundCh, height, round) // first round at first height
|
||||||
ensureNewEventOnChannel(newBlockCh) // first block gets committed
|
ensureNewEventOnChannel(newBlockCh) // first block gets committed
|
||||||
|
|
||||||
height = height + 1 // moving to the next height
|
height = height + 1 // moving to the next height
|
||||||
round = 0
|
round = 0
|
||||||
|
|
||||||
ensureNewRoundStep(newRoundCh, height, round) // first round at next height
|
ensureNewRound(newRoundCh, height, round) // first round at next height
|
||||||
deliverTxsRange(cs, 0, 1) // we deliver txs, but dont set a proposal so we get the next round
|
deliverTxsRange(cs, 0, 1) // we deliver txs, but dont set a proposal so we get the next round
|
||||||
ensureNewTimeout(timeoutCh, height, round, cs.config.TimeoutPropose.Nanoseconds())
|
ensureNewTimeout(timeoutCh, height, round, cs.config.TimeoutPropose.Nanoseconds())
|
||||||
|
|
||||||
round = round + 1 // moving to the next round
|
round = round + 1 // moving to the next round
|
||||||
ensureNewRoundStep(newRoundCh, height, round) // wait for the next round
|
ensureNewRound(newRoundCh, height, round) // wait for the next round
|
||||||
ensureNewEventOnChannel(newBlockCh) // now we can commit the block
|
ensureNewEventOnChannel(newBlockCh) // now we can commit the block
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -402,7 +402,7 @@ func (conR *ConsensusReactor) unsubscribeFromBroadcastEvents() {
|
|||||||
|
|
||||||
func (conR *ConsensusReactor) broadcastProposalHeartbeatMessage(hb *types.Heartbeat) {
|
func (conR *ConsensusReactor) broadcastProposalHeartbeatMessage(hb *types.Heartbeat) {
|
||||||
conR.Logger.Debug("Broadcasting proposal heartbeat message",
|
conR.Logger.Debug("Broadcasting proposal heartbeat message",
|
||||||
"height", hb.Height, "round", hb.Round, "sequence", hb.Sequence)
|
"height", hb.Height, "round", hb.Round, "sequence", hb.Sequence, "address", hb.ValidatorAddress)
|
||||||
msg := &ProposalHeartbeatMessage{hb}
|
msg := &ProposalHeartbeatMessage{hb}
|
||||||
conR.Switch.Broadcast(StateChannel, cdc.MustMarshalBinaryBare(msg))
|
conR.Switch.Broadcast(StateChannel, cdc.MustMarshalBinaryBare(msg))
|
||||||
}
|
}
|
||||||
|
@@ -276,7 +276,12 @@ func (h *Handshaker) ReplayBlocks(
|
|||||||
|
|
||||||
// If appBlockHeight == 0 it means that we are at genesis and hence should send InitChain.
|
// If appBlockHeight == 0 it means that we are at genesis and hence should send InitChain.
|
||||||
if appBlockHeight == 0 {
|
if appBlockHeight == 0 {
|
||||||
nextVals := types.TM2PB.ValidatorUpdates(state.NextValidators) // state.Validators would work too.
|
validators := make([]*types.Validator, len(h.genDoc.Validators))
|
||||||
|
for i, val := range h.genDoc.Validators {
|
||||||
|
validators[i] = types.NewValidator(val.PubKey, val.Power)
|
||||||
|
}
|
||||||
|
validatorSet := types.NewValidatorSet(validators)
|
||||||
|
nextVals := types.TM2PB.ValidatorUpdates(validatorSet)
|
||||||
csParams := types.TM2PB.ConsensusParams(h.genDoc.ConsensusParams)
|
csParams := types.TM2PB.ConsensusParams(h.genDoc.ConsensusParams)
|
||||||
req := abci.RequestInitChain{
|
req := abci.RequestInitChain{
|
||||||
Time: h.genDoc.GenesisTime,
|
Time: h.genDoc.GenesisTime,
|
||||||
|
@@ -315,28 +315,21 @@ func testHandshakeReplay(t *testing.T, nBlocks int, mode uint) {
|
|||||||
config := ResetConfig("proxy_test_")
|
config := ResetConfig("proxy_test_")
|
||||||
|
|
||||||
walBody, err := WALWithNBlocks(NUM_BLOCKS)
|
walBody, err := WALWithNBlocks(NUM_BLOCKS)
|
||||||
if err != nil {
|
require.NoError(t, err)
|
||||||
t.Fatal(err)
|
|
||||||
}
|
|
||||||
walFile := tempWALWithData(walBody)
|
walFile := tempWALWithData(walBody)
|
||||||
config.Consensus.SetWalFile(walFile)
|
config.Consensus.SetWalFile(walFile)
|
||||||
|
|
||||||
privVal := privval.LoadFilePV(config.PrivValidatorFile())
|
privVal := privval.LoadFilePV(config.PrivValidatorFile())
|
||||||
|
|
||||||
wal, err := NewWAL(walFile)
|
wal, err := NewWAL(walFile)
|
||||||
if err != nil {
|
require.NoError(t, err)
|
||||||
t.Fatal(err)
|
|
||||||
}
|
|
||||||
wal.SetLogger(log.TestingLogger())
|
wal.SetLogger(log.TestingLogger())
|
||||||
if err := wal.Start(); err != nil {
|
err = wal.Start()
|
||||||
t.Fatal(err)
|
require.NoError(t, err)
|
||||||
}
|
|
||||||
defer wal.Stop()
|
defer wal.Stop()
|
||||||
|
|
||||||
chain, commits, err := makeBlockchainFromWAL(wal)
|
chain, commits, err := makeBlockchainFromWAL(wal)
|
||||||
if err != nil {
|
require.NoError(t, err)
|
||||||
t.Fatalf(err.Error())
|
|
||||||
}
|
|
||||||
|
|
||||||
stateDB, state, store := stateAndStore(config, privVal.GetPubKey(), kvstore.ProtocolVersion)
|
stateDB, state, store := stateAndStore(config, privVal.GetPubKey(), kvstore.ProtocolVersion)
|
||||||
store.chain = chain
|
store.chain = chain
|
||||||
|
@@ -324,10 +324,11 @@ func (cs *ConsensusState) startRoutines(maxSteps int) {
|
|||||||
go cs.receiveRoutine(maxSteps)
|
go cs.receiveRoutine(maxSteps)
|
||||||
}
|
}
|
||||||
|
|
||||||
// OnStop implements cmn.Service. It stops all routines and waits for the WAL to finish.
|
// OnStop implements cmn.Service.
|
||||||
func (cs *ConsensusState) OnStop() {
|
func (cs *ConsensusState) OnStop() {
|
||||||
cs.evsw.Stop()
|
cs.evsw.Stop()
|
||||||
cs.timeoutTicker.Stop()
|
cs.timeoutTicker.Stop()
|
||||||
|
// WAL is stopped in receiveRoutine.
|
||||||
}
|
}
|
||||||
|
|
||||||
// Wait waits for the the main routine to return.
|
// Wait waits for the the main routine to return.
|
||||||
@@ -772,7 +773,7 @@ func (cs *ConsensusState) enterNewRound(height int64, round int) {
|
|||||||
cs.Votes.SetRound(round + 1) // also track next round (round+1) to allow round-skipping
|
cs.Votes.SetRound(round + 1) // also track next round (round+1) to allow round-skipping
|
||||||
cs.triggeredTimeoutPrecommit = false
|
cs.triggeredTimeoutPrecommit = false
|
||||||
|
|
||||||
cs.eventBus.PublishEventNewRound(cs.RoundStateEvent())
|
cs.eventBus.PublishEventNewRound(cs.NewRoundEvent())
|
||||||
cs.metrics.Rounds.Set(float64(round))
|
cs.metrics.Rounds.Set(float64(round))
|
||||||
|
|
||||||
// Wait for txs to be available in the mempool
|
// Wait for txs to be available in the mempool
|
||||||
@@ -802,8 +803,14 @@ func (cs *ConsensusState) needProofBlock(height int64) bool {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func (cs *ConsensusState) proposalHeartbeat(height int64, round int) {
|
func (cs *ConsensusState) proposalHeartbeat(height int64, round int) {
|
||||||
counter := 0
|
logger := cs.Logger.With("height", height, "round", round)
|
||||||
addr := cs.privValidator.GetAddress()
|
addr := cs.privValidator.GetAddress()
|
||||||
|
|
||||||
|
if !cs.Validators.HasAddress(addr) {
|
||||||
|
logger.Debug("Not sending proposalHearbeat. This node is not a validator", "addr", addr, "vals", cs.Validators)
|
||||||
|
return
|
||||||
|
}
|
||||||
|
counter := 0
|
||||||
valIndex, _ := cs.Validators.GetByAddress(addr)
|
valIndex, _ := cs.Validators.GetByAddress(addr)
|
||||||
chainID := cs.state.ChainID
|
chainID := cs.state.ChainID
|
||||||
for {
|
for {
|
||||||
@@ -1462,7 +1469,7 @@ func (cs *ConsensusState) addProposalBlockPart(msg *BlockPartMessage, peerID p2p
|
|||||||
}
|
}
|
||||||
// NOTE: it's possible to receive complete proposal blocks for future rounds without having the proposal
|
// NOTE: it's possible to receive complete proposal blocks for future rounds without having the proposal
|
||||||
cs.Logger.Info("Received complete proposal block", "height", cs.ProposalBlock.Height, "hash", cs.ProposalBlock.Hash())
|
cs.Logger.Info("Received complete proposal block", "height", cs.ProposalBlock.Height, "hash", cs.ProposalBlock.Hash())
|
||||||
cs.eventBus.PublishEventCompleteProposal(cs.RoundStateEvent())
|
cs.eventBus.PublishEventCompleteProposal(cs.CompleteProposalEvent())
|
||||||
|
|
||||||
// Update Valid* if we can.
|
// Update Valid* if we can.
|
||||||
prevotes := cs.Votes.Prevotes(cs.Round)
|
prevotes := cs.Votes.Prevotes(cs.Round)
|
||||||
|
@@ -11,6 +11,8 @@ import (
|
|||||||
"github.com/stretchr/testify/require"
|
"github.com/stretchr/testify/require"
|
||||||
|
|
||||||
cstypes "github.com/tendermint/tendermint/consensus/types"
|
cstypes "github.com/tendermint/tendermint/consensus/types"
|
||||||
|
tmevents "github.com/tendermint/tendermint/libs/events"
|
||||||
|
|
||||||
cmn "github.com/tendermint/tendermint/libs/common"
|
cmn "github.com/tendermint/tendermint/libs/common"
|
||||||
"github.com/tendermint/tendermint/libs/log"
|
"github.com/tendermint/tendermint/libs/log"
|
||||||
tmpubsub "github.com/tendermint/tendermint/libs/pubsub"
|
tmpubsub "github.com/tendermint/tendermint/libs/pubsub"
|
||||||
@@ -197,9 +199,8 @@ func TestStateBadProposal(t *testing.T) {
|
|||||||
stateHash[0] = byte((stateHash[0] + 1) % 255)
|
stateHash[0] = byte((stateHash[0] + 1) % 255)
|
||||||
propBlock.AppHash = stateHash
|
propBlock.AppHash = stateHash
|
||||||
propBlockParts := propBlock.MakePartSet(partSize)
|
propBlockParts := propBlock.MakePartSet(partSize)
|
||||||
proposal := types.NewProposal(
|
blockID := types.BlockID{propBlock.Hash(), propBlockParts.Header()}
|
||||||
vs2.Height, round, -1,
|
proposal := types.NewProposal(vs2.Height, round, -1, blockID)
|
||||||
types.BlockID{propBlock.Hash(), propBlockParts.Header()})
|
|
||||||
if err := vs2.SignProposal(config.ChainID(), proposal); err != nil {
|
if err := vs2.SignProposal(config.ChainID(), proposal); err != nil {
|
||||||
t.Fatal("failed to sign bad proposal", err)
|
t.Fatal("failed to sign bad proposal", err)
|
||||||
}
|
}
|
||||||
@@ -213,7 +214,7 @@ func TestStateBadProposal(t *testing.T) {
|
|||||||
startTestRound(cs1, height, round)
|
startTestRound(cs1, height, round)
|
||||||
|
|
||||||
// wait for proposal
|
// wait for proposal
|
||||||
ensureNewProposal(proposalCh, height, round)
|
ensureProposal(proposalCh, height, round, blockID)
|
||||||
|
|
||||||
// wait for prevote
|
// wait for prevote
|
||||||
ensurePrevote(voteCh, height, round)
|
ensurePrevote(voteCh, height, round)
|
||||||
@@ -1028,6 +1029,33 @@ func TestSetValidBlockOnDelayedPrevote(t *testing.T) {
|
|||||||
assert.True(t, rs.ValidRound == round)
|
assert.True(t, rs.ValidRound == round)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// regression for #2518
|
||||||
|
func TestNoHearbeatWhenNotValidator(t *testing.T) {
|
||||||
|
cs, _ := randConsensusState(4)
|
||||||
|
cs.Validators = types.NewValidatorSet(nil) // make sure we are not in the validator set
|
||||||
|
|
||||||
|
cs.evsw.AddListenerForEvent("testing", types.EventProposalHeartbeat,
|
||||||
|
func(data tmevents.EventData) {
|
||||||
|
t.Errorf("Should not have broadcasted heartbeat")
|
||||||
|
})
|
||||||
|
go cs.proposalHeartbeat(10, 1)
|
||||||
|
|
||||||
|
cs.Stop()
|
||||||
|
|
||||||
|
// if a faulty implementation sends an event, we should wait here a little bit to make sure we don't miss it by prematurely leaving the test method
|
||||||
|
time.Sleep((proposalHeartbeatIntervalSeconds + 1) * time.Second)
|
||||||
|
}
|
||||||
|
|
||||||
|
// regression for #2518
|
||||||
|
func TestHearbeatWhenWeAreValidator(t *testing.T) {
|
||||||
|
cs, _ := randConsensusState(4)
|
||||||
|
heartbeatCh := subscribe(cs.eventBus, types.EventQueryProposalHeartbeat)
|
||||||
|
|
||||||
|
go cs.proposalHeartbeat(10, 1)
|
||||||
|
ensureProposalHeartbeat(heartbeatCh)
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
// What we want:
|
// What we want:
|
||||||
// P0 miss to lock B as Proposal Block is missing, but set valid block to B after
|
// P0 miss to lock B as Proposal Block is missing, but set valid block to B after
|
||||||
// receiving delayed Block Proposal.
|
// receiving delayed Block Proposal.
|
||||||
|
@@ -55,3 +55,31 @@ func (prs PeerRoundState) StringIndented(indent string) string {
|
|||||||
indent, prs.CatchupCommit, prs.CatchupCommitRound,
|
indent, prs.CatchupCommit, prs.CatchupCommitRound,
|
||||||
indent)
|
indent)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
//-----------------------------------------------------------
|
||||||
|
// These methods are for Protobuf Compatibility
|
||||||
|
|
||||||
|
// Size returns the size of the amino encoding, in bytes.
|
||||||
|
func (ps *PeerRoundState) Size() int {
|
||||||
|
bs, _ := ps.Marshal()
|
||||||
|
return len(bs)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Marshal returns the amino encoding.
|
||||||
|
func (ps *PeerRoundState) Marshal() ([]byte, error) {
|
||||||
|
return cdc.MarshalBinaryBare(ps)
|
||||||
|
}
|
||||||
|
|
||||||
|
// MarshalTo calls Marshal and copies to the given buffer.
|
||||||
|
func (ps *PeerRoundState) MarshalTo(data []byte) (int, error) {
|
||||||
|
bs, err := ps.Marshal()
|
||||||
|
if err != nil {
|
||||||
|
return -1, err
|
||||||
|
}
|
||||||
|
return copy(data, bs), nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Unmarshal deserializes from amino encoded form.
|
||||||
|
func (ps *PeerRoundState) Unmarshal(bs []byte) error {
|
||||||
|
return cdc.UnmarshalBinaryBare(bs, ps)
|
||||||
|
}
|
||||||
|
@@ -112,18 +112,50 @@ func (rs *RoundState) RoundStateSimple() RoundStateSimple {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// NewRoundEvent returns the RoundState with proposer information as an event.
|
||||||
|
func (rs *RoundState) NewRoundEvent() types.EventDataNewRound {
|
||||||
|
addr := rs.Validators.GetProposer().Address
|
||||||
|
idx, _ := rs.Validators.GetByAddress(addr)
|
||||||
|
|
||||||
|
return types.EventDataNewRound{
|
||||||
|
Height: rs.Height,
|
||||||
|
Round: rs.Round,
|
||||||
|
Step: rs.Step.String(),
|
||||||
|
Proposer: types.ValidatorInfo{
|
||||||
|
Address: addr,
|
||||||
|
Index: idx,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// CompleteProposalEvent returns information about a proposed block as an event.
|
||||||
|
func (rs *RoundState) CompleteProposalEvent() types.EventDataCompleteProposal {
|
||||||
|
// We must construct BlockID from ProposalBlock and ProposalBlockParts
|
||||||
|
// cs.Proposal is not guaranteed to be set when this function is called
|
||||||
|
blockId := types.BlockID{
|
||||||
|
Hash: rs.ProposalBlock.Hash(),
|
||||||
|
PartsHeader: rs.ProposalBlockParts.Header(),
|
||||||
|
}
|
||||||
|
|
||||||
|
return types.EventDataCompleteProposal{
|
||||||
|
Height: rs.Height,
|
||||||
|
Round: rs.Round,
|
||||||
|
Step: rs.Step.String(),
|
||||||
|
BlockID: blockId,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
// RoundStateEvent returns the H/R/S of the RoundState as an event.
|
// RoundStateEvent returns the H/R/S of the RoundState as an event.
|
||||||
func (rs *RoundState) RoundStateEvent() types.EventDataRoundState {
|
func (rs *RoundState) RoundStateEvent() types.EventDataRoundState {
|
||||||
// copy the RoundState.
|
// copy the RoundState.
|
||||||
// TODO: if we want to avoid this, we may need synchronous events after all
|
// TODO: if we want to avoid this, we may need synchronous events after all
|
||||||
rsCopy := *rs
|
rsCopy := *rs
|
||||||
edrs := types.EventDataRoundState{
|
return types.EventDataRoundState{
|
||||||
Height: rs.Height,
|
Height: rs.Height,
|
||||||
Round: rs.Round,
|
Round: rs.Round,
|
||||||
Step: rs.Step.String(),
|
Step: rs.Step.String(),
|
||||||
RoundState: &rsCopy,
|
RoundState: &rsCopy,
|
||||||
}
|
}
|
||||||
return edrs
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// String returns a string
|
// String returns a string
|
||||||
@@ -169,3 +201,31 @@ func (rs *RoundState) StringShort() string {
|
|||||||
return fmt.Sprintf(`RoundState{H:%v R:%v S:%v ST:%v}`,
|
return fmt.Sprintf(`RoundState{H:%v R:%v S:%v ST:%v}`,
|
||||||
rs.Height, rs.Round, rs.Step, rs.StartTime)
|
rs.Height, rs.Round, rs.Step, rs.StartTime)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
//-----------------------------------------------------------
|
||||||
|
// These methods are for Protobuf Compatibility
|
||||||
|
|
||||||
|
// Size returns the size of the amino encoding, in bytes.
|
||||||
|
func (rs *RoundStateSimple) Size() int {
|
||||||
|
bs, _ := rs.Marshal()
|
||||||
|
return len(bs)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Marshal returns the amino encoding.
|
||||||
|
func (rs *RoundStateSimple) Marshal() ([]byte, error) {
|
||||||
|
return cdc.MarshalBinaryBare(rs)
|
||||||
|
}
|
||||||
|
|
||||||
|
// MarshalTo calls Marshal and copies to the given buffer.
|
||||||
|
func (rs *RoundStateSimple) MarshalTo(data []byte) (int, error) {
|
||||||
|
bs, err := rs.Marshal()
|
||||||
|
if err != nil {
|
||||||
|
return -1, err
|
||||||
|
}
|
||||||
|
return copy(data, bs), nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Unmarshal deserializes from amino encoded form.
|
||||||
|
func (rs *RoundStateSimple) Unmarshal(bs []byte) error {
|
||||||
|
return cdc.UnmarshalBinaryBare(bs, rs)
|
||||||
|
}
|
||||||
|
@@ -7,13 +7,13 @@ import (
|
|||||||
"io/ioutil"
|
"io/ioutil"
|
||||||
"os"
|
"os"
|
||||||
"path/filepath"
|
"path/filepath"
|
||||||
|
|
||||||
// "sync"
|
// "sync"
|
||||||
"testing"
|
"testing"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/tendermint/tendermint/consensus/types"
|
"github.com/tendermint/tendermint/consensus/types"
|
||||||
"github.com/tendermint/tendermint/libs/autofile"
|
"github.com/tendermint/tendermint/libs/autofile"
|
||||||
|
"github.com/tendermint/tendermint/libs/log"
|
||||||
tmtypes "github.com/tendermint/tendermint/types"
|
tmtypes "github.com/tendermint/tendermint/types"
|
||||||
tmtime "github.com/tendermint/tendermint/types/time"
|
tmtime "github.com/tendermint/tendermint/types/time"
|
||||||
|
|
||||||
@@ -23,29 +23,27 @@ import (
|
|||||||
|
|
||||||
func TestWALTruncate(t *testing.T) {
|
func TestWALTruncate(t *testing.T) {
|
||||||
walDir, err := ioutil.TempDir("", "wal")
|
walDir, err := ioutil.TempDir("", "wal")
|
||||||
if err != nil {
|
require.NoError(t, err)
|
||||||
panic(fmt.Errorf("failed to create temp WAL file: %v", err))
|
|
||||||
}
|
|
||||||
defer os.RemoveAll(walDir)
|
defer os.RemoveAll(walDir)
|
||||||
|
|
||||||
walFile := filepath.Join(walDir, "wal")
|
walFile := filepath.Join(walDir, "wal")
|
||||||
|
|
||||||
//this magic number 4K can truncate the content when RotateFile. defaultHeadSizeLimit(10M) is hard to simulate.
|
//this magic number 4K can truncate the content when RotateFile. defaultHeadSizeLimit(10M) is hard to simulate.
|
||||||
//this magic number 1 * time.Millisecond make RotateFile check frequently. defaultGroupCheckDuration(5s) is hard to simulate.
|
//this magic number 1 * time.Millisecond make RotateFile check frequently. defaultGroupCheckDuration(5s) is hard to simulate.
|
||||||
wal, err := NewWAL(walFile, autofile.GroupHeadSizeLimit(4096), autofile.GroupCheckDuration(1*time.Millisecond))
|
wal, err := NewWAL(walFile,
|
||||||
if err != nil {
|
autofile.GroupHeadSizeLimit(4096),
|
||||||
t.Fatal(err)
|
autofile.GroupCheckDuration(1*time.Millisecond),
|
||||||
}
|
)
|
||||||
|
require.NoError(t, err)
|
||||||
wal.Start()
|
wal.SetLogger(log.TestingLogger())
|
||||||
|
err = wal.Start()
|
||||||
|
require.NoError(t, err)
|
||||||
defer wal.Stop()
|
defer wal.Stop()
|
||||||
|
|
||||||
//60 block's size nearly 70K, greater than group's headBuf size(4096 * 10), when headBuf is full, truncate content will Flush to the file.
|
//60 block's size nearly 70K, greater than group's headBuf size(4096 * 10), when headBuf is full, truncate content will Flush to the file.
|
||||||
//at this time, RotateFile is called, truncate content exist in each file.
|
//at this time, RotateFile is called, truncate content exist in each file.
|
||||||
err = WALGenerateNBlocks(wal.Group(), 60)
|
err = WALGenerateNBlocks(wal.Group(), 60)
|
||||||
if err != nil {
|
require.NoError(t, err)
|
||||||
t.Fatal(err)
|
|
||||||
}
|
|
||||||
|
|
||||||
time.Sleep(1 * time.Millisecond) //wait groupCheckDuration, make sure RotateFile run
|
time.Sleep(1 * time.Millisecond) //wait groupCheckDuration, make sure RotateFile run
|
||||||
|
|
||||||
@@ -99,9 +97,8 @@ func TestWALSearchForEndHeight(t *testing.T) {
|
|||||||
walFile := tempWALWithData(walBody)
|
walFile := tempWALWithData(walBody)
|
||||||
|
|
||||||
wal, err := NewWAL(walFile)
|
wal, err := NewWAL(walFile)
|
||||||
if err != nil {
|
require.NoError(t, err)
|
||||||
t.Fatal(err)
|
wal.SetLogger(log.TestingLogger())
|
||||||
}
|
|
||||||
|
|
||||||
h := int64(3)
|
h := int64(3)
|
||||||
gr, found, err := wal.SearchForEndHeight(h, &WALSearchOptions{})
|
gr, found, err := wal.SearchForEndHeight(h, &WALSearchOptions{})
|
||||||
|
@@ -21,7 +21,7 @@ For more details on using Tendermint, see the respective documentation for
|
|||||||
|
|
||||||
## Contribute
|
## Contribute
|
||||||
|
|
||||||
To contribute to the documentation, see [this file](./DOCS_README.md) for details of the build process and
|
To contribute to the documentation, see [this file](https://github.com/tendermint/tendermint/blob/master/docs/DOCS_README.md) for details of the build process and
|
||||||
considerations when making changes.
|
considerations when making changes.
|
||||||
|
|
||||||
## Version
|
## Version
|
||||||
|
@@ -5,14 +5,17 @@ implementations:
|
|||||||
|
|
||||||
- FilePV uses an unencrypted private key in a "priv_validator.json" file - no
|
- FilePV uses an unencrypted private key in a "priv_validator.json" file - no
|
||||||
configuration required (just `tendermint init`).
|
configuration required (just `tendermint init`).
|
||||||
- SocketPV uses a socket to send signing requests to another process - user is
|
- TCPVal and IPCVal use TCP and Unix sockets respectively to send signing requests
|
||||||
responsible for starting that process themselves.
|
to another process - the user is responsible for starting that process themselves.
|
||||||
|
|
||||||
The SocketPV address can be provided via flags at the command line - doing so
|
Both TCPVal and IPCVal addresses can be provided via flags at the command line
|
||||||
will cause Tendermint to ignore any "priv_validator.json" file and to listen on
|
or in the configuration file; TCPVal addresses must be of the form
|
||||||
the given address for incoming connections from an external priv_validator
|
`tcp://<ip_address>:<port>` and IPCVal addresses `unix:///path/to/file.sock` -
|
||||||
process. It will halt any operation until at least one external process
|
doing so will cause Tendermint to ignore any private validator files.
|
||||||
succesfully connected.
|
|
||||||
|
TCPVal will listen on the given address for incoming connections from an external
|
||||||
|
private validator process. It will halt any operation until at least one external
|
||||||
|
process successfully connected.
|
||||||
|
|
||||||
The external priv_validator process will dial the address to connect to
|
The external priv_validator process will dial the address to connect to
|
||||||
Tendermint, and then Tendermint will send requests on the ensuing connection to
|
Tendermint, and then Tendermint will send requests on the ensuing connection to
|
||||||
@@ -21,6 +24,9 @@ but the Tendermint process makes all requests. In a later stage we're going to
|
|||||||
support multiple validators for fault tolerance. To prevent double signing they
|
support multiple validators for fault tolerance. To prevent double signing they
|
||||||
need to be synced, which is deferred to an external solution (see #1185).
|
need to be synced, which is deferred to an external solution (see #1185).
|
||||||
|
|
||||||
|
Conversely, IPCVal will make an outbound connection to an existing socket opened
|
||||||
|
by the external validator process.
|
||||||
|
|
||||||
In addition, Tendermint will provide implementations that can be run in that
|
In addition, Tendermint will provide implementations that can be run in that
|
||||||
external process. These include:
|
external process. These include:
|
||||||
|
|
||||||
|
40
docs/architecture/adr-035-documentation.md
Normal file
40
docs/architecture/adr-035-documentation.md
Normal file
@@ -0,0 +1,40 @@
|
|||||||
|
# ADR 035: Documentation
|
||||||
|
|
||||||
|
Author: @zramsay (Zach Ramsay)
|
||||||
|
|
||||||
|
## Changelog
|
||||||
|
|
||||||
|
### November 2nd 2018
|
||||||
|
|
||||||
|
- initial write-up
|
||||||
|
|
||||||
|
## Context
|
||||||
|
|
||||||
|
The Tendermint documentation has undergone several changes until settling on the current model. Originally, the documentation was hosted on the website and had to be updated asynchronously from the code. Along with the other repositories requiring documentation, the whole stack moved to using Read The Docs to automatically generate, publish, and host the documentation. This, however, was insufficient; the RTD site had advertisement, it wasn't easily accessible to devs, didn't collect metrics, was another set of external links, etc.
|
||||||
|
|
||||||
|
## Decision
|
||||||
|
|
||||||
|
For two reasons, the decision was made to use VuePress:
|
||||||
|
|
||||||
|
1) ability to get metrics (implemented on both Tendermint and SDK)
|
||||||
|
2) host the documentation on the website as a `/docs` endpoint.
|
||||||
|
|
||||||
|
This is done while maintaining synchrony between the docs and code, i.e., the website is built whenever the docs are updated.
|
||||||
|
|
||||||
|
## Status
|
||||||
|
|
||||||
|
The two points above have been implemented; the `config.js` has a Google Analytics identifier and the documentation workflow has been up and running largely without problems for several months. Details about the documentation build & workflow can be found [here](../DOCS_README.md)
|
||||||
|
|
||||||
|
## Consequences
|
||||||
|
|
||||||
|
Because of the organizational seperation between Tendermint & Cosmos, there is a challenge of "what goes where" for certain aspects of documentation.
|
||||||
|
|
||||||
|
### Positive
|
||||||
|
|
||||||
|
This architecture is largely positive relative to prior docs arrangements.
|
||||||
|
|
||||||
|
### Negative
|
||||||
|
|
||||||
|
A significant portion of the docs automation / build process is in private repos with limited access/visibility to devs. However, these tasks are handled by the SRE team.
|
||||||
|
|
||||||
|
### Neutral
|
@@ -1,19 +1,36 @@
|
|||||||
# ADR 000: Template for an ADR
|
# ADR {ADR-NUMBER}: {TITLE}
|
||||||
|
|
||||||
Author:
|
|
||||||
|
|
||||||
## Changelog
|
## Changelog
|
||||||
|
* {date}: {changelog}
|
||||||
|
|
||||||
## Context
|
## Context
|
||||||
|
|
||||||
|
> This section contains all the context one needs to understand the current state, and why there is a problem. It should be as succinct as possible and introduce the high level idea behind the solution.
|
||||||
## Decision
|
## Decision
|
||||||
|
|
||||||
|
> This section explains all of the details of the proposed solution, including implementation details.
|
||||||
|
It should also describe affects / corollary items that may need to be changed as a part of this.
|
||||||
|
If the proposed change will be large, please also indicate a way to do the change to maximize ease of review.
|
||||||
|
(e.g. the optimal split of things to do between separate PR's)
|
||||||
|
|
||||||
## Status
|
## Status
|
||||||
|
|
||||||
|
> A decision may be "proposed" if it hasn't been agreed upon yet, or "accepted" once it is agreed upon. If a later ADR changes or reverses a decision, it may be marked as "deprecated" or "superseded" with a reference to its replacement.
|
||||||
|
|
||||||
|
{Deprecated|Proposed|Accepted}
|
||||||
|
|
||||||
## Consequences
|
## Consequences
|
||||||
|
|
||||||
|
> This section describes the consequences, after applying the decision. All consequences should be summarized here, not just the "positive" ones.
|
||||||
|
|
||||||
### Positive
|
### Positive
|
||||||
|
|
||||||
### Negative
|
### Negative
|
||||||
|
|
||||||
### Neutral
|
### Neutral
|
||||||
|
|
||||||
|
## References
|
||||||
|
|
||||||
|
> Are there any relevant PR comments, issues that led up to this, or articles referrenced for why we made the given design choice? If so link them here!
|
||||||
|
|
||||||
|
* {reference link}
|
||||||
|
@@ -95,9 +95,9 @@ wget https://github.com/google/leveldb/archive/v1.20.tar.gz && \
|
|||||||
tar -zxvf v1.20.tar.gz && \
|
tar -zxvf v1.20.tar.gz && \
|
||||||
cd leveldb-1.20/ && \
|
cd leveldb-1.20/ && \
|
||||||
make && \
|
make && \
|
||||||
cp -r out-static/lib* out-shared/lib* /usr/local/lib/ && \
|
sudo cp -r out-static/lib* out-shared/lib* /usr/local/lib/ && \
|
||||||
cd include/ && \
|
cd include/ && \
|
||||||
cp -r leveldb /usr/local/include/ && \
|
sudo cp -r leveldb /usr/local/include/ && \
|
||||||
sudo ldconfig && \
|
sudo ldconfig && \
|
||||||
rm -f v1.20.tar.gz
|
rm -f v1.20.tar.gz
|
||||||
```
|
```
|
||||||
@@ -109,8 +109,8 @@ Set database backend to cleveldb:
|
|||||||
db_backend = "cleveldb"
|
db_backend = "cleveldb"
|
||||||
```
|
```
|
||||||
|
|
||||||
To build Tendermint, run
|
To install Tendermint, run
|
||||||
|
|
||||||
```
|
```
|
||||||
CGO_LDFLAGS="-lsnappy" go build -ldflags "-X github.com/tendermint/tendermint/version.GitCommit=`git rev-parse --short=8 HEAD`" -tags "tendermint gcc" -o build/tendermint ./cmd/tendermint/
|
CGO_LDFLAGS="-lsnappy" go install -ldflags "-X github.com/tendermint/tendermint/version.GitCommit=`git rev-parse --short=8 HEAD`" -tags "tendermint gcc" -o build/tendermint ./cmd/tendermint/
|
||||||
```
|
```
|
||||||
|
@@ -45,7 +45,9 @@ include a `Tags` field in their `Response*`. Each tag is key-value pair denoting
|
|||||||
something about what happened during the methods execution.
|
something about what happened during the methods execution.
|
||||||
|
|
||||||
Tags can be used to index transactions and blocks according to what happened
|
Tags can be used to index transactions and blocks according to what happened
|
||||||
during their execution.
|
during their execution. Note that the set of tags returned for a block from
|
||||||
|
`BeginBlock` and `EndBlock` are merged. In case both methods return the same
|
||||||
|
tag, only the value defined in `EndBlock` is used.
|
||||||
|
|
||||||
Keys and values in tags must be UTF-8 encoded strings (e.g.
|
Keys and values in tags must be UTF-8 encoded strings (e.g.
|
||||||
"account.owner": "Bob", "balance": "100.0",
|
"account.owner": "Bob", "balance": "100.0",
|
||||||
|
@@ -59,22 +59,14 @@ You can simply use below table and concatenate Prefix || Length (of raw bytes) |
|
|||||||
| PubKeySecp256k1 | tendermint/PubKeySecp256k1 | 0xEB5AE987 | 0x21 | |
|
| PubKeySecp256k1 | tendermint/PubKeySecp256k1 | 0xEB5AE987 | 0x21 | |
|
||||||
| PrivKeyEd25519 | tendermint/PrivKeyEd25519 | 0xA3288910 | 0x40 | |
|
| PrivKeyEd25519 | tendermint/PrivKeyEd25519 | 0xA3288910 | 0x40 | |
|
||||||
| PrivKeySecp256k1 | tendermint/PrivKeySecp256k1 | 0xE1B0F79B | 0x20 | |
|
| PrivKeySecp256k1 | tendermint/PrivKeySecp256k1 | 0xE1B0F79B | 0x20 | |
|
||||||
| SignatureEd25519 | tendermint/SignatureEd25519 | 0x2031EA53 | 0x40 | |
|
| PubKeyMultisigThreshold | tendermint/PubKeyMultisigThreshold | 0x22C1F7E2 | variable | |
|
||||||
| SignatureSecp256k1 | tendermint/SignatureSecp256k1 | 0x7FC4A495 | variable |
|
|
||||||
|
|
||||||
|
|
### Example
|
||||||
|
|
||||||
### Examples
|
For example, the 33-byte (or 0x21-byte in hex) Secp256k1 pubkey
|
||||||
|
|
||||||
1. For example, the 33-byte (or 0x21-byte in hex) Secp256k1 pubkey
|
|
||||||
`020BD40F225A57ED383B440CF073BC5539D0341F5767D2BF2D78406D00475A2EE9`
|
`020BD40F225A57ED383B440CF073BC5539D0341F5767D2BF2D78406D00475A2EE9`
|
||||||
would be encoded as
|
would be encoded as
|
||||||
`EB5AE98221020BD40F225A57ED383B440CF073BC5539D0341F5767D2BF2D78406D00475A2EE9`
|
`EB5AE98721020BD40F225A57ED383B440CF073BC5539D0341F5767D2BF2D78406D00475A2EE9`
|
||||||
|
|
||||||
2. For example, the variable size Secp256k1 signature (in this particular example 70 or 0x46 bytes)
|
|
||||||
`304402201CD4B8C764D2FD8AF23ECFE6666CA8A53886D47754D951295D2D311E1FEA33BF02201E0F906BB1CF2C30EAACFFB032A7129358AFF96B9F79B06ACFFB18AC90C2ADD7`
|
|
||||||
would be encoded as
|
|
||||||
`16E1FEEA46304402201CD4B8C764D2FD8AF23ECFE6666CA8A53886D47754D951295D2D311E1FEA33BF02201E0F906BB1CF2C30EAACFFB032A7129358AFF96B9F79B06ACFFB18AC90C2ADD7`
|
|
||||||
|
|
||||||
### Addresses
|
### Addresses
|
||||||
|
|
||||||
|
@@ -79,31 +79,25 @@ func TotalVotingPower(vals []Validators) int64{
|
|||||||
ConsensusParams define various limits for blockchain data structures.
|
ConsensusParams define various limits for blockchain data structures.
|
||||||
Like validator sets, they are set during genesis and can be updated by the application through ABCI.
|
Like validator sets, they are set during genesis and can be updated by the application through ABCI.
|
||||||
|
|
||||||
```
|
```go
|
||||||
type ConsensusParams struct {
|
type ConsensusParams struct {
|
||||||
BlockSize
|
BlockSize
|
||||||
TxSize
|
Evidence
|
||||||
BlockGossip
|
Validator
|
||||||
EvidenceParams
|
|
||||||
}
|
}
|
||||||
|
|
||||||
type BlockSize struct {
|
type BlockSize struct {
|
||||||
MaxBytes int
|
MaxBytes int64
|
||||||
MaxGas int64
|
MaxGas int64
|
||||||
}
|
}
|
||||||
|
|
||||||
type TxSize struct {
|
type Evidence struct {
|
||||||
MaxBytes int
|
|
||||||
MaxGas int64
|
|
||||||
}
|
|
||||||
|
|
||||||
type BlockGossip struct {
|
|
||||||
BlockPartSizeBytes int
|
|
||||||
}
|
|
||||||
|
|
||||||
type EvidenceParams struct {
|
|
||||||
MaxAge int64
|
MaxAge int64
|
||||||
}
|
}
|
||||||
|
|
||||||
|
type Validator struct {
|
||||||
|
PubKeyTypes []string
|
||||||
|
}
|
||||||
```
|
```
|
||||||
|
|
||||||
#### BlockSize
|
#### BlockSize
|
||||||
@@ -115,20 +109,15 @@ otherwise.
|
|||||||
Blocks should additionally be limited by the amount of "gas" consumed by the
|
Blocks should additionally be limited by the amount of "gas" consumed by the
|
||||||
transactions in the block, though this is not yet implemented.
|
transactions in the block, though this is not yet implemented.
|
||||||
|
|
||||||
#### TxSize
|
#### Evidence
|
||||||
|
|
||||||
These parameters are not yet enforced and may disappear. See [issue
|
|
||||||
#2347](https://github.com/tendermint/tendermint/issues/2347).
|
|
||||||
|
|
||||||
#### BlockGossip
|
|
||||||
|
|
||||||
When gossipping blocks in the consensus, they are first split into parts. The
|
|
||||||
size of each part is `ConsensusParams.BlockGossip.BlockPartSizeBytes`.
|
|
||||||
|
|
||||||
#### EvidenceParams
|
|
||||||
|
|
||||||
For evidence in a block to be valid, it must satisfy:
|
For evidence in a block to be valid, it must satisfy:
|
||||||
|
|
||||||
```
|
```
|
||||||
block.Header.Height - evidence.Height < ConsensusParams.EvidenceParams.MaxAge
|
block.Header.Height - evidence.Height < ConsensusParams.Evidence.MaxAge
|
||||||
```
|
```
|
||||||
|
|
||||||
|
#### Validator
|
||||||
|
|
||||||
|
Validators from genesis file and `ResponseEndBlock` must have pubkeys of type ∈
|
||||||
|
`ConsensusParams.Validator.PubKeyTypes`.
|
||||||
|
@@ -66,11 +66,11 @@ type Requester {
|
|||||||
block Block
|
block Block
|
||||||
height int64
|
height int64
|
||||||
peerID p2p.ID
|
peerID p2p.ID
|
||||||
redoChannel chan struct{}
|
redoChannel chan p2p.ID //redo may send multi-time; peerId is used to identify repeat
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
|
|
||||||
Pool is core data structure that stores last executed block (`height`), assignment of requests to peers (`requesters`), current height for each peer and number of pending requests for each peer (`peers`), maximum peer height, etc.
|
Pool is a core data structure that stores last executed block (`height`), assignment of requests to peers (`requesters`), current height for each peer and number of pending requests for each peer (`peers`), maximum peer height, etc.
|
||||||
|
|
||||||
```go
|
```go
|
||||||
type Pool {
|
type Pool {
|
||||||
@@ -169,11 +169,11 @@ Requester task is responsible for fetching a single block at position `height`.
|
|||||||
|
|
||||||
```go
|
```go
|
||||||
fetchBlock(height, pool):
|
fetchBlock(height, pool):
|
||||||
while true do
|
while true do {
|
||||||
peerID = nil
|
peerID = nil
|
||||||
block = nil
|
block = nil
|
||||||
peer = pickAvailablePeer(height)
|
peer = pickAvailablePeer(height)
|
||||||
peerId = peer.id
|
peerID = peer.id
|
||||||
|
|
||||||
enqueue BlockRequest(height, peerID) to pool.requestsChannel
|
enqueue BlockRequest(height, peerID) to pool.requestsChannel
|
||||||
redo = false
|
redo = false
|
||||||
@@ -181,12 +181,15 @@ fetchBlock(height, pool):
|
|||||||
select {
|
select {
|
||||||
upon receiving Quit message do
|
upon receiving Quit message do
|
||||||
return
|
return
|
||||||
upon receiving message on redoChannel do
|
upon receiving redo message with id on redoChannel do
|
||||||
|
if peerID == id {
|
||||||
mtx.Lock()
|
mtx.Lock()
|
||||||
pool.numPending++
|
pool.numPending++
|
||||||
redo = true
|
redo = true
|
||||||
mtx.UnLock()
|
mtx.UnLock()
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
pickAvailablePeer(height):
|
pickAvailablePeer(height):
|
||||||
selectedPeer = nil
|
selectedPeer = nil
|
||||||
@@ -244,7 +247,7 @@ createRequesters(pool):
|
|||||||
main(pool):
|
main(pool):
|
||||||
create trySyncTicker with interval trySyncIntervalMS
|
create trySyncTicker with interval trySyncIntervalMS
|
||||||
create statusUpdateTicker with interval statusUpdateIntervalSeconds
|
create statusUpdateTicker with interval statusUpdateIntervalSeconds
|
||||||
create switchToConsensusTicker with interbal switchToConsensusIntervalSeconds
|
create switchToConsensusTicker with interval switchToConsensusIntervalSeconds
|
||||||
|
|
||||||
while true do
|
while true do
|
||||||
select {
|
select {
|
||||||
|
@@ -39,6 +39,9 @@ db_dir = "data"
|
|||||||
# Output level for logging
|
# Output level for logging
|
||||||
log_level = "state:info,*:error"
|
log_level = "state:info,*:error"
|
||||||
|
|
||||||
|
# Output format: 'plain' (colored text) or 'json'
|
||||||
|
log_format = "plain"
|
||||||
|
|
||||||
##### additional base config options #####
|
##### additional base config options #####
|
||||||
|
|
||||||
# The ID of the chain to join (should be signed with every transaction and vote)
|
# The ID of the chain to join (should be signed with every transaction and vote)
|
||||||
@@ -200,6 +203,9 @@ create_empty_blocks_interval = "0s"
|
|||||||
peer_gossip_sleep_duration = "100ms"
|
peer_gossip_sleep_duration = "100ms"
|
||||||
peer_query_maj23_sleep_duration = "2000ms"
|
peer_query_maj23_sleep_duration = "2000ms"
|
||||||
|
|
||||||
|
# Block time parameters. Corresponds to the minimum time increment between consecutive blocks.
|
||||||
|
blocktime_iota = "1000ms"
|
||||||
|
|
||||||
##### transactions indexer configuration options #####
|
##### transactions indexer configuration options #####
|
||||||
[tx_index]
|
[tx_index]
|
||||||
|
|
||||||
|
@@ -8,7 +8,6 @@ import (
|
|||||||
"time"
|
"time"
|
||||||
|
|
||||||
cmn "github.com/tendermint/tendermint/libs/common"
|
cmn "github.com/tendermint/tendermint/libs/common"
|
||||||
"github.com/tendermint/tendermint/libs/errors"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
/* AutoFile usage
|
/* AutoFile usage
|
||||||
@@ -157,13 +156,13 @@ func (af *AutoFile) openFile() error {
|
|||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
fileInfo, err := file.Stat()
|
// fileInfo, err := file.Stat()
|
||||||
if err != nil {
|
// if err != nil {
|
||||||
return err
|
// return err
|
||||||
}
|
// }
|
||||||
if fileInfo.Mode() != autoFilePerms {
|
// if fileInfo.Mode() != autoFilePerms {
|
||||||
return errors.NewErrPermissionsChanged(file.Name(), fileInfo.Mode(), autoFilePerms)
|
// return errors.NewErrPermissionsChanged(file.Name(), fileInfo.Mode(), autoFilePerms)
|
||||||
}
|
// }
|
||||||
af.file = file
|
af.file = file
|
||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
@@ -10,7 +10,6 @@ import (
|
|||||||
"github.com/stretchr/testify/require"
|
"github.com/stretchr/testify/require"
|
||||||
|
|
||||||
cmn "github.com/tendermint/tendermint/libs/common"
|
cmn "github.com/tendermint/tendermint/libs/common"
|
||||||
"github.com/tendermint/tendermint/libs/errors"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
func TestSIGHUP(t *testing.T) {
|
func TestSIGHUP(t *testing.T) {
|
||||||
@@ -58,32 +57,32 @@ func TestSIGHUP(t *testing.T) {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// Manually modify file permissions, close, and reopen using autofile:
|
// // Manually modify file permissions, close, and reopen using autofile:
|
||||||
// We expect the file permissions to be changed back to the intended perms.
|
// // We expect the file permissions to be changed back to the intended perms.
|
||||||
func TestOpenAutoFilePerms(t *testing.T) {
|
// func TestOpenAutoFilePerms(t *testing.T) {
|
||||||
file, err := ioutil.TempFile("", "permission_test")
|
// file, err := ioutil.TempFile("", "permission_test")
|
||||||
require.NoError(t, err)
|
// require.NoError(t, err)
|
||||||
err = file.Close()
|
// err = file.Close()
|
||||||
require.NoError(t, err)
|
// require.NoError(t, err)
|
||||||
name := file.Name()
|
// name := file.Name()
|
||||||
|
|
||||||
// open and change permissions
|
// // open and change permissions
|
||||||
af, err := OpenAutoFile(name)
|
// af, err := OpenAutoFile(name)
|
||||||
require.NoError(t, err)
|
// require.NoError(t, err)
|
||||||
err = af.file.Chmod(0755)
|
// err = af.file.Chmod(0755)
|
||||||
require.NoError(t, err)
|
// require.NoError(t, err)
|
||||||
err = af.Close()
|
// err = af.Close()
|
||||||
require.NoError(t, err)
|
// require.NoError(t, err)
|
||||||
|
|
||||||
// reopen and expect an ErrPermissionsChanged as Cause
|
// // reopen and expect an ErrPermissionsChanged as Cause
|
||||||
af, err = OpenAutoFile(name)
|
// af, err = OpenAutoFile(name)
|
||||||
require.Error(t, err)
|
// require.Error(t, err)
|
||||||
if e, ok := err.(*errors.ErrPermissionsChanged); ok {
|
// if e, ok := err.(*errors.ErrPermissionsChanged); ok {
|
||||||
t.Logf("%v", e)
|
// t.Logf("%v", e)
|
||||||
} else {
|
// } else {
|
||||||
t.Errorf("unexpected error %v", e)
|
// t.Errorf("unexpected error %v", e)
|
||||||
}
|
// }
|
||||||
}
|
// }
|
||||||
|
|
||||||
func TestAutoFileSize(t *testing.T) {
|
func TestAutoFileSize(t *testing.T) {
|
||||||
// First, create an AutoFile writing to a tempfile dir
|
// First, create an AutoFile writing to a tempfile dir
|
||||||
|
@@ -51,7 +51,7 @@ func TestParseLogLevel(t *testing.T) {
|
|||||||
|
|
||||||
buf.Reset()
|
buf.Reset()
|
||||||
|
|
||||||
logger.With("module", "wire").Debug("Kingpin")
|
logger.With("module", "mempool").With("module", "wire").Debug("Kingpin")
|
||||||
if have := strings.TrimSpace(buf.String()); c.expectedLogLines[0] != have {
|
if have := strings.TrimSpace(buf.String()); c.expectedLogLines[0] != have {
|
||||||
t.Errorf("\nwant '%s'\nhave '%s'\nlevel '%s'", c.expectedLogLines[0], have, c.lvl)
|
t.Errorf("\nwant '%s'\nhave '%s'\nlevel '%s'", c.expectedLogLines[0], have, c.lvl)
|
||||||
}
|
}
|
||||||
|
@@ -12,7 +12,6 @@ import (
|
|||||||
"github.com/pkg/errors"
|
"github.com/pkg/errors"
|
||||||
|
|
||||||
cmn "github.com/tendermint/tendermint/libs/common"
|
cmn "github.com/tendermint/tendermint/libs/common"
|
||||||
tmerrors "github.com/tendermint/tendermint/libs/errors"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
const (
|
const (
|
||||||
@@ -207,13 +206,13 @@ func write(path string, d []byte) error {
|
|||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
defer f.Close()
|
defer f.Close()
|
||||||
fInfo, err := f.Stat()
|
// fInfo, err := f.Stat()
|
||||||
if err != nil {
|
// if err != nil {
|
||||||
return err
|
// return err
|
||||||
}
|
// }
|
||||||
if fInfo.Mode() != keyPerm {
|
// if fInfo.Mode() != keyPerm {
|
||||||
return tmerrors.NewErrPermissionsChanged(f.Name(), keyPerm, fInfo.Mode())
|
// return tmerrors.NewErrPermissionsChanged(f.Name(), keyPerm, fInfo.Mode())
|
||||||
}
|
// }
|
||||||
_, err = f.Write(d)
|
_, err = f.Write(d)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
|
@@ -1,26 +1,21 @@
|
|||||||
// Package errors contains errors that are thrown across packages.
|
// Package errors contains errors that are thrown across packages.
|
||||||
package errors
|
package errors
|
||||||
|
|
||||||
import (
|
// // ErrPermissionsChanged occurs if the file permission have changed since the file was created.
|
||||||
"fmt"
|
// type ErrPermissionsChanged struct {
|
||||||
"os"
|
// name string
|
||||||
)
|
// got, want os.FileMode
|
||||||
|
// }
|
||||||
|
|
||||||
// ErrPermissionsChanged occurs if the file permission have changed since the file was created.
|
// func NewErrPermissionsChanged(name string, got, want os.FileMode) *ErrPermissionsChanged {
|
||||||
type ErrPermissionsChanged struct {
|
// return &ErrPermissionsChanged{name: name, got: got, want: want}
|
||||||
name string
|
// }
|
||||||
got, want os.FileMode
|
|
||||||
}
|
|
||||||
|
|
||||||
func NewErrPermissionsChanged(name string, got, want os.FileMode) *ErrPermissionsChanged {
|
// func (e ErrPermissionsChanged) Error() string {
|
||||||
return &ErrPermissionsChanged{name: name, got: got, want: want}
|
// return fmt.Sprintf(
|
||||||
}
|
// "file: [%v]\nexpected file permissions: %v, got: %v",
|
||||||
|
// e.name,
|
||||||
func (e ErrPermissionsChanged) Error() string {
|
// e.want,
|
||||||
return fmt.Sprintf(
|
// e.got,
|
||||||
"file: [%v]\nexpected file permissions: %v, got: %v",
|
// )
|
||||||
e.name,
|
// }
|
||||||
e.want,
|
|
||||||
e.got,
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
@@ -13,6 +13,7 @@ const (
|
|||||||
type filter struct {
|
type filter struct {
|
||||||
next Logger
|
next Logger
|
||||||
allowed level // XOR'd levels for default case
|
allowed level // XOR'd levels for default case
|
||||||
|
initiallyAllowed level // XOR'd levels for initial case
|
||||||
allowedKeyvals map[keyval]level // When key-value match, use this level
|
allowedKeyvals map[keyval]level // When key-value match, use this level
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -33,6 +34,7 @@ func NewFilter(next Logger, options ...Option) Logger {
|
|||||||
for _, option := range options {
|
for _, option := range options {
|
||||||
option(l)
|
option(l)
|
||||||
}
|
}
|
||||||
|
l.initiallyAllowed = l.allowed
|
||||||
return l
|
return l
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -76,14 +78,45 @@ func (l *filter) Error(msg string, keyvals ...interface{}) {
|
|||||||
// logger = log.NewFilter(logger, log.AllowError(), log.AllowInfoWith("module", "crypto"), log.AllowNoneWith("user", "Sam"))
|
// logger = log.NewFilter(logger, log.AllowError(), log.AllowInfoWith("module", "crypto"), log.AllowNoneWith("user", "Sam"))
|
||||||
// logger.With("user", "Sam").With("module", "crypto").Info("Hello") # produces "I... Hello module=crypto user=Sam"
|
// logger.With("user", "Sam").With("module", "crypto").Info("Hello") # produces "I... Hello module=crypto user=Sam"
|
||||||
func (l *filter) With(keyvals ...interface{}) Logger {
|
func (l *filter) With(keyvals ...interface{}) Logger {
|
||||||
|
keyInAllowedKeyvals := false
|
||||||
|
|
||||||
for i := len(keyvals) - 2; i >= 0; i -= 2 {
|
for i := len(keyvals) - 2; i >= 0; i -= 2 {
|
||||||
for kv, allowed := range l.allowedKeyvals {
|
for kv, allowed := range l.allowedKeyvals {
|
||||||
if keyvals[i] == kv.key && keyvals[i+1] == kv.value {
|
if keyvals[i] == kv.key {
|
||||||
return &filter{next: l.next.With(keyvals...), allowed: allowed, allowedKeyvals: l.allowedKeyvals}
|
keyInAllowedKeyvals = true
|
||||||
|
// Example:
|
||||||
|
// logger = log.NewFilter(logger, log.AllowError(), log.AllowInfoWith("module", "crypto"))
|
||||||
|
// logger.With("module", "crypto")
|
||||||
|
if keyvals[i+1] == kv.value {
|
||||||
|
return &filter{
|
||||||
|
next: l.next.With(keyvals...),
|
||||||
|
allowed: allowed, // set the desired level
|
||||||
|
allowedKeyvals: l.allowedKeyvals,
|
||||||
|
initiallyAllowed: l.initiallyAllowed,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return &filter{next: l.next.With(keyvals...), allowed: l.allowed, allowedKeyvals: l.allowedKeyvals}
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Example:
|
||||||
|
// logger = log.NewFilter(logger, log.AllowError(), log.AllowInfoWith("module", "crypto"))
|
||||||
|
// logger.With("module", "main")
|
||||||
|
if keyInAllowedKeyvals {
|
||||||
|
return &filter{
|
||||||
|
next: l.next.With(keyvals...),
|
||||||
|
allowed: l.initiallyAllowed, // return back to initially allowed
|
||||||
|
allowedKeyvals: l.allowedKeyvals,
|
||||||
|
initiallyAllowed: l.initiallyAllowed,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return &filter{
|
||||||
|
next: l.next.With(keyvals...),
|
||||||
|
allowed: l.allowed, // simply continue with the current level
|
||||||
|
allowedKeyvals: l.allowedKeyvals,
|
||||||
|
initiallyAllowed: l.initiallyAllowed,
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
//--------------------------------------------------------------------------------
|
//--------------------------------------------------------------------------------
|
||||||
|
@@ -9,7 +9,7 @@ import (
|
|||||||
rpcclient "github.com/tendermint/tendermint/rpc/client"
|
rpcclient "github.com/tendermint/tendermint/rpc/client"
|
||||||
"github.com/tendermint/tendermint/rpc/core"
|
"github.com/tendermint/tendermint/rpc/core"
|
||||||
ctypes "github.com/tendermint/tendermint/rpc/core/types"
|
ctypes "github.com/tendermint/tendermint/rpc/core/types"
|
||||||
rpc "github.com/tendermint/tendermint/rpc/lib/server"
|
rpcserver "github.com/tendermint/tendermint/rpc/lib/server"
|
||||||
)
|
)
|
||||||
|
|
||||||
const (
|
const (
|
||||||
@@ -19,6 +19,7 @@ const (
|
|||||||
// StartProxy will start the websocket manager on the client,
|
// StartProxy will start the websocket manager on the client,
|
||||||
// set up the rpc routes to proxy via the given client,
|
// set up the rpc routes to proxy via the given client,
|
||||||
// and start up an http/rpc server on the location given by bind (eg. :1234)
|
// and start up an http/rpc server on the location given by bind (eg. :1234)
|
||||||
|
// NOTE: This function blocks - you may want to call it in a go-routine.
|
||||||
func StartProxy(c rpcclient.Client, listenAddr string, logger log.Logger, maxOpenConnections int) error {
|
func StartProxy(c rpcclient.Client, listenAddr string, logger log.Logger, maxOpenConnections int) error {
|
||||||
err := c.Start()
|
err := c.Start()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
@@ -31,47 +32,49 @@ func StartProxy(c rpcclient.Client, listenAddr string, logger log.Logger, maxOpe
|
|||||||
|
|
||||||
// build the handler...
|
// build the handler...
|
||||||
mux := http.NewServeMux()
|
mux := http.NewServeMux()
|
||||||
rpc.RegisterRPCFuncs(mux, r, cdc, logger)
|
rpcserver.RegisterRPCFuncs(mux, r, cdc, logger)
|
||||||
|
|
||||||
wm := rpc.NewWebsocketManager(r, cdc, rpc.EventSubscriber(c))
|
wm := rpcserver.NewWebsocketManager(r, cdc, rpcserver.EventSubscriber(c))
|
||||||
wm.SetLogger(logger)
|
wm.SetLogger(logger)
|
||||||
core.SetLogger(logger)
|
core.SetLogger(logger)
|
||||||
mux.HandleFunc(wsEndpoint, wm.WebsocketHandler)
|
mux.HandleFunc(wsEndpoint, wm.WebsocketHandler)
|
||||||
|
|
||||||
_, err = rpc.StartHTTPServer(listenAddr, mux, logger, rpc.Config{MaxOpenConnections: maxOpenConnections})
|
l, err := rpcserver.Listen(listenAddr, rpcserver.Config{MaxOpenConnections: maxOpenConnections})
|
||||||
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
return rpcserver.StartHTTPServer(l, mux, logger)
|
||||||
|
}
|
||||||
|
|
||||||
// RPCRoutes just routes everything to the given client, as if it were
|
// RPCRoutes just routes everything to the given client, as if it were
|
||||||
// a tendermint fullnode.
|
// a tendermint fullnode.
|
||||||
//
|
//
|
||||||
// if we want security, the client must implement it as a secure client
|
// if we want security, the client must implement it as a secure client
|
||||||
func RPCRoutes(c rpcclient.Client) map[string]*rpc.RPCFunc {
|
func RPCRoutes(c rpcclient.Client) map[string]*rpcserver.RPCFunc {
|
||||||
|
|
||||||
return map[string]*rpc.RPCFunc{
|
return map[string]*rpcserver.RPCFunc{
|
||||||
// Subscribe/unsubscribe are reserved for websocket events.
|
// Subscribe/unsubscribe are reserved for websocket events.
|
||||||
// We can just use the core tendermint impl, which uses the
|
// We can just use the core tendermint impl, which uses the
|
||||||
// EventSwitch we registered in NewWebsocketManager above
|
// EventSwitch we registered in NewWebsocketManager above
|
||||||
"subscribe": rpc.NewWSRPCFunc(core.Subscribe, "query"),
|
"subscribe": rpcserver.NewWSRPCFunc(core.Subscribe, "query"),
|
||||||
"unsubscribe": rpc.NewWSRPCFunc(core.Unsubscribe, "query"),
|
"unsubscribe": rpcserver.NewWSRPCFunc(core.Unsubscribe, "query"),
|
||||||
|
|
||||||
// info API
|
// info API
|
||||||
"status": rpc.NewRPCFunc(c.Status, ""),
|
"status": rpcserver.NewRPCFunc(c.Status, ""),
|
||||||
"blockchain": rpc.NewRPCFunc(c.BlockchainInfo, "minHeight,maxHeight"),
|
"blockchain": rpcserver.NewRPCFunc(c.BlockchainInfo, "minHeight,maxHeight"),
|
||||||
"genesis": rpc.NewRPCFunc(c.Genesis, ""),
|
"genesis": rpcserver.NewRPCFunc(c.Genesis, ""),
|
||||||
"block": rpc.NewRPCFunc(c.Block, "height"),
|
"block": rpcserver.NewRPCFunc(c.Block, "height"),
|
||||||
"commit": rpc.NewRPCFunc(c.Commit, "height"),
|
"commit": rpcserver.NewRPCFunc(c.Commit, "height"),
|
||||||
"tx": rpc.NewRPCFunc(c.Tx, "hash,prove"),
|
"tx": rpcserver.NewRPCFunc(c.Tx, "hash,prove"),
|
||||||
"validators": rpc.NewRPCFunc(c.Validators, ""),
|
"validators": rpcserver.NewRPCFunc(c.Validators, ""),
|
||||||
|
|
||||||
// broadcast API
|
// broadcast API
|
||||||
"broadcast_tx_commit": rpc.NewRPCFunc(c.BroadcastTxCommit, "tx"),
|
"broadcast_tx_commit": rpcserver.NewRPCFunc(c.BroadcastTxCommit, "tx"),
|
||||||
"broadcast_tx_sync": rpc.NewRPCFunc(c.BroadcastTxSync, "tx"),
|
"broadcast_tx_sync": rpcserver.NewRPCFunc(c.BroadcastTxSync, "tx"),
|
||||||
"broadcast_tx_async": rpc.NewRPCFunc(c.BroadcastTxAsync, "tx"),
|
"broadcast_tx_async": rpcserver.NewRPCFunc(c.BroadcastTxAsync, "tx"),
|
||||||
|
|
||||||
// abci API
|
// abci API
|
||||||
"abci_query": rpc.NewRPCFunc(c.ABCIQuery, "path,data,prove"),
|
"abci_query": rpcserver.NewRPCFunc(c.ABCIQuery, "path,data,prove"),
|
||||||
"abci_info": rpc.NewRPCFunc(c.ABCIInfo, ""),
|
"abci_info": rpcserver.NewRPCFunc(c.ABCIInfo, ""),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@@ -131,7 +131,6 @@ type Mempool struct {
|
|||||||
proxyMtx sync.Mutex
|
proxyMtx sync.Mutex
|
||||||
proxyAppConn proxy.AppConnMempool
|
proxyAppConn proxy.AppConnMempool
|
||||||
txs *clist.CList // concurrent linked-list of good txs
|
txs *clist.CList // concurrent linked-list of good txs
|
||||||
counter int64 // simple incrementing counter
|
|
||||||
height int64 // the last block Update()'d to
|
height int64 // the last block Update()'d to
|
||||||
rechecking int32 // for re-checking filtered txs on Update()
|
rechecking int32 // for re-checking filtered txs on Update()
|
||||||
recheckCursor *clist.CElement // next expected response
|
recheckCursor *clist.CElement // next expected response
|
||||||
@@ -167,7 +166,6 @@ func NewMempool(
|
|||||||
config: config,
|
config: config,
|
||||||
proxyAppConn: proxyAppConn,
|
proxyAppConn: proxyAppConn,
|
||||||
txs: clist.New(),
|
txs: clist.New(),
|
||||||
counter: 0,
|
|
||||||
height: height,
|
height: height,
|
||||||
rechecking: 0,
|
rechecking: 0,
|
||||||
recheckCursor: nil,
|
recheckCursor: nil,
|
||||||
@@ -365,9 +363,7 @@ func (mem *Mempool) resCbNormal(req *abci.Request, res *abci.Response) {
|
|||||||
postCheckErr = mem.postCheck(tx, r.CheckTx)
|
postCheckErr = mem.postCheck(tx, r.CheckTx)
|
||||||
}
|
}
|
||||||
if (r.CheckTx.Code == abci.CodeTypeOK) && postCheckErr == nil {
|
if (r.CheckTx.Code == abci.CodeTypeOK) && postCheckErr == nil {
|
||||||
mem.counter++
|
|
||||||
memTx := &mempoolTx{
|
memTx := &mempoolTx{
|
||||||
counter: mem.counter,
|
|
||||||
height: mem.height,
|
height: mem.height,
|
||||||
gasWanted: r.CheckTx.GasWanted,
|
gasWanted: r.CheckTx.GasWanted,
|
||||||
tx: tx,
|
tx: tx,
|
||||||
@@ -378,7 +374,6 @@ func (mem *Mempool) resCbNormal(req *abci.Request, res *abci.Response) {
|
|||||||
"res", r,
|
"res", r,
|
||||||
"height", memTx.height,
|
"height", memTx.height,
|
||||||
"total", mem.Size(),
|
"total", mem.Size(),
|
||||||
"counter", memTx.counter,
|
|
||||||
)
|
)
|
||||||
mem.metrics.TxSizeBytes.Observe(float64(len(tx)))
|
mem.metrics.TxSizeBytes.Observe(float64(len(tx)))
|
||||||
mem.notifyTxsAvailable()
|
mem.notifyTxsAvailable()
|
||||||
@@ -534,12 +529,6 @@ func (mem *Mempool) Update(
|
|||||||
preCheck PreCheckFunc,
|
preCheck PreCheckFunc,
|
||||||
postCheck PostCheckFunc,
|
postCheck PostCheckFunc,
|
||||||
) error {
|
) error {
|
||||||
// First, create a lookup map of txns in new txs.
|
|
||||||
txsMap := make(map[string]struct{}, len(txs))
|
|
||||||
for _, tx := range txs {
|
|
||||||
txsMap[string(tx)] = struct{}{}
|
|
||||||
}
|
|
||||||
|
|
||||||
// Set height
|
// Set height
|
||||||
mem.height = height
|
mem.height = height
|
||||||
mem.notifiedTxsAvailable = false
|
mem.notifiedTxsAvailable = false
|
||||||
@@ -551,12 +540,18 @@ func (mem *Mempool) Update(
|
|||||||
mem.postCheck = postCheck
|
mem.postCheck = postCheck
|
||||||
}
|
}
|
||||||
|
|
||||||
// Remove transactions that are already in txs.
|
// Add committed transactions to cache (if missing).
|
||||||
goodTxs := mem.filterTxs(txsMap)
|
for _, tx := range txs {
|
||||||
|
_ = mem.cache.Push(tx)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Remove committed transactions.
|
||||||
|
txsLeft := mem.removeTxs(txs)
|
||||||
|
|
||||||
// Recheck mempool txs if any txs were committed in the block
|
// Recheck mempool txs if any txs were committed in the block
|
||||||
if mem.config.Recheck && len(goodTxs) > 0 {
|
if mem.config.Recheck && len(txsLeft) > 0 {
|
||||||
mem.logger.Info("Recheck txs", "numtxs", len(goodTxs), "height", height)
|
mem.logger.Info("Recheck txs", "numtxs", len(txsLeft), "height", height)
|
||||||
mem.recheckTxs(goodTxs)
|
mem.recheckTxs(txsLeft)
|
||||||
// At this point, mem.txs are being rechecked.
|
// At this point, mem.txs are being rechecked.
|
||||||
// mem.recheckCursor re-scans mem.txs and possibly removes some txs.
|
// mem.recheckCursor re-scans mem.txs and possibly removes some txs.
|
||||||
// Before mem.Reap(), we should wait for mem.recheckCursor to be nil.
|
// Before mem.Reap(), we should wait for mem.recheckCursor to be nil.
|
||||||
@@ -568,12 +563,18 @@ func (mem *Mempool) Update(
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func (mem *Mempool) filterTxs(blockTxsMap map[string]struct{}) []types.Tx {
|
func (mem *Mempool) removeTxs(txs types.Txs) []types.Tx {
|
||||||
goodTxs := make([]types.Tx, 0, mem.txs.Len())
|
// Build a map for faster lookups.
|
||||||
|
txsMap := make(map[string]struct{}, len(txs))
|
||||||
|
for _, tx := range txs {
|
||||||
|
txsMap[string(tx)] = struct{}{}
|
||||||
|
}
|
||||||
|
|
||||||
|
txsLeft := make([]types.Tx, 0, mem.txs.Len())
|
||||||
for e := mem.txs.Front(); e != nil; e = e.Next() {
|
for e := mem.txs.Front(); e != nil; e = e.Next() {
|
||||||
memTx := e.Value.(*mempoolTx)
|
memTx := e.Value.(*mempoolTx)
|
||||||
// Remove the tx if it's alredy in a block.
|
// Remove the tx if it's already in a block.
|
||||||
if _, ok := blockTxsMap[string(memTx.tx)]; ok {
|
if _, ok := txsMap[string(memTx.tx)]; ok {
|
||||||
// remove from clist
|
// remove from clist
|
||||||
mem.txs.Remove(e)
|
mem.txs.Remove(e)
|
||||||
e.DetachPrev()
|
e.DetachPrev()
|
||||||
@@ -581,15 +582,14 @@ func (mem *Mempool) filterTxs(blockTxsMap map[string]struct{}) []types.Tx {
|
|||||||
// NOTE: we don't remove committed txs from the cache.
|
// NOTE: we don't remove committed txs from the cache.
|
||||||
continue
|
continue
|
||||||
}
|
}
|
||||||
// Good tx!
|
txsLeft = append(txsLeft, memTx.tx)
|
||||||
goodTxs = append(goodTxs, memTx.tx)
|
|
||||||
}
|
}
|
||||||
return goodTxs
|
return txsLeft
|
||||||
}
|
}
|
||||||
|
|
||||||
// NOTE: pass in goodTxs because mem.txs can mutate concurrently.
|
// NOTE: pass in txs because mem.txs can mutate concurrently.
|
||||||
func (mem *Mempool) recheckTxs(goodTxs []types.Tx) {
|
func (mem *Mempool) recheckTxs(txs []types.Tx) {
|
||||||
if len(goodTxs) == 0 {
|
if len(txs) == 0 {
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
atomic.StoreInt32(&mem.rechecking, 1)
|
atomic.StoreInt32(&mem.rechecking, 1)
|
||||||
@@ -598,7 +598,7 @@ func (mem *Mempool) recheckTxs(goodTxs []types.Tx) {
|
|||||||
|
|
||||||
// Push txs to proxyAppConn
|
// Push txs to proxyAppConn
|
||||||
// NOTE: resCb() may be called concurrently.
|
// NOTE: resCb() may be called concurrently.
|
||||||
for _, tx := range goodTxs {
|
for _, tx := range txs {
|
||||||
mem.proxyAppConn.CheckTxAsync(tx)
|
mem.proxyAppConn.CheckTxAsync(tx)
|
||||||
}
|
}
|
||||||
mem.proxyAppConn.FlushAsync()
|
mem.proxyAppConn.FlushAsync()
|
||||||
@@ -608,7 +608,6 @@ func (mem *Mempool) recheckTxs(goodTxs []types.Tx) {
|
|||||||
|
|
||||||
// mempoolTx is a transaction that successfully ran
|
// mempoolTx is a transaction that successfully ran
|
||||||
type mempoolTx struct {
|
type mempoolTx struct {
|
||||||
counter int64 // a simple incrementing counter
|
|
||||||
height int64 // height that this tx had been validated in
|
height int64 // height that this tx had been validated in
|
||||||
gasWanted int64 // amount of gas this tx states it will require
|
gasWanted int64 // amount of gas this tx states it will require
|
||||||
tx types.Tx //
|
tx types.Tx //
|
||||||
|
@@ -163,6 +163,17 @@ func TestMempoolFilters(t *testing.T) {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func TestMempoolUpdateAddsTxsToCache(t *testing.T) {
|
||||||
|
app := kvstore.NewKVStoreApplication()
|
||||||
|
cc := proxy.NewLocalClientCreator(app)
|
||||||
|
mempool := newMempoolWithApp(cc)
|
||||||
|
mempool.Update(1, []types.Tx{[]byte{0x01}}, nil, nil)
|
||||||
|
err := mempool.CheckTx([]byte{0x01}, nil)
|
||||||
|
if assert.Error(t, err) {
|
||||||
|
assert.Equal(t, ErrTxInCache, err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
func TestTxsAvailable(t *testing.T) {
|
func TestTxsAvailable(t *testing.T) {
|
||||||
app := kvstore.NewKVStoreApplication()
|
app := kvstore.NewKVStoreApplication()
|
||||||
cc := proxy.NewLocalClientCreator(app)
|
cc := proxy.NewLocalClientCreator(app)
|
||||||
|
91
node/node.go
91
node/node.go
@@ -3,7 +3,6 @@ package node
|
|||||||
import (
|
import (
|
||||||
"bytes"
|
"bytes"
|
||||||
"context"
|
"context"
|
||||||
"errors"
|
|
||||||
"fmt"
|
"fmt"
|
||||||
"net"
|
"net"
|
||||||
"net/http"
|
"net/http"
|
||||||
@@ -11,11 +10,12 @@ import (
|
|||||||
"strings"
|
"strings"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
|
"github.com/pkg/errors"
|
||||||
"github.com/prometheus/client_golang/prometheus"
|
"github.com/prometheus/client_golang/prometheus"
|
||||||
"github.com/prometheus/client_golang/prometheus/promhttp"
|
"github.com/prometheus/client_golang/prometheus/promhttp"
|
||||||
"github.com/rs/cors"
|
"github.com/rs/cors"
|
||||||
|
|
||||||
"github.com/tendermint/go-amino"
|
amino "github.com/tendermint/go-amino"
|
||||||
abci "github.com/tendermint/tendermint/abci/types"
|
abci "github.com/tendermint/tendermint/abci/types"
|
||||||
bc "github.com/tendermint/tendermint/blockchain"
|
bc "github.com/tendermint/tendermint/blockchain"
|
||||||
cfg "github.com/tendermint/tendermint/config"
|
cfg "github.com/tendermint/tendermint/config"
|
||||||
@@ -220,25 +220,14 @@ func NewNode(config *cfg.Config,
|
|||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
// If an address is provided, listen on the socket for a
|
|
||||||
// connection from an external signing process.
|
|
||||||
if config.PrivValidatorListenAddr != "" {
|
if config.PrivValidatorListenAddr != "" {
|
||||||
var (
|
// If an address is provided, listen on the socket for a connection from an
|
||||||
// TODO: persist this key so external signer
|
// external signing process.
|
||||||
// can actually authenticate us
|
// FIXME: we should start services inside OnStart
|
||||||
privKey = ed25519.GenPrivKey()
|
privValidator, err = createAndStartPrivValidatorSocketClient(config.PrivValidatorListenAddr, logger)
|
||||||
pvsc = privval.NewTCPVal(
|
if err != nil {
|
||||||
logger.With("module", "privval"),
|
return nil, errors.Wrap(err, "Error with private validator socket client")
|
||||||
config.PrivValidatorListenAddr,
|
|
||||||
privKey,
|
|
||||||
)
|
|
||||||
)
|
|
||||||
|
|
||||||
if err := pvsc.Start(); err != nil {
|
|
||||||
return nil, fmt.Errorf("Error starting private validator client: %v", err)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
privValidator = pvsc
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// Decide whether to fast-sync or not
|
// Decide whether to fast-sync or not
|
||||||
@@ -371,7 +360,8 @@ func NewNode(config *cfg.Config,
|
|||||||
|
|
||||||
// Setup Transport.
|
// Setup Transport.
|
||||||
var (
|
var (
|
||||||
transport = p2p.NewMultiplexTransport(nodeInfo, *nodeKey)
|
mConnConfig = p2p.MConnConfig(config.P2P)
|
||||||
|
transport = p2p.NewMultiplexTransport(nodeInfo, *nodeKey, mConnConfig)
|
||||||
connFilters = []p2p.ConnFilterFunc{}
|
connFilters = []p2p.ConnFilterFunc{}
|
||||||
peerFilters = []p2p.PeerFilterFunc{}
|
peerFilters = []p2p.PeerFilterFunc{}
|
||||||
)
|
)
|
||||||
@@ -599,10 +589,8 @@ func (n *Node) OnStop() {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if pvsc, ok := n.privValidator.(*privval.TCPVal); ok {
|
if pvsc, ok := n.privValidator.(cmn.Service); ok {
|
||||||
if err := pvsc.Stop(); err != nil {
|
pvsc.Stop()
|
||||||
n.Logger.Error("Error stopping priv validator socket client", "err", err)
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
if n.prometheusSrv != nil {
|
if n.prometheusSrv != nil {
|
||||||
@@ -653,6 +641,14 @@ func (n *Node) startRPC() ([]net.Listener, error) {
|
|||||||
mux.HandleFunc("/websocket", wm.WebsocketHandler)
|
mux.HandleFunc("/websocket", wm.WebsocketHandler)
|
||||||
rpcserver.RegisterRPCFuncs(mux, rpccore.Routes, coreCodec, rpcLogger)
|
rpcserver.RegisterRPCFuncs(mux, rpccore.Routes, coreCodec, rpcLogger)
|
||||||
|
|
||||||
|
listener, err := rpcserver.Listen(
|
||||||
|
listenAddr,
|
||||||
|
rpcserver.Config{MaxOpenConnections: n.config.RPC.MaxOpenConnections},
|
||||||
|
)
|
||||||
|
if err != nil {
|
||||||
|
return nil, err
|
||||||
|
}
|
||||||
|
|
||||||
var rootHandler http.Handler = mux
|
var rootHandler http.Handler = mux
|
||||||
if n.config.RPC.IsCorsEnabled() {
|
if n.config.RPC.IsCorsEnabled() {
|
||||||
corsMiddleware := cors.New(cors.Options{
|
corsMiddleware := cors.New(cors.Options{
|
||||||
@@ -663,30 +659,23 @@ func (n *Node) startRPC() ([]net.Listener, error) {
|
|||||||
rootHandler = corsMiddleware.Handler(mux)
|
rootHandler = corsMiddleware.Handler(mux)
|
||||||
}
|
}
|
||||||
|
|
||||||
listener, err := rpcserver.StartHTTPServer(
|
go rpcserver.StartHTTPServer(
|
||||||
listenAddr,
|
listener,
|
||||||
rootHandler,
|
rootHandler,
|
||||||
rpcLogger,
|
rpcLogger,
|
||||||
rpcserver.Config{MaxOpenConnections: n.config.RPC.MaxOpenConnections},
|
|
||||||
)
|
)
|
||||||
if err != nil {
|
|
||||||
return nil, err
|
|
||||||
}
|
|
||||||
listeners[i] = listener
|
listeners[i] = listener
|
||||||
}
|
}
|
||||||
|
|
||||||
// we expose a simplified api over grpc for convenience to app devs
|
// we expose a simplified api over grpc for convenience to app devs
|
||||||
grpcListenAddr := n.config.RPC.GRPCListenAddress
|
grpcListenAddr := n.config.RPC.GRPCListenAddress
|
||||||
if grpcListenAddr != "" {
|
if grpcListenAddr != "" {
|
||||||
listener, err := grpccore.StartGRPCServer(
|
listener, err := rpcserver.Listen(
|
||||||
grpcListenAddr,
|
grpcListenAddr, rpcserver.Config{MaxOpenConnections: n.config.RPC.GRPCMaxOpenConnections})
|
||||||
grpccore.Config{
|
|
||||||
MaxOpenConnections: n.config.RPC.GRPCMaxOpenConnections,
|
|
||||||
},
|
|
||||||
)
|
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return nil, err
|
return nil, err
|
||||||
}
|
}
|
||||||
|
go grpccore.StartGRPCServer(listener)
|
||||||
listeners = append(listeners, listener)
|
listeners = append(listeners, listener)
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -855,6 +844,36 @@ func saveGenesisDoc(db dbm.DB, genDoc *types.GenesisDoc) {
|
|||||||
db.SetSync(genesisDocKey, bytes)
|
db.SetSync(genesisDocKey, bytes)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func createAndStartPrivValidatorSocketClient(
|
||||||
|
listenAddr string,
|
||||||
|
logger log.Logger,
|
||||||
|
) (types.PrivValidator, error) {
|
||||||
|
var pvsc types.PrivValidator
|
||||||
|
|
||||||
|
protocol, address := cmn.ProtocolAndAddress(listenAddr)
|
||||||
|
switch protocol {
|
||||||
|
case "unix":
|
||||||
|
pvsc = privval.NewIPCVal(logger.With("module", "privval"), address)
|
||||||
|
case "tcp":
|
||||||
|
// TODO: persist this key so external signer
|
||||||
|
// can actually authenticate us
|
||||||
|
pvsc = privval.NewTCPVal(logger.With("module", "privval"), listenAddr, ed25519.GenPrivKey())
|
||||||
|
default:
|
||||||
|
return nil, fmt.Errorf(
|
||||||
|
"Wrong listen address: expected either 'tcp' or 'unix' protocols, got %s",
|
||||||
|
protocol,
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
if pvsc, ok := pvsc.(cmn.Service); ok {
|
||||||
|
if err := pvsc.Start(); err != nil {
|
||||||
|
return nil, errors.Wrap(err, "failed to start")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return pvsc, nil
|
||||||
|
}
|
||||||
|
|
||||||
// splitAndTrimEmpty slices s into all subslices separated by sep and returns a
|
// splitAndTrimEmpty slices s into all subslices separated by sep and returns a
|
||||||
// slice of the string s with all leading and trailing Unicode code points
|
// slice of the string s with all leading and trailing Unicode code points
|
||||||
// contained in cutset removed. If sep is empty, SplitAndTrim splits after each
|
// contained in cutset removed. If sep is empty, SplitAndTrim splits after each
|
||||||
|
@@ -3,23 +3,26 @@ package node
|
|||||||
import (
|
import (
|
||||||
"context"
|
"context"
|
||||||
"fmt"
|
"fmt"
|
||||||
|
"net"
|
||||||
"os"
|
"os"
|
||||||
"syscall"
|
"syscall"
|
||||||
"testing"
|
"testing"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/stretchr/testify/assert"
|
"github.com/stretchr/testify/assert"
|
||||||
|
"github.com/stretchr/testify/require"
|
||||||
|
|
||||||
"github.com/tendermint/tendermint/abci/example/kvstore"
|
"github.com/tendermint/tendermint/abci/example/kvstore"
|
||||||
|
cfg "github.com/tendermint/tendermint/config"
|
||||||
|
"github.com/tendermint/tendermint/crypto/ed25519"
|
||||||
|
cmn "github.com/tendermint/tendermint/libs/common"
|
||||||
"github.com/tendermint/tendermint/libs/log"
|
"github.com/tendermint/tendermint/libs/log"
|
||||||
"github.com/tendermint/tendermint/p2p"
|
"github.com/tendermint/tendermint/p2p"
|
||||||
|
"github.com/tendermint/tendermint/privval"
|
||||||
sm "github.com/tendermint/tendermint/state"
|
sm "github.com/tendermint/tendermint/state"
|
||||||
"github.com/tendermint/tendermint/version"
|
|
||||||
|
|
||||||
cfg "github.com/tendermint/tendermint/config"
|
|
||||||
"github.com/tendermint/tendermint/types"
|
"github.com/tendermint/tendermint/types"
|
||||||
|
|
||||||
tmtime "github.com/tendermint/tendermint/types/time"
|
tmtime "github.com/tendermint/tendermint/types/time"
|
||||||
|
"github.com/tendermint/tendermint/version"
|
||||||
)
|
)
|
||||||
|
|
||||||
func TestNodeStartStop(t *testing.T) {
|
func TestNodeStartStop(t *testing.T) {
|
||||||
@@ -27,17 +30,16 @@ func TestNodeStartStop(t *testing.T) {
|
|||||||
|
|
||||||
// create & start node
|
// create & start node
|
||||||
n, err := DefaultNewNode(config, log.TestingLogger())
|
n, err := DefaultNewNode(config, log.TestingLogger())
|
||||||
assert.NoError(t, err, "expected no err on DefaultNewNode")
|
require.NoError(t, err)
|
||||||
err1 := n.Start()
|
err = n.Start()
|
||||||
if err1 != nil {
|
require.NoError(t, err)
|
||||||
t.Error(err1)
|
|
||||||
}
|
|
||||||
t.Logf("Started node %v", n.sw.NodeInfo())
|
t.Logf("Started node %v", n.sw.NodeInfo())
|
||||||
|
|
||||||
// wait for the node to produce a block
|
// wait for the node to produce a block
|
||||||
blockCh := make(chan interface{})
|
blockCh := make(chan interface{})
|
||||||
err = n.EventBus().Subscribe(context.Background(), "node_test", types.EventQueryNewBlock, blockCh)
|
err = n.EventBus().Subscribe(context.Background(), "node_test", types.EventQueryNewBlock, blockCh)
|
||||||
assert.NoError(t, err)
|
require.NoError(t, err)
|
||||||
select {
|
select {
|
||||||
case <-blockCh:
|
case <-blockCh:
|
||||||
case <-time.After(10 * time.Second):
|
case <-time.After(10 * time.Second):
|
||||||
@@ -89,7 +91,7 @@ func TestNodeDelayedStop(t *testing.T) {
|
|||||||
// create & start node
|
// create & start node
|
||||||
n, err := DefaultNewNode(config, log.TestingLogger())
|
n, err := DefaultNewNode(config, log.TestingLogger())
|
||||||
n.GenesisDoc().GenesisTime = now.Add(5 * time.Second)
|
n.GenesisDoc().GenesisTime = now.Add(5 * time.Second)
|
||||||
assert.NoError(t, err)
|
require.NoError(t, err)
|
||||||
|
|
||||||
n.Start()
|
n.Start()
|
||||||
startTime := tmtime.Now()
|
startTime := tmtime.Now()
|
||||||
@@ -101,7 +103,7 @@ func TestNodeSetAppVersion(t *testing.T) {
|
|||||||
|
|
||||||
// create & start node
|
// create & start node
|
||||||
n, err := DefaultNewNode(config, log.TestingLogger())
|
n, err := DefaultNewNode(config, log.TestingLogger())
|
||||||
assert.NoError(t, err, "expected no err on DefaultNewNode")
|
require.NoError(t, err)
|
||||||
|
|
||||||
// default config uses the kvstore app
|
// default config uses the kvstore app
|
||||||
var appVersion version.Protocol = kvstore.ProtocolVersion
|
var appVersion version.Protocol = kvstore.ProtocolVersion
|
||||||
@@ -113,3 +115,80 @@ func TestNodeSetAppVersion(t *testing.T) {
|
|||||||
// check version is set in node info
|
// check version is set in node info
|
||||||
assert.Equal(t, n.nodeInfo.(p2p.DefaultNodeInfo).ProtocolVersion.App, appVersion)
|
assert.Equal(t, n.nodeInfo.(p2p.DefaultNodeInfo).ProtocolVersion.App, appVersion)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func TestNodeSetPrivValTCP(t *testing.T) {
|
||||||
|
addr := "tcp://" + testFreeAddr(t)
|
||||||
|
|
||||||
|
config := cfg.ResetTestRoot("node_priv_val_tcp_test")
|
||||||
|
config.BaseConfig.PrivValidatorListenAddr = addr
|
||||||
|
|
||||||
|
rs := privval.NewRemoteSigner(
|
||||||
|
log.TestingLogger(),
|
||||||
|
config.ChainID(),
|
||||||
|
addr,
|
||||||
|
types.NewMockPV(),
|
||||||
|
ed25519.GenPrivKey(),
|
||||||
|
)
|
||||||
|
privval.RemoteSignerConnDeadline(5 * time.Millisecond)(rs)
|
||||||
|
go func() {
|
||||||
|
err := rs.Start()
|
||||||
|
if err != nil {
|
||||||
|
panic(err)
|
||||||
|
}
|
||||||
|
}()
|
||||||
|
defer rs.Stop()
|
||||||
|
|
||||||
|
n, err := DefaultNewNode(config, log.TestingLogger())
|
||||||
|
require.NoError(t, err)
|
||||||
|
assert.IsType(t, &privval.TCPVal{}, n.PrivValidator())
|
||||||
|
}
|
||||||
|
|
||||||
|
// address without a protocol must result in error
|
||||||
|
func TestPrivValidatorListenAddrNoProtocol(t *testing.T) {
|
||||||
|
addrNoPrefix := testFreeAddr(t)
|
||||||
|
|
||||||
|
config := cfg.ResetTestRoot("node_priv_val_tcp_test")
|
||||||
|
config.BaseConfig.PrivValidatorListenAddr = addrNoPrefix
|
||||||
|
|
||||||
|
_, err := DefaultNewNode(config, log.TestingLogger())
|
||||||
|
assert.Error(t, err)
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestNodeSetPrivValIPC(t *testing.T) {
|
||||||
|
tmpfile := "/tmp/kms." + cmn.RandStr(6) + ".sock"
|
||||||
|
defer os.Remove(tmpfile) // clean up
|
||||||
|
|
||||||
|
config := cfg.ResetTestRoot("node_priv_val_tcp_test")
|
||||||
|
config.BaseConfig.PrivValidatorListenAddr = "unix://" + tmpfile
|
||||||
|
|
||||||
|
rs := privval.NewIPCRemoteSigner(
|
||||||
|
log.TestingLogger(),
|
||||||
|
config.ChainID(),
|
||||||
|
tmpfile,
|
||||||
|
types.NewMockPV(),
|
||||||
|
)
|
||||||
|
privval.IPCRemoteSignerConnDeadline(3 * time.Second)(rs)
|
||||||
|
|
||||||
|
done := make(chan struct{})
|
||||||
|
go func() {
|
||||||
|
defer close(done)
|
||||||
|
n, err := DefaultNewNode(config, log.TestingLogger())
|
||||||
|
require.NoError(t, err)
|
||||||
|
assert.IsType(t, &privval.IPCVal{}, n.PrivValidator())
|
||||||
|
}()
|
||||||
|
|
||||||
|
err := rs.Start()
|
||||||
|
require.NoError(t, err)
|
||||||
|
defer rs.Stop()
|
||||||
|
|
||||||
|
<-done
|
||||||
|
}
|
||||||
|
|
||||||
|
// testFreeAddr claims a free port so we don't block on listener being ready.
|
||||||
|
func testFreeAddr(t *testing.T) string {
|
||||||
|
ln, err := net.Listen("tcp", "127.0.0.1:0")
|
||||||
|
require.NoError(t, err)
|
||||||
|
defer ln.Close()
|
||||||
|
|
||||||
|
return fmt.Sprintf("127.0.0.1:%d", ln.Addr().(*net.TCPAddr).Port)
|
||||||
|
}
|
||||||
|
@@ -84,7 +84,11 @@ type MConnection struct {
|
|||||||
errored uint32
|
errored uint32
|
||||||
config MConnConfig
|
config MConnConfig
|
||||||
|
|
||||||
quit chan struct{}
|
// Closing quitSendRoutine will cause
|
||||||
|
// doneSendRoutine to close.
|
||||||
|
quitSendRoutine chan struct{}
|
||||||
|
doneSendRoutine chan struct{}
|
||||||
|
|
||||||
flushTimer *cmn.ThrottleTimer // flush writes as necessary but throttled.
|
flushTimer *cmn.ThrottleTimer // flush writes as necessary but throttled.
|
||||||
pingTimer *cmn.RepeatTimer // send pings periodically
|
pingTimer *cmn.RepeatTimer // send pings periodically
|
||||||
|
|
||||||
@@ -190,7 +194,8 @@ func (c *MConnection) OnStart() error {
|
|||||||
if err := c.BaseService.OnStart(); err != nil {
|
if err := c.BaseService.OnStart(); err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
c.quit = make(chan struct{})
|
c.quitSendRoutine = make(chan struct{})
|
||||||
|
c.doneSendRoutine = make(chan struct{})
|
||||||
c.flushTimer = cmn.NewThrottleTimer("flush", c.config.FlushThrottle)
|
c.flushTimer = cmn.NewThrottleTimer("flush", c.config.FlushThrottle)
|
||||||
c.pingTimer = cmn.NewRepeatTimer("ping", c.config.PingInterval)
|
c.pingTimer = cmn.NewRepeatTimer("ping", c.config.PingInterval)
|
||||||
c.pongTimeoutCh = make(chan bool, 1)
|
c.pongTimeoutCh = make(chan bool, 1)
|
||||||
@@ -200,15 +205,59 @@ func (c *MConnection) OnStart() error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// OnStop implements BaseService
|
// FlushStop replicates the logic of OnStop.
|
||||||
func (c *MConnection) OnStop() {
|
// It additionally ensures that all successful
|
||||||
|
// .Send() calls will get flushed before closing
|
||||||
|
// the connection.
|
||||||
|
// NOTE: it is not safe to call this method more than once.
|
||||||
|
func (c *MConnection) FlushStop() {
|
||||||
c.BaseService.OnStop()
|
c.BaseService.OnStop()
|
||||||
c.flushTimer.Stop()
|
c.flushTimer.Stop()
|
||||||
c.pingTimer.Stop()
|
c.pingTimer.Stop()
|
||||||
c.chStatsTimer.Stop()
|
c.chStatsTimer.Stop()
|
||||||
if c.quit != nil {
|
if c.quitSendRoutine != nil {
|
||||||
close(c.quit)
|
close(c.quitSendRoutine)
|
||||||
|
// wait until the sendRoutine exits
|
||||||
|
// so we dont race on calling sendSomePacketMsgs
|
||||||
|
<-c.doneSendRoutine
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Send and flush all pending msgs.
|
||||||
|
// By now, IsRunning == false,
|
||||||
|
// so any concurrent attempts to send will fail.
|
||||||
|
// Since sendRoutine has exited, we can call this
|
||||||
|
// safely
|
||||||
|
eof := c.sendSomePacketMsgs()
|
||||||
|
for !eof {
|
||||||
|
eof = c.sendSomePacketMsgs()
|
||||||
|
}
|
||||||
|
c.flush()
|
||||||
|
|
||||||
|
// Now we can close the connection
|
||||||
|
c.conn.Close() // nolint: errcheck
|
||||||
|
|
||||||
|
// We can't close pong safely here because
|
||||||
|
// recvRoutine may write to it after we've stopped.
|
||||||
|
// Though it doesn't need to get closed at all,
|
||||||
|
// we close it @ recvRoutine.
|
||||||
|
|
||||||
|
// c.Stop()
|
||||||
|
}
|
||||||
|
|
||||||
|
// OnStop implements BaseService
|
||||||
|
func (c *MConnection) OnStop() {
|
||||||
|
select {
|
||||||
|
case <-c.quitSendRoutine:
|
||||||
|
// already quit via FlushStop
|
||||||
|
return
|
||||||
|
default:
|
||||||
|
}
|
||||||
|
|
||||||
|
c.BaseService.OnStop()
|
||||||
|
c.flushTimer.Stop()
|
||||||
|
c.pingTimer.Stop()
|
||||||
|
c.chStatsTimer.Stop()
|
||||||
|
close(c.quitSendRoutine)
|
||||||
c.conn.Close() // nolint: errcheck
|
c.conn.Close() // nolint: errcheck
|
||||||
|
|
||||||
// We can't close pong safely here because
|
// We can't close pong safely here because
|
||||||
@@ -269,7 +318,7 @@ func (c *MConnection) Send(chID byte, msgBytes []byte) bool {
|
|||||||
default:
|
default:
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
c.Logger.Error("Send failed", "channel", chID, "conn", c, "msgBytes", fmt.Sprintf("%X", msgBytes))
|
c.Logger.Debug("Send failed", "channel", chID, "conn", c, "msgBytes", fmt.Sprintf("%X", msgBytes))
|
||||||
}
|
}
|
||||||
return success
|
return success
|
||||||
}
|
}
|
||||||
@@ -365,7 +414,8 @@ FOR_LOOP:
|
|||||||
}
|
}
|
||||||
c.sendMonitor.Update(int(_n))
|
c.sendMonitor.Update(int(_n))
|
||||||
c.flush()
|
c.flush()
|
||||||
case <-c.quit:
|
case <-c.quitSendRoutine:
|
||||||
|
close(c.doneSendRoutine)
|
||||||
break FOR_LOOP
|
break FOR_LOOP
|
||||||
case <-c.send:
|
case <-c.send:
|
||||||
// Send some PacketMsgs
|
// Send some PacketMsgs
|
||||||
|
@@ -36,6 +36,43 @@ func createMConnectionWithCallbacks(conn net.Conn, onReceive func(chID byte, msg
|
|||||||
return c
|
return c
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func TestMConnectionSendFlushStop(t *testing.T) {
|
||||||
|
server, client := NetPipe()
|
||||||
|
defer server.Close() // nolint: errcheck
|
||||||
|
defer client.Close() // nolint: errcheck
|
||||||
|
|
||||||
|
clientConn := createTestMConnection(client)
|
||||||
|
err := clientConn.Start()
|
||||||
|
require.Nil(t, err)
|
||||||
|
defer clientConn.Stop()
|
||||||
|
|
||||||
|
msg := []byte("abc")
|
||||||
|
assert.True(t, clientConn.Send(0x01, msg))
|
||||||
|
|
||||||
|
aminoMsgLength := 14
|
||||||
|
|
||||||
|
// start the reader in a new routine, so we can flush
|
||||||
|
errCh := make(chan error)
|
||||||
|
go func() {
|
||||||
|
msgB := make([]byte, aminoMsgLength)
|
||||||
|
_, err := server.Read(msgB)
|
||||||
|
if err != nil {
|
||||||
|
t.Fatal(err)
|
||||||
|
}
|
||||||
|
errCh <- err
|
||||||
|
}()
|
||||||
|
|
||||||
|
// stop the conn - it should flush all conns
|
||||||
|
clientConn.FlushStop()
|
||||||
|
|
||||||
|
timer := time.NewTimer(3 * time.Second)
|
||||||
|
select {
|
||||||
|
case <-errCh:
|
||||||
|
case <-timer.C:
|
||||||
|
t.Error("timed out waiting for msgs to be read")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
func TestMConnectionSend(t *testing.T) {
|
func TestMConnectionSend(t *testing.T) {
|
||||||
server, client := NetPipe()
|
server, client := NetPipe()
|
||||||
defer server.Close() // nolint: errcheck
|
defer server.Close() // nolint: errcheck
|
||||||
|
@@ -25,6 +25,11 @@ func NewPeer() *peer {
|
|||||||
return p
|
return p
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// FlushStop just calls Stop.
|
||||||
|
func (p *peer) FlushStop() {
|
||||||
|
p.Stop()
|
||||||
|
}
|
||||||
|
|
||||||
// ID always returns dummy.
|
// ID always returns dummy.
|
||||||
func (p *peer) ID() p2p.ID {
|
func (p *peer) ID() p2p.ID {
|
||||||
return p2p.ID("dummy")
|
return p2p.ID("dummy")
|
||||||
|
@@ -230,3 +230,31 @@ func (info DefaultNodeInfo) NetAddress() *NetAddress {
|
|||||||
}
|
}
|
||||||
return netAddr
|
return netAddr
|
||||||
}
|
}
|
||||||
|
|
||||||
|
//-----------------------------------------------------------
|
||||||
|
// These methods are for Protobuf Compatibility
|
||||||
|
|
||||||
|
// Size returns the size of the amino encoding, in bytes.
|
||||||
|
func (info *DefaultNodeInfo) Size() int {
|
||||||
|
bs, _ := info.Marshal()
|
||||||
|
return len(bs)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Marshal returns the amino encoding.
|
||||||
|
func (info *DefaultNodeInfo) Marshal() ([]byte, error) {
|
||||||
|
return cdc.MarshalBinaryBare(info)
|
||||||
|
}
|
||||||
|
|
||||||
|
// MarshalTo calls Marshal and copies to the given buffer.
|
||||||
|
func (info *DefaultNodeInfo) MarshalTo(data []byte) (int, error) {
|
||||||
|
bs, err := info.Marshal()
|
||||||
|
if err != nil {
|
||||||
|
return -1, err
|
||||||
|
}
|
||||||
|
return copy(data, bs), nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Unmarshal deserializes from amino encoded form.
|
||||||
|
func (info *DefaultNodeInfo) Unmarshal(bs []byte) error {
|
||||||
|
return cdc.UnmarshalBinaryBare(bs, info)
|
||||||
|
}
|
||||||
|
14
p2p/peer.go
14
p2p/peer.go
@@ -8,7 +8,6 @@ import (
|
|||||||
cmn "github.com/tendermint/tendermint/libs/common"
|
cmn "github.com/tendermint/tendermint/libs/common"
|
||||||
"github.com/tendermint/tendermint/libs/log"
|
"github.com/tendermint/tendermint/libs/log"
|
||||||
|
|
||||||
"github.com/tendermint/tendermint/config"
|
|
||||||
tmconn "github.com/tendermint/tendermint/p2p/conn"
|
tmconn "github.com/tendermint/tendermint/p2p/conn"
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -17,6 +16,7 @@ const metricsTickerDuration = 10 * time.Second
|
|||||||
// Peer is an interface representing a peer connected on a reactor.
|
// Peer is an interface representing a peer connected on a reactor.
|
||||||
type Peer interface {
|
type Peer interface {
|
||||||
cmn.Service
|
cmn.Service
|
||||||
|
FlushStop()
|
||||||
|
|
||||||
ID() ID // peer's cryptographic ID
|
ID() ID // peer's cryptographic ID
|
||||||
RemoteIP() net.IP // remote IP of the connection
|
RemoteIP() net.IP // remote IP of the connection
|
||||||
@@ -41,7 +41,6 @@ type Peer interface {
|
|||||||
type peerConn struct {
|
type peerConn struct {
|
||||||
outbound bool
|
outbound bool
|
||||||
persistent bool
|
persistent bool
|
||||||
config *config.P2PConfig
|
|
||||||
conn net.Conn // source connection
|
conn net.Conn // source connection
|
||||||
|
|
||||||
originalAddr *NetAddress // nil for inbound connections
|
originalAddr *NetAddress // nil for inbound connections
|
||||||
@@ -52,7 +51,6 @@ type peerConn struct {
|
|||||||
|
|
||||||
func newPeerConn(
|
func newPeerConn(
|
||||||
outbound, persistent bool,
|
outbound, persistent bool,
|
||||||
config *config.P2PConfig,
|
|
||||||
conn net.Conn,
|
conn net.Conn,
|
||||||
originalAddr *NetAddress,
|
originalAddr *NetAddress,
|
||||||
) peerConn {
|
) peerConn {
|
||||||
@@ -60,7 +58,6 @@ func newPeerConn(
|
|||||||
return peerConn{
|
return peerConn{
|
||||||
outbound: outbound,
|
outbound: outbound,
|
||||||
persistent: persistent,
|
persistent: persistent,
|
||||||
config: config,
|
|
||||||
conn: conn,
|
conn: conn,
|
||||||
originalAddr: originalAddr,
|
originalAddr: originalAddr,
|
||||||
}
|
}
|
||||||
@@ -184,6 +181,15 @@ func (p *peer) OnStart() error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// FlushStop mimics OnStop but additionally ensures that all successful
|
||||||
|
// .Send() calls will get flushed before closing the connection.
|
||||||
|
// NOTE: it is not safe to call this method more than once.
|
||||||
|
func (p *peer) FlushStop() {
|
||||||
|
p.metricsTicker.Stop()
|
||||||
|
p.BaseService.OnStop()
|
||||||
|
p.mconn.FlushStop() // stop everything and close the conn
|
||||||
|
}
|
||||||
|
|
||||||
// OnStop implements BaseService.
|
// OnStop implements BaseService.
|
||||||
func (p *peer) OnStop() {
|
func (p *peer) OnStop() {
|
||||||
p.metricsTicker.Stop()
|
p.metricsTicker.Stop()
|
||||||
|
@@ -18,6 +18,7 @@ type mockPeer struct {
|
|||||||
id ID
|
id ID
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func (mp *mockPeer) FlushStop() { mp.Stop() }
|
||||||
func (mp *mockPeer) TrySend(chID byte, msgBytes []byte) bool { return true }
|
func (mp *mockPeer) TrySend(chID byte, msgBytes []byte) bool { return true }
|
||||||
func (mp *mockPeer) Send(chID byte, msgBytes []byte) bool { return true }
|
func (mp *mockPeer) Send(chID byte, msgBytes []byte) bool { return true }
|
||||||
func (mp *mockPeer) NodeInfo() NodeInfo { return DefaultNodeInfo{} }
|
func (mp *mockPeer) NodeInfo() NodeInfo { return DefaultNodeInfo{} }
|
||||||
|
@@ -208,25 +208,38 @@ func (r *PEXReactor) Receive(chID byte, src Peer, msgBytes []byte) {
|
|||||||
|
|
||||||
switch msg := msg.(type) {
|
switch msg := msg.(type) {
|
||||||
case *pexRequestMessage:
|
case *pexRequestMessage:
|
||||||
// Check we're not receiving too many requests
|
|
||||||
|
// NOTE: this is a prime candidate for amplification attacks,
|
||||||
|
// so it's important we
|
||||||
|
// 1) restrict how frequently peers can request
|
||||||
|
// 2) limit the output size
|
||||||
|
|
||||||
|
// If we're a seed and this is an inbound peer,
|
||||||
|
// respond once and disconnect.
|
||||||
|
if r.config.SeedMode && !src.IsOutbound() {
|
||||||
|
id := string(src.ID())
|
||||||
|
v := r.lastReceivedRequests.Get(id)
|
||||||
|
if v != nil {
|
||||||
|
// FlushStop/StopPeer are already
|
||||||
|
// running in a go-routine.
|
||||||
|
return
|
||||||
|
}
|
||||||
|
r.lastReceivedRequests.Set(id, time.Now())
|
||||||
|
|
||||||
|
// Send addrs and disconnect
|
||||||
|
r.SendAddrs(src, r.book.GetSelectionWithBias(biasToSelectNewPeers))
|
||||||
|
go func() {
|
||||||
|
// In a go-routine so it doesn't block .Receive.
|
||||||
|
src.FlushStop()
|
||||||
|
r.Switch.StopPeerGracefully(src)
|
||||||
|
}()
|
||||||
|
|
||||||
|
} else {
|
||||||
|
// Check we're not receiving requests too frequently.
|
||||||
if err := r.receiveRequest(src); err != nil {
|
if err := r.receiveRequest(src); err != nil {
|
||||||
r.Switch.StopPeerForError(src, err)
|
r.Switch.StopPeerForError(src, err)
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
|
|
||||||
// Seeds disconnect after sending a batch of addrs
|
|
||||||
// NOTE: this is a prime candidate for amplification attacks
|
|
||||||
// so it's important we
|
|
||||||
// 1) restrict how frequently peers can request
|
|
||||||
// 2) limit the output size
|
|
||||||
if r.config.SeedMode {
|
|
||||||
r.SendAddrs(src, r.book.GetSelectionWithBias(biasToSelectNewPeers))
|
|
||||||
go func() {
|
|
||||||
// TODO Fix properly #2092
|
|
||||||
time.Sleep(time.Second * 5)
|
|
||||||
r.Switch.StopPeerGracefully(src)
|
|
||||||
}()
|
|
||||||
} else {
|
|
||||||
r.SendAddrs(src, r.book.GetSelection())
|
r.SendAddrs(src, r.book.GetSelection())
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -387,6 +387,7 @@ func newMockPeer() mockPeer {
|
|||||||
return mp
|
return mp
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func (mp mockPeer) FlushStop() { mp.Stop() }
|
||||||
func (mp mockPeer) ID() p2p.ID { return mp.addr.ID }
|
func (mp mockPeer) ID() p2p.ID { return mp.addr.ID }
|
||||||
func (mp mockPeer) IsOutbound() bool { return mp.outbound }
|
func (mp mockPeer) IsOutbound() bool { return mp.outbound }
|
||||||
func (mp mockPeer) IsPersistent() bool { return mp.persistent }
|
func (mp mockPeer) IsPersistent() bool { return mp.persistent }
|
||||||
|
@@ -27,6 +27,17 @@ const (
|
|||||||
reconnectBackOffBaseSeconds = 3
|
reconnectBackOffBaseSeconds = 3
|
||||||
)
|
)
|
||||||
|
|
||||||
|
// MConnConfig returns an MConnConfig with fields updated
|
||||||
|
// from the P2PConfig.
|
||||||
|
func MConnConfig(cfg *config.P2PConfig) conn.MConnConfig {
|
||||||
|
mConfig := conn.DefaultMConnConfig()
|
||||||
|
mConfig.FlushThrottle = cfg.FlushThrottleTimeout
|
||||||
|
mConfig.SendRate = cfg.SendRate
|
||||||
|
mConfig.RecvRate = cfg.RecvRate
|
||||||
|
mConfig.MaxPacketMsgPayloadSize = cfg.MaxPacketMsgPayloadSize
|
||||||
|
return mConfig
|
||||||
|
}
|
||||||
|
|
||||||
//-----------------------------------------------------------------------------
|
//-----------------------------------------------------------------------------
|
||||||
|
|
||||||
// An AddrBook represents an address book from the pex package, which is used
|
// An AddrBook represents an address book from the pex package, which is used
|
||||||
@@ -70,8 +81,6 @@ type Switch struct {
|
|||||||
filterTimeout time.Duration
|
filterTimeout time.Duration
|
||||||
peerFilters []PeerFilterFunc
|
peerFilters []PeerFilterFunc
|
||||||
|
|
||||||
mConfig conn.MConnConfig
|
|
||||||
|
|
||||||
rng *cmn.Rand // seed for randomizing dial times and orders
|
rng *cmn.Rand // seed for randomizing dial times and orders
|
||||||
|
|
||||||
metrics *Metrics
|
metrics *Metrics
|
||||||
@@ -102,14 +111,6 @@ func NewSwitch(
|
|||||||
// Ensure we have a completely undeterministic PRNG.
|
// Ensure we have a completely undeterministic PRNG.
|
||||||
sw.rng = cmn.NewRand()
|
sw.rng = cmn.NewRand()
|
||||||
|
|
||||||
mConfig := conn.DefaultMConnConfig()
|
|
||||||
mConfig.FlushThrottle = cfg.FlushThrottleTimeout
|
|
||||||
mConfig.SendRate = cfg.SendRate
|
|
||||||
mConfig.RecvRate = cfg.RecvRate
|
|
||||||
mConfig.MaxPacketMsgPayloadSize = cfg.MaxPacketMsgPayloadSize
|
|
||||||
|
|
||||||
sw.mConfig = mConfig
|
|
||||||
|
|
||||||
sw.BaseService = *cmn.NewBaseService(nil, "P2P Switch", sw)
|
sw.BaseService = *cmn.NewBaseService(nil, "P2P Switch", sw)
|
||||||
|
|
||||||
for _, option := range options {
|
for _, option := range options {
|
||||||
|
@@ -135,7 +135,7 @@ func (sw *Switch) addPeerWithConnection(conn net.Conn) error {
|
|||||||
|
|
||||||
p := newPeer(
|
p := newPeer(
|
||||||
pc,
|
pc,
|
||||||
sw.mConfig,
|
MConnConfig(sw.config),
|
||||||
ni,
|
ni,
|
||||||
sw.reactorsByCh,
|
sw.reactorsByCh,
|
||||||
sw.chDescs,
|
sw.chDescs,
|
||||||
@@ -175,7 +175,7 @@ func MakeSwitch(
|
|||||||
}
|
}
|
||||||
nodeInfo := testNodeInfo(nodeKey.ID(), fmt.Sprintf("node%d", i))
|
nodeInfo := testNodeInfo(nodeKey.ID(), fmt.Sprintf("node%d", i))
|
||||||
|
|
||||||
t := NewMultiplexTransport(nodeInfo, nodeKey)
|
t := NewMultiplexTransport(nodeInfo, nodeKey, MConnConfig(cfg))
|
||||||
|
|
||||||
addr := nodeInfo.NetAddress()
|
addr := nodeInfo.NetAddress()
|
||||||
if err := t.Listen(*addr); err != nil {
|
if err := t.Listen(*addr); err != nil {
|
||||||
@@ -232,7 +232,6 @@ func testPeerConn(
|
|||||||
|
|
||||||
// Only the information we already have
|
// Only the information we already have
|
||||||
return peerConn{
|
return peerConn{
|
||||||
config: cfg,
|
|
||||||
outbound: outbound,
|
outbound: outbound,
|
||||||
persistent: persistent,
|
persistent: persistent,
|
||||||
conn: conn,
|
conn: conn,
|
||||||
|
@@ -6,7 +6,6 @@ import (
|
|||||||
"net"
|
"net"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/tendermint/tendermint/config"
|
|
||||||
"github.com/tendermint/tendermint/crypto"
|
"github.com/tendermint/tendermint/crypto"
|
||||||
"github.com/tendermint/tendermint/p2p/conn"
|
"github.com/tendermint/tendermint/p2p/conn"
|
||||||
)
|
)
|
||||||
@@ -129,11 +128,10 @@ type MultiplexTransport struct {
|
|||||||
nodeKey NodeKey
|
nodeKey NodeKey
|
||||||
resolver IPResolver
|
resolver IPResolver
|
||||||
|
|
||||||
// TODO(xla): Those configs are still needed as we parameterise peerConn and
|
// TODO(xla): This config is still needed as we parameterise peerConn and
|
||||||
// peer currently. All relevant configuration should be refactored into options
|
// peer currently. All relevant configuration should be refactored into options
|
||||||
// with sane defaults.
|
// with sane defaults.
|
||||||
mConfig conn.MConnConfig
|
mConfig conn.MConnConfig
|
||||||
p2pConfig config.P2PConfig
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// Test multiplexTransport for interface completeness.
|
// Test multiplexTransport for interface completeness.
|
||||||
@@ -144,6 +142,7 @@ var _ transportLifecycle = (*MultiplexTransport)(nil)
|
|||||||
func NewMultiplexTransport(
|
func NewMultiplexTransport(
|
||||||
nodeInfo NodeInfo,
|
nodeInfo NodeInfo,
|
||||||
nodeKey NodeKey,
|
nodeKey NodeKey,
|
||||||
|
mConfig conn.MConnConfig,
|
||||||
) *MultiplexTransport {
|
) *MultiplexTransport {
|
||||||
return &MultiplexTransport{
|
return &MultiplexTransport{
|
||||||
acceptc: make(chan accept),
|
acceptc: make(chan accept),
|
||||||
@@ -151,7 +150,7 @@ func NewMultiplexTransport(
|
|||||||
dialTimeout: defaultDialTimeout,
|
dialTimeout: defaultDialTimeout,
|
||||||
filterTimeout: defaultFilterTimeout,
|
filterTimeout: defaultFilterTimeout,
|
||||||
handshakeTimeout: defaultHandshakeTimeout,
|
handshakeTimeout: defaultHandshakeTimeout,
|
||||||
mConfig: conn.DefaultMConnConfig(),
|
mConfig: mConfig,
|
||||||
nodeInfo: nodeInfo,
|
nodeInfo: nodeInfo,
|
||||||
nodeKey: nodeKey,
|
nodeKey: nodeKey,
|
||||||
conns: NewConnSet(),
|
conns: NewConnSet(),
|
||||||
@@ -405,7 +404,6 @@ func (mt *MultiplexTransport) wrapPeer(
|
|||||||
peerConn := newPeerConn(
|
peerConn := newPeerConn(
|
||||||
cfg.outbound,
|
cfg.outbound,
|
||||||
cfg.persistent,
|
cfg.persistent,
|
||||||
&mt.p2pConfig,
|
|
||||||
c,
|
c,
|
||||||
dialedAddr,
|
dialedAddr,
|
||||||
)
|
)
|
||||||
|
@@ -9,6 +9,7 @@ import (
|
|||||||
"time"
|
"time"
|
||||||
|
|
||||||
"github.com/tendermint/tendermint/crypto/ed25519"
|
"github.com/tendermint/tendermint/crypto/ed25519"
|
||||||
|
"github.com/tendermint/tendermint/p2p/conn"
|
||||||
)
|
)
|
||||||
|
|
||||||
var defaultNodeName = "host_peer"
|
var defaultNodeName = "host_peer"
|
||||||
@@ -17,8 +18,20 @@ func emptyNodeInfo() NodeInfo {
|
|||||||
return DefaultNodeInfo{}
|
return DefaultNodeInfo{}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// newMultiplexTransport returns a tcp connected multiplexed peer
|
||||||
|
// using the default MConnConfig. It's a convenience function used
|
||||||
|
// for testing.
|
||||||
|
func newMultiplexTransport(
|
||||||
|
nodeInfo NodeInfo,
|
||||||
|
nodeKey NodeKey,
|
||||||
|
) *MultiplexTransport {
|
||||||
|
return NewMultiplexTransport(
|
||||||
|
nodeInfo, nodeKey, conn.DefaultMConnConfig(),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
func TestTransportMultiplexConnFilter(t *testing.T) {
|
func TestTransportMultiplexConnFilter(t *testing.T) {
|
||||||
mt := NewMultiplexTransport(
|
mt := newMultiplexTransport(
|
||||||
emptyNodeInfo(),
|
emptyNodeInfo(),
|
||||||
NodeKey{
|
NodeKey{
|
||||||
PrivKey: ed25519.GenPrivKey(),
|
PrivKey: ed25519.GenPrivKey(),
|
||||||
@@ -75,7 +88,7 @@ func TestTransportMultiplexConnFilter(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func TestTransportMultiplexConnFilterTimeout(t *testing.T) {
|
func TestTransportMultiplexConnFilterTimeout(t *testing.T) {
|
||||||
mt := NewMultiplexTransport(
|
mt := newMultiplexTransport(
|
||||||
emptyNodeInfo(),
|
emptyNodeInfo(),
|
||||||
NodeKey{
|
NodeKey{
|
||||||
PrivKey: ed25519.GenPrivKey(),
|
PrivKey: ed25519.GenPrivKey(),
|
||||||
@@ -140,7 +153,7 @@ func TestTransportMultiplexAcceptMultiple(t *testing.T) {
|
|||||||
go func() {
|
go func() {
|
||||||
var (
|
var (
|
||||||
pv = ed25519.GenPrivKey()
|
pv = ed25519.GenPrivKey()
|
||||||
dialer = NewMultiplexTransport(
|
dialer = newMultiplexTransport(
|
||||||
testNodeInfo(PubKeyToID(pv.PubKey()), defaultNodeName),
|
testNodeInfo(PubKeyToID(pv.PubKey()), defaultNodeName),
|
||||||
NodeKey{
|
NodeKey{
|
||||||
PrivKey: pv,
|
PrivKey: pv,
|
||||||
@@ -261,7 +274,7 @@ func TestTransportMultiplexAcceptNonBlocking(t *testing.T) {
|
|||||||
<-slowc
|
<-slowc
|
||||||
|
|
||||||
var (
|
var (
|
||||||
dialer = NewMultiplexTransport(
|
dialer = newMultiplexTransport(
|
||||||
fastNodeInfo,
|
fastNodeInfo,
|
||||||
NodeKey{
|
NodeKey{
|
||||||
PrivKey: fastNodePV,
|
PrivKey: fastNodePV,
|
||||||
@@ -307,7 +320,7 @@ func TestTransportMultiplexValidateNodeInfo(t *testing.T) {
|
|||||||
go func() {
|
go func() {
|
||||||
var (
|
var (
|
||||||
pv = ed25519.GenPrivKey()
|
pv = ed25519.GenPrivKey()
|
||||||
dialer = NewMultiplexTransport(
|
dialer = newMultiplexTransport(
|
||||||
testNodeInfo(PubKeyToID(pv.PubKey()), ""), // Should not be empty
|
testNodeInfo(PubKeyToID(pv.PubKey()), ""), // Should not be empty
|
||||||
NodeKey{
|
NodeKey{
|
||||||
PrivKey: pv,
|
PrivKey: pv,
|
||||||
@@ -350,7 +363,7 @@ func TestTransportMultiplexRejectMissmatchID(t *testing.T) {
|
|||||||
errc := make(chan error)
|
errc := make(chan error)
|
||||||
|
|
||||||
go func() {
|
go func() {
|
||||||
dialer := NewMultiplexTransport(
|
dialer := newMultiplexTransport(
|
||||||
testNodeInfo(
|
testNodeInfo(
|
||||||
PubKeyToID(ed25519.GenPrivKey().PubKey()), "dialer",
|
PubKeyToID(ed25519.GenPrivKey().PubKey()), "dialer",
|
||||||
),
|
),
|
||||||
@@ -396,7 +409,7 @@ func TestTransportMultiplexRejectIncompatible(t *testing.T) {
|
|||||||
go func() {
|
go func() {
|
||||||
var (
|
var (
|
||||||
pv = ed25519.GenPrivKey()
|
pv = ed25519.GenPrivKey()
|
||||||
dialer = NewMultiplexTransport(
|
dialer = newMultiplexTransport(
|
||||||
testNodeInfoWithNetwork(PubKeyToID(pv.PubKey()), "dialer", "incompatible-network"),
|
testNodeInfoWithNetwork(PubKeyToID(pv.PubKey()), "dialer", "incompatible-network"),
|
||||||
NodeKey{
|
NodeKey{
|
||||||
PrivKey: pv,
|
PrivKey: pv,
|
||||||
@@ -553,7 +566,7 @@ func TestTransportHandshake(t *testing.T) {
|
|||||||
func testSetupMultiplexTransport(t *testing.T) *MultiplexTransport {
|
func testSetupMultiplexTransport(t *testing.T) *MultiplexTransport {
|
||||||
var (
|
var (
|
||||||
pv = ed25519.GenPrivKey()
|
pv = ed25519.GenPrivKey()
|
||||||
mt = NewMultiplexTransport(
|
mt = newMultiplexTransport(
|
||||||
testNodeInfo(
|
testNodeInfo(
|
||||||
PubKeyToID(pv.PubKey()), "transport",
|
PubKeyToID(pv.PubKey()), "transport",
|
||||||
),
|
),
|
||||||
|
@@ -69,6 +69,7 @@ func (rs *IPCRemoteSigner) OnStart() error {
|
|||||||
for {
|
for {
|
||||||
conn, err := rs.listener.AcceptUnix()
|
conn, err := rs.listener.AcceptUnix()
|
||||||
if err != nil {
|
if err != nil {
|
||||||
|
rs.Logger.Error("AcceptUnix", "err", err)
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
go rs.handleConnection(conn)
|
go rs.handleConnection(conn)
|
||||||
|
@@ -370,20 +370,27 @@ func TestTxSearch(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// query by height
|
// query by height
|
||||||
result, err = c.TxSearch(fmt.Sprintf("tx.height >= %d", txHeight), true, 1, 30)
|
result, err = c.TxSearch(fmt.Sprintf("tx.height=%d", txHeight), true, 1, 30)
|
||||||
require.Nil(t, err, "%+v", err)
|
require.Nil(t, err, "%+v", err)
|
||||||
require.Len(t, result.Txs, 1)
|
require.Len(t, result.Txs, 1)
|
||||||
|
|
||||||
// we query for non existing tx
|
// query for non existing tx
|
||||||
result, err = c.TxSearch(fmt.Sprintf("tx.hash='%X'", anotherTxHash), false, 1, 30)
|
result, err = c.TxSearch(fmt.Sprintf("tx.hash='%X'", anotherTxHash), false, 1, 30)
|
||||||
require.Nil(t, err, "%+v", err)
|
require.Nil(t, err, "%+v", err)
|
||||||
require.Len(t, result.Txs, 0)
|
require.Len(t, result.Txs, 0)
|
||||||
|
|
||||||
// we query using a tag (see kvstore application)
|
// query using a tag (see kvstore application)
|
||||||
result, err = c.TxSearch("app.creator='Cosmoshi Netowoko'", false, 1, 30)
|
result, err = c.TxSearch("app.creator='Cosmoshi Netowoko'", false, 1, 30)
|
||||||
require.Nil(t, err, "%+v", err)
|
require.Nil(t, err, "%+v", err)
|
||||||
if len(result.Txs) == 0 {
|
if len(result.Txs) == 0 {
|
||||||
t.Fatal("expected a lot of transactions")
|
t.Fatal("expected a lot of transactions")
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// query using a tag (see kvstore application) and height
|
||||||
|
result, err = c.TxSearch("app.creator='Cosmoshi Netowoko' AND tx.height<10000", true, 1, 30)
|
||||||
|
require.Nil(t, err, "%+v", err)
|
||||||
|
if len(result.Txs) == 0 {
|
||||||
|
t.Fatal("expected a lot of transactions")
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@@ -2,6 +2,7 @@ package core
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"context"
|
"context"
|
||||||
|
"fmt"
|
||||||
|
|
||||||
"github.com/pkg/errors"
|
"github.com/pkg/errors"
|
||||||
|
|
||||||
@@ -104,7 +105,7 @@ func Subscribe(wsCtx rpctypes.WSRPCContext, query string) (*ctypes.ResultSubscri
|
|||||||
go func() {
|
go func() {
|
||||||
for event := range ch {
|
for event := range ch {
|
||||||
tmResult := &ctypes.ResultEvent{query, event.(tmtypes.TMEventData)}
|
tmResult := &ctypes.ResultEvent{query, event.(tmtypes.TMEventData)}
|
||||||
wsCtx.TryWriteRPCResponse(rpctypes.NewRPCSuccessResponse(wsCtx.Codec(), wsCtx.Request.ID+"#event", tmResult))
|
wsCtx.TryWriteRPCResponse(rpctypes.NewRPCSuccessResponse(wsCtx.Codec(), rpctypes.JSONRPCStringID(fmt.Sprintf("%v#event", wsCtx.Request.ID)), tmResult))
|
||||||
}
|
}
|
||||||
}()
|
}()
|
||||||
|
|
||||||
|
@@ -9,6 +9,7 @@ import (
|
|||||||
|
|
||||||
abci "github.com/tendermint/tendermint/abci/types"
|
abci "github.com/tendermint/tendermint/abci/types"
|
||||||
ctypes "github.com/tendermint/tendermint/rpc/core/types"
|
ctypes "github.com/tendermint/tendermint/rpc/core/types"
|
||||||
|
rpcserver "github.com/tendermint/tendermint/rpc/lib/server"
|
||||||
"github.com/tendermint/tendermint/types"
|
"github.com/tendermint/tendermint/types"
|
||||||
)
|
)
|
||||||
|
|
||||||
@@ -194,7 +195,8 @@ func BroadcastTxCommit(tx types.Tx) (*ctypes.ResultBroadcastTxCommit, error) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Wait for the tx to be included in a block or timeout.
|
// Wait for the tx to be included in a block or timeout.
|
||||||
var deliverTxTimeout = 10 * time.Second // TODO: configurable?
|
// TODO: configurable?
|
||||||
|
var deliverTxTimeout = rpcserver.WriteTimeout / 2
|
||||||
select {
|
select {
|
||||||
case deliverTxResMsg := <-deliverTxResCh: // The tx was included in a block.
|
case deliverTxResMsg := <-deliverTxResCh: // The tx was included in a block.
|
||||||
deliverTxRes := deliverTxResMsg.(types.EventDataTx)
|
deliverTxRes := deliverTxResMsg.(types.EventDataTx)
|
||||||
|
@@ -1,8 +1,6 @@
|
|||||||
package core
|
package core
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"time"
|
|
||||||
|
|
||||||
"github.com/tendermint/tendermint/consensus"
|
"github.com/tendermint/tendermint/consensus"
|
||||||
crypto "github.com/tendermint/tendermint/crypto"
|
crypto "github.com/tendermint/tendermint/crypto"
|
||||||
dbm "github.com/tendermint/tendermint/libs/db"
|
dbm "github.com/tendermint/tendermint/libs/db"
|
||||||
@@ -10,6 +8,7 @@ import (
|
|||||||
mempl "github.com/tendermint/tendermint/mempool"
|
mempl "github.com/tendermint/tendermint/mempool"
|
||||||
"github.com/tendermint/tendermint/p2p"
|
"github.com/tendermint/tendermint/p2p"
|
||||||
"github.com/tendermint/tendermint/proxy"
|
"github.com/tendermint/tendermint/proxy"
|
||||||
|
rpcserver "github.com/tendermint/tendermint/rpc/lib/server"
|
||||||
sm "github.com/tendermint/tendermint/state"
|
sm "github.com/tendermint/tendermint/state"
|
||||||
"github.com/tendermint/tendermint/state/txindex"
|
"github.com/tendermint/tendermint/state/txindex"
|
||||||
"github.com/tendermint/tendermint/types"
|
"github.com/tendermint/tendermint/types"
|
||||||
@@ -21,7 +20,7 @@ const (
|
|||||||
maxPerPage = 100
|
maxPerPage = 100
|
||||||
)
|
)
|
||||||
|
|
||||||
var subscribeTimeout = 5 * time.Second
|
var subscribeTimeout = rpcserver.WriteTimeout / 2
|
||||||
|
|
||||||
//----------------------------------------------
|
//----------------------------------------------
|
||||||
// These interfaces are used by RPC and must be thread safe
|
// These interfaces are used by RPC and must be thread safe
|
||||||
|
@@ -1,12 +1,9 @@
|
|||||||
package core_grpc
|
package core_grpc
|
||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
|
||||||
"net"
|
"net"
|
||||||
"strings"
|
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
"golang.org/x/net/netutil"
|
|
||||||
"google.golang.org/grpc"
|
"google.golang.org/grpc"
|
||||||
|
|
||||||
cmn "github.com/tendermint/tendermint/libs/common"
|
cmn "github.com/tendermint/tendermint/libs/common"
|
||||||
@@ -17,28 +14,12 @@ type Config struct {
|
|||||||
MaxOpenConnections int
|
MaxOpenConnections int
|
||||||
}
|
}
|
||||||
|
|
||||||
// StartGRPCServer starts a new gRPC BroadcastAPIServer, listening on
|
// StartGRPCServer starts a new gRPC BroadcastAPIServer using the given net.Listener.
|
||||||
// protoAddr, in a goroutine. Returns a listener and an error, if it fails to
|
// NOTE: This function blocks - you may want to call it in a go-routine.
|
||||||
// parse an address.
|
func StartGRPCServer(ln net.Listener) error {
|
||||||
func StartGRPCServer(protoAddr string, config Config) (net.Listener, error) {
|
|
||||||
parts := strings.SplitN(protoAddr, "://", 2)
|
|
||||||
if len(parts) != 2 {
|
|
||||||
return nil, fmt.Errorf("Invalid listen address for grpc server (did you forget a tcp:// prefix?) : %s", protoAddr)
|
|
||||||
}
|
|
||||||
proto, addr := parts[0], parts[1]
|
|
||||||
ln, err := net.Listen(proto, addr)
|
|
||||||
if err != nil {
|
|
||||||
return nil, err
|
|
||||||
}
|
|
||||||
if config.MaxOpenConnections > 0 {
|
|
||||||
ln = netutil.LimitListener(ln, config.MaxOpenConnections)
|
|
||||||
}
|
|
||||||
|
|
||||||
grpcServer := grpc.NewServer()
|
grpcServer := grpc.NewServer()
|
||||||
RegisterBroadcastAPIServer(grpcServer, &broadcastAPI{})
|
RegisterBroadcastAPIServer(grpcServer, &broadcastAPI{})
|
||||||
go grpcServer.Serve(ln) // nolint: errcheck
|
return grpcServer.Serve(ln)
|
||||||
|
|
||||||
return ln, nil
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// StartGRPCClient dials the gRPC server using protoAddr and returns a new
|
// StartGRPCClient dials the gRPC server using protoAddr and returns a new
|
||||||
|
@@ -99,7 +99,7 @@ func NewJSONRPCClient(remote string) *JSONRPCClient {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func (c *JSONRPCClient) Call(method string, params map[string]interface{}, result interface{}) (interface{}, error) {
|
func (c *JSONRPCClient) Call(method string, params map[string]interface{}, result interface{}) (interface{}, error) {
|
||||||
request, err := types.MapToRequest(c.cdc, "jsonrpc-client", method, params)
|
request, err := types.MapToRequest(c.cdc, types.JSONRPCStringID("jsonrpc-client"), method, params)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return nil, err
|
return nil, err
|
||||||
}
|
}
|
||||||
|
@@ -214,7 +214,7 @@ func (c *WSClient) Send(ctx context.Context, request types.RPCRequest) error {
|
|||||||
|
|
||||||
// Call the given method. See Send description.
|
// Call the given method. See Send description.
|
||||||
func (c *WSClient) Call(ctx context.Context, method string, params map[string]interface{}) error {
|
func (c *WSClient) Call(ctx context.Context, method string, params map[string]interface{}) error {
|
||||||
request, err := types.MapToRequest(c.cdc, "ws-client", method, params)
|
request, err := types.MapToRequest(c.cdc, types.JSONRPCStringID("ws-client"), method, params)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
@@ -224,7 +224,7 @@ func (c *WSClient) Call(ctx context.Context, method string, params map[string]in
|
|||||||
// CallWithArrayParams the given method with params in a form of array. See
|
// CallWithArrayParams the given method with params in a form of array. See
|
||||||
// Send description.
|
// Send description.
|
||||||
func (c *WSClient) CallWithArrayParams(ctx context.Context, method string, params []interface{}) error {
|
func (c *WSClient) CallWithArrayParams(ctx context.Context, method string, params []interface{}) error {
|
||||||
request, err := types.ArrayToRequest(c.cdc, "ws-client", method, params)
|
request, err := types.ArrayToRequest(c.cdc, types.JSONRPCStringID("ws-client"), method, params)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return err
|
||||||
}
|
}
|
||||||
|
@@ -70,12 +70,9 @@
|
|||||||
// wm := rpcserver.NewWebsocketManager(Routes)
|
// wm := rpcserver.NewWebsocketManager(Routes)
|
||||||
// mux.HandleFunc("/websocket", wm.WebsocketHandler)
|
// mux.HandleFunc("/websocket", wm.WebsocketHandler)
|
||||||
// logger := log.NewTMLogger(log.NewSyncWriter(os.Stdout))
|
// logger := log.NewTMLogger(log.NewSyncWriter(os.Stdout))
|
||||||
// go func() {
|
// listener, err := rpc.Listen("0.0.0.0:8080", rpcserver.Config{})
|
||||||
// _, err := rpcserver.StartHTTPServer("0.0.0.0:8008", mux, logger)
|
// if err != nil { panic(err) }
|
||||||
// if err != nil {
|
// go rpcserver.StartHTTPServer(listener, mux, logger)
|
||||||
// panic(err)
|
|
||||||
// }
|
|
||||||
// }()
|
|
||||||
//
|
//
|
||||||
// Note that unix sockets are supported as well (eg. `/path/to/socket` instead of `0.0.0.0:8008`)
|
// Note that unix sockets are supported as well (eg. `/path/to/socket` instead of `0.0.0.0:8008`)
|
||||||
// Now see all available endpoints by sending a GET request to `0.0.0.0:8008`.
|
// Now see all available endpoints by sending a GET request to `0.0.0.0:8008`.
|
||||||
|
@@ -121,12 +121,11 @@ func setup() {
|
|||||||
wm := server.NewWebsocketManager(Routes, RoutesCdc, server.ReadWait(5*time.Second), server.PingPeriod(1*time.Second))
|
wm := server.NewWebsocketManager(Routes, RoutesCdc, server.ReadWait(5*time.Second), server.PingPeriod(1*time.Second))
|
||||||
wm.SetLogger(tcpLogger)
|
wm.SetLogger(tcpLogger)
|
||||||
mux.HandleFunc(websocketEndpoint, wm.WebsocketHandler)
|
mux.HandleFunc(websocketEndpoint, wm.WebsocketHandler)
|
||||||
go func() {
|
listener1, err := server.Listen(tcpAddr, server.Config{})
|
||||||
_, err := server.StartHTTPServer(tcpAddr, mux, tcpLogger, server.Config{})
|
|
||||||
if err != nil {
|
if err != nil {
|
||||||
panic(err)
|
panic(err)
|
||||||
}
|
}
|
||||||
}()
|
go server.StartHTTPServer(listener1, mux, tcpLogger)
|
||||||
|
|
||||||
unixLogger := logger.With("socket", "unix")
|
unixLogger := logger.With("socket", "unix")
|
||||||
mux2 := http.NewServeMux()
|
mux2 := http.NewServeMux()
|
||||||
@@ -134,12 +133,11 @@ func setup() {
|
|||||||
wm = server.NewWebsocketManager(Routes, RoutesCdc)
|
wm = server.NewWebsocketManager(Routes, RoutesCdc)
|
||||||
wm.SetLogger(unixLogger)
|
wm.SetLogger(unixLogger)
|
||||||
mux2.HandleFunc(websocketEndpoint, wm.WebsocketHandler)
|
mux2.HandleFunc(websocketEndpoint, wm.WebsocketHandler)
|
||||||
go func() {
|
listener2, err := server.Listen(unixAddr, server.Config{})
|
||||||
_, err := server.StartHTTPServer(unixAddr, mux2, unixLogger, server.Config{})
|
|
||||||
if err != nil {
|
if err != nil {
|
||||||
panic(err)
|
panic(err)
|
||||||
}
|
}
|
||||||
}()
|
go server.StartHTTPServer(listener2, mux2, unixLogger)
|
||||||
|
|
||||||
// wait for servers to start
|
// wait for servers to start
|
||||||
time.Sleep(time.Second * 2)
|
time.Sleep(time.Second * 2)
|
||||||
|
@@ -103,7 +103,7 @@ func makeJSONRPCHandler(funcMap map[string]*RPCFunc, cdc *amino.Codec, logger lo
|
|||||||
return func(w http.ResponseWriter, r *http.Request) {
|
return func(w http.ResponseWriter, r *http.Request) {
|
||||||
b, err := ioutil.ReadAll(r.Body)
|
b, err := ioutil.ReadAll(r.Body)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
WriteRPCResponseHTTP(w, types.RPCInvalidRequestError("", errors.Wrap(err, "Error reading request body")))
|
WriteRPCResponseHTTP(w, types.RPCInvalidRequestError(types.JSONRPCStringID(""), errors.Wrap(err, "Error reading request body")))
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
// if its an empty request (like from a browser),
|
// if its an empty request (like from a browser),
|
||||||
@@ -116,12 +116,12 @@ func makeJSONRPCHandler(funcMap map[string]*RPCFunc, cdc *amino.Codec, logger lo
|
|||||||
var request types.RPCRequest
|
var request types.RPCRequest
|
||||||
err = json.Unmarshal(b, &request)
|
err = json.Unmarshal(b, &request)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
WriteRPCResponseHTTP(w, types.RPCParseError("", errors.Wrap(err, "Error unmarshalling request")))
|
WriteRPCResponseHTTP(w, types.RPCParseError(types.JSONRPCStringID(""), errors.Wrap(err, "Error unmarshalling request")))
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
// A Notification is a Request object without an "id" member.
|
// A Notification is a Request object without an "id" member.
|
||||||
// The Server MUST NOT reply to a Notification, including those that are within a batch request.
|
// The Server MUST NOT reply to a Notification, including those that are within a batch request.
|
||||||
if request.ID == "" {
|
if request.ID == types.JSONRPCStringID("") {
|
||||||
logger.Debug("HTTPJSONRPC received a notification, skipping... (please send a non-empty ID if you want to call a method)")
|
logger.Debug("HTTPJSONRPC received a notification, skipping... (please send a non-empty ID if you want to call a method)")
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
@@ -255,7 +255,7 @@ func makeHTTPHandler(rpcFunc *RPCFunc, cdc *amino.Codec, logger log.Logger) func
|
|||||||
// Exception for websocket endpoints
|
// Exception for websocket endpoints
|
||||||
if rpcFunc.ws {
|
if rpcFunc.ws {
|
||||||
return func(w http.ResponseWriter, r *http.Request) {
|
return func(w http.ResponseWriter, r *http.Request) {
|
||||||
WriteRPCResponseHTTP(w, types.RPCMethodNotFoundError(""))
|
WriteRPCResponseHTTP(w, types.RPCMethodNotFoundError(types.JSONRPCStringID("")))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
// All other endpoints
|
// All other endpoints
|
||||||
@@ -263,17 +263,17 @@ func makeHTTPHandler(rpcFunc *RPCFunc, cdc *amino.Codec, logger log.Logger) func
|
|||||||
logger.Debug("HTTP HANDLER", "req", r)
|
logger.Debug("HTTP HANDLER", "req", r)
|
||||||
args, err := httpParamsToArgs(rpcFunc, cdc, r)
|
args, err := httpParamsToArgs(rpcFunc, cdc, r)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
WriteRPCResponseHTTP(w, types.RPCInvalidParamsError("", errors.Wrap(err, "Error converting http params to arguments")))
|
WriteRPCResponseHTTP(w, types.RPCInvalidParamsError(types.JSONRPCStringID(""), errors.Wrap(err, "Error converting http params to arguments")))
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
returns := rpcFunc.f.Call(args)
|
returns := rpcFunc.f.Call(args)
|
||||||
logger.Info("HTTPRestRPC", "method", r.URL.Path, "args", args, "returns", returns)
|
logger.Info("HTTPRestRPC", "method", r.URL.Path, "args", args, "returns", returns)
|
||||||
result, err := unreflectResult(returns)
|
result, err := unreflectResult(returns)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
WriteRPCResponseHTTP(w, types.RPCInternalError("", err))
|
WriteRPCResponseHTTP(w, types.RPCInternalError(types.JSONRPCStringID(""), err))
|
||||||
return
|
return
|
||||||
}
|
}
|
||||||
WriteRPCResponseHTTP(w, types.NewRPCSuccessResponse(cdc, "", result))
|
WriteRPCResponseHTTP(w, types.NewRPCSuccessResponse(cdc, types.JSONRPCStringID(""), result))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -580,7 +580,7 @@ func (wsc *wsConnection) readRoutine() {
|
|||||||
err = fmt.Errorf("WSJSONRPC: %v", r)
|
err = fmt.Errorf("WSJSONRPC: %v", r)
|
||||||
}
|
}
|
||||||
wsc.Logger.Error("Panic in WSJSONRPC handler", "err", err, "stack", string(debug.Stack()))
|
wsc.Logger.Error("Panic in WSJSONRPC handler", "err", err, "stack", string(debug.Stack()))
|
||||||
wsc.WriteRPCResponse(types.RPCInternalError("unknown", err))
|
wsc.WriteRPCResponse(types.RPCInternalError(types.JSONRPCStringID("unknown"), err))
|
||||||
go wsc.readRoutine()
|
go wsc.readRoutine()
|
||||||
} else {
|
} else {
|
||||||
wsc.baseConn.Close() // nolint: errcheck
|
wsc.baseConn.Close() // nolint: errcheck
|
||||||
@@ -615,13 +615,13 @@ func (wsc *wsConnection) readRoutine() {
|
|||||||
var request types.RPCRequest
|
var request types.RPCRequest
|
||||||
err = json.Unmarshal(in, &request)
|
err = json.Unmarshal(in, &request)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
wsc.WriteRPCResponse(types.RPCParseError("", errors.Wrap(err, "Error unmarshaling request")))
|
wsc.WriteRPCResponse(types.RPCParseError(types.JSONRPCStringID(""), errors.Wrap(err, "Error unmarshaling request")))
|
||||||
continue
|
continue
|
||||||
}
|
}
|
||||||
|
|
||||||
// A Notification is a Request object without an "id" member.
|
// A Notification is a Request object without an "id" member.
|
||||||
// The Server MUST NOT reply to a Notification, including those that are within a batch request.
|
// The Server MUST NOT reply to a Notification, including those that are within a batch request.
|
||||||
if request.ID == "" {
|
if request.ID == types.JSONRPCStringID("") {
|
||||||
wsc.Logger.Debug("WSJSONRPC received a notification, skipping... (please send a non-empty ID if you want to call a method)")
|
wsc.Logger.Debug("WSJSONRPC received a notification, skipping... (please send a non-empty ID if you want to call a method)")
|
||||||
continue
|
continue
|
||||||
}
|
}
|
||||||
|
@@ -49,19 +49,20 @@ func TestRPCParams(t *testing.T) {
|
|||||||
tests := []struct {
|
tests := []struct {
|
||||||
payload string
|
payload string
|
||||||
wantErr string
|
wantErr string
|
||||||
|
expectedId interface{}
|
||||||
}{
|
}{
|
||||||
// bad
|
// bad
|
||||||
{`{"jsonrpc": "2.0", "id": "0"}`, "Method not found"},
|
{`{"jsonrpc": "2.0", "id": "0"}`, "Method not found", types.JSONRPCStringID("0")},
|
||||||
{`{"jsonrpc": "2.0", "method": "y", "id": "0"}`, "Method not found"},
|
{`{"jsonrpc": "2.0", "method": "y", "id": "0"}`, "Method not found", types.JSONRPCStringID("0")},
|
||||||
{`{"method": "c", "id": "0", "params": a}`, "invalid character"},
|
{`{"method": "c", "id": "0", "params": a}`, "invalid character", types.JSONRPCStringID("")}, // id not captured in JSON parsing failures
|
||||||
{`{"method": "c", "id": "0", "params": ["a"]}`, "got 1"},
|
{`{"method": "c", "id": "0", "params": ["a"]}`, "got 1", types.JSONRPCStringID("0")},
|
||||||
{`{"method": "c", "id": "0", "params": ["a", "b"]}`, "invalid character"},
|
{`{"method": "c", "id": "0", "params": ["a", "b"]}`, "invalid character", types.JSONRPCStringID("0")},
|
||||||
{`{"method": "c", "id": "0", "params": [1, 1]}`, "of type string"},
|
{`{"method": "c", "id": "0", "params": [1, 1]}`, "of type string", types.JSONRPCStringID("0")},
|
||||||
|
|
||||||
// good
|
// good
|
||||||
{`{"jsonrpc": "2.0", "method": "c", "id": "0", "params": null}`, ""},
|
{`{"jsonrpc": "2.0", "method": "c", "id": "0", "params": null}`, "", types.JSONRPCStringID("0")},
|
||||||
{`{"method": "c", "id": "0", "params": {}}`, ""},
|
{`{"method": "c", "id": "0", "params": {}}`, "", types.JSONRPCStringID("0")},
|
||||||
{`{"method": "c", "id": "0", "params": ["a", "10"]}`, ""},
|
{`{"method": "c", "id": "0", "params": ["a", "10"]}`, "", types.JSONRPCStringID("0")},
|
||||||
}
|
}
|
||||||
|
|
||||||
for i, tt := range tests {
|
for i, tt := range tests {
|
||||||
@@ -80,7 +81,7 @@ func TestRPCParams(t *testing.T) {
|
|||||||
recv := new(types.RPCResponse)
|
recv := new(types.RPCResponse)
|
||||||
assert.Nil(t, json.Unmarshal(blob, recv), "#%d: expecting successful parsing of an RPCResponse:\nblob: %s", i, blob)
|
assert.Nil(t, json.Unmarshal(blob, recv), "#%d: expecting successful parsing of an RPCResponse:\nblob: %s", i, blob)
|
||||||
assert.NotEqual(t, recv, new(types.RPCResponse), "#%d: not expecting a blank RPCResponse", i)
|
assert.NotEqual(t, recv, new(types.RPCResponse), "#%d: not expecting a blank RPCResponse", i)
|
||||||
|
assert.Equal(t, tt.expectedId, recv.ID, "#%d: expected ID not matched in RPCResponse", i)
|
||||||
if tt.wantErr == "" {
|
if tt.wantErr == "" {
|
||||||
assert.Nil(t, recv.Error, "#%d: not expecting an error", i)
|
assert.Nil(t, recv.Error, "#%d: not expecting an error", i)
|
||||||
} else {
|
} else {
|
||||||
@@ -91,9 +92,56 @@ func TestRPCParams(t *testing.T) {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func TestJSONRPCID(t *testing.T) {
|
||||||
|
mux := testMux()
|
||||||
|
tests := []struct {
|
||||||
|
payload string
|
||||||
|
wantErr bool
|
||||||
|
expectedId interface{}
|
||||||
|
}{
|
||||||
|
// good id
|
||||||
|
{`{"jsonrpc": "2.0", "method": "c", "id": "0", "params": ["a", "10"]}`, false, types.JSONRPCStringID("0")},
|
||||||
|
{`{"jsonrpc": "2.0", "method": "c", "id": "abc", "params": ["a", "10"]}`, false, types.JSONRPCStringID("abc")},
|
||||||
|
{`{"jsonrpc": "2.0", "method": "c", "id": 0, "params": ["a", "10"]}`, false, types.JSONRPCIntID(0)},
|
||||||
|
{`{"jsonrpc": "2.0", "method": "c", "id": 1, "params": ["a", "10"]}`, false, types.JSONRPCIntID(1)},
|
||||||
|
{`{"jsonrpc": "2.0", "method": "c", "id": 1.3, "params": ["a", "10"]}`, false, types.JSONRPCIntID(1)},
|
||||||
|
{`{"jsonrpc": "2.0", "method": "c", "id": -1, "params": ["a", "10"]}`, false, types.JSONRPCIntID(-1)},
|
||||||
|
{`{"jsonrpc": "2.0", "method": "c", "id": null, "params": ["a", "10"]}`, false, nil},
|
||||||
|
|
||||||
|
// bad id
|
||||||
|
{`{"jsonrpc": "2.0", "method": "c", "id": {}, "params": ["a", "10"]}`, true, nil},
|
||||||
|
{`{"jsonrpc": "2.0", "method": "c", "id": [], "params": ["a", "10"]}`, true, nil},
|
||||||
|
}
|
||||||
|
|
||||||
|
for i, tt := range tests {
|
||||||
|
req, _ := http.NewRequest("POST", "http://localhost/", strings.NewReader(tt.payload))
|
||||||
|
rec := httptest.NewRecorder()
|
||||||
|
mux.ServeHTTP(rec, req)
|
||||||
|
res := rec.Result()
|
||||||
|
// Always expecting back a JSONRPCResponse
|
||||||
|
assert.True(t, statusOK(res.StatusCode), "#%d: should always return 2XX", i)
|
||||||
|
blob, err := ioutil.ReadAll(res.Body)
|
||||||
|
if err != nil {
|
||||||
|
t.Errorf("#%d: err reading body: %v", i, err)
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
|
||||||
|
recv := new(types.RPCResponse)
|
||||||
|
err = json.Unmarshal(blob, recv)
|
||||||
|
assert.Nil(t, err, "#%d: expecting successful parsing of an RPCResponse:\nblob: %s", i, blob)
|
||||||
|
if !tt.wantErr {
|
||||||
|
assert.NotEqual(t, recv, new(types.RPCResponse), "#%d: not expecting a blank RPCResponse", i)
|
||||||
|
assert.Equal(t, tt.expectedId, recv.ID, "#%d: expected ID not matched in RPCResponse", i)
|
||||||
|
assert.Nil(t, recv.Error, "#%d: not expecting an error", i)
|
||||||
|
} else {
|
||||||
|
assert.True(t, recv.Error.Code < 0, "#%d: not expecting a positive JSONRPC code", i)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
func TestRPCNotification(t *testing.T) {
|
func TestRPCNotification(t *testing.T) {
|
||||||
mux := testMux()
|
mux := testMux()
|
||||||
body := strings.NewReader(`{"jsonrpc": "2.0"}`)
|
body := strings.NewReader(`{"jsonrpc": "2.0", "id": ""}`)
|
||||||
req, _ := http.NewRequest("POST", "http://localhost/", body)
|
req, _ := http.NewRequest("POST", "http://localhost/", body)
|
||||||
rec := httptest.NewRecorder()
|
rec := httptest.NewRecorder()
|
||||||
mux.ServeHTTP(rec, req)
|
mux.ServeHTTP(rec, req)
|
||||||
@@ -134,7 +182,7 @@ func TestWebsocketManagerHandler(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// check basic functionality works
|
// check basic functionality works
|
||||||
req, err := types.MapToRequest(amino.NewCodec(), "TestWebsocketManager", "c", map[string]interface{}{"s": "a", "i": 10})
|
req, err := types.MapToRequest(amino.NewCodec(), types.JSONRPCStringID("TestWebsocketManager"), "c", map[string]interface{}{"s": "a", "i": 10})
|
||||||
require.NoError(t, err)
|
require.NoError(t, err)
|
||||||
err = c.WriteJSON(req)
|
err = c.WriteJSON(req)
|
||||||
require.NoError(t, err)
|
require.NoError(t, err)
|
||||||
|
@@ -27,92 +27,56 @@ const (
|
|||||||
// maxBodyBytes controls the maximum number of bytes the
|
// maxBodyBytes controls the maximum number of bytes the
|
||||||
// server will read parsing the request body.
|
// server will read parsing the request body.
|
||||||
maxBodyBytes = int64(1000000) // 1MB
|
maxBodyBytes = int64(1000000) // 1MB
|
||||||
|
|
||||||
|
// same as the net/http default
|
||||||
|
maxHeaderBytes = 1 << 20
|
||||||
|
|
||||||
|
// Timeouts for reading/writing to the http connection.
|
||||||
|
// Public so handlers can read them -
|
||||||
|
// /broadcast_tx_commit has it's own timeout, which should
|
||||||
|
// be less than the WriteTimeout here.
|
||||||
|
// TODO: use a config instead.
|
||||||
|
ReadTimeout = 3 * time.Second
|
||||||
|
WriteTimeout = 20 * time.Second
|
||||||
)
|
)
|
||||||
|
|
||||||
// StartHTTPServer starts an HTTP server on listenAddr with the given handler.
|
// StartHTTPServer takes a listener and starts an HTTP server with the given handler.
|
||||||
// It wraps handler with RecoverAndLogHandler.
|
// It wraps handler with RecoverAndLogHandler.
|
||||||
func StartHTTPServer(
|
// NOTE: This function blocks - you may want to call it in a go-routine.
|
||||||
listenAddr string,
|
func StartHTTPServer(listener net.Listener, handler http.Handler, logger log.Logger) error {
|
||||||
handler http.Handler,
|
logger.Info(fmt.Sprintf("Starting RPC HTTP server on %s", listener.Addr()))
|
||||||
logger log.Logger,
|
s := &http.Server{
|
||||||
config Config,
|
Handler: RecoverAndLogHandler(maxBytesHandler{h: handler, n: maxBodyBytes}, logger),
|
||||||
) (listener net.Listener, err error) {
|
ReadTimeout: ReadTimeout,
|
||||||
var proto, addr string
|
WriteTimeout: WriteTimeout,
|
||||||
parts := strings.SplitN(listenAddr, "://", 2)
|
MaxHeaderBytes: maxHeaderBytes,
|
||||||
if len(parts) != 2 {
|
|
||||||
return nil, errors.Errorf(
|
|
||||||
"Invalid listening address %s (use fully formed addresses, including the tcp:// or unix:// prefix)",
|
|
||||||
listenAddr,
|
|
||||||
)
|
|
||||||
}
|
}
|
||||||
proto, addr = parts[0], parts[1]
|
err := s.Serve(listener)
|
||||||
|
|
||||||
logger.Info(fmt.Sprintf("Starting RPC HTTP server on %s", listenAddr))
|
|
||||||
listener, err = net.Listen(proto, addr)
|
|
||||||
if err != nil {
|
|
||||||
return nil, errors.Errorf("Failed to listen on %v: %v", listenAddr, err)
|
|
||||||
}
|
|
||||||
if config.MaxOpenConnections > 0 {
|
|
||||||
listener = netutil.LimitListener(listener, config.MaxOpenConnections)
|
|
||||||
}
|
|
||||||
|
|
||||||
go func() {
|
|
||||||
err := http.Serve(
|
|
||||||
listener,
|
|
||||||
RecoverAndLogHandler(maxBytesHandler{h: handler, n: maxBodyBytes}, logger),
|
|
||||||
)
|
|
||||||
logger.Info("RPC HTTP server stopped", "err", err)
|
logger.Info("RPC HTTP server stopped", "err", err)
|
||||||
}()
|
return err
|
||||||
return listener, nil
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// StartHTTPAndTLSServer starts an HTTPS server on listenAddr with the given
|
// StartHTTPAndTLSServer takes a listener and starts an HTTPS server with the given handler.
|
||||||
// handler.
|
|
||||||
// It wraps handler with RecoverAndLogHandler.
|
// It wraps handler with RecoverAndLogHandler.
|
||||||
|
// NOTE: This function blocks - you may want to call it in a go-routine.
|
||||||
func StartHTTPAndTLSServer(
|
func StartHTTPAndTLSServer(
|
||||||
listenAddr string,
|
listener net.Listener,
|
||||||
handler http.Handler,
|
handler http.Handler,
|
||||||
certFile, keyFile string,
|
certFile, keyFile string,
|
||||||
logger log.Logger,
|
logger log.Logger,
|
||||||
config Config,
|
) error {
|
||||||
) (listener net.Listener, err error) {
|
logger.Info(fmt.Sprintf("Starting RPC HTTPS server on %s (cert: %q, key: %q)",
|
||||||
var proto, addr string
|
listener.Addr(), certFile, keyFile))
|
||||||
parts := strings.SplitN(listenAddr, "://", 2)
|
s := &http.Server{
|
||||||
if len(parts) != 2 {
|
Handler: RecoverAndLogHandler(maxBytesHandler{h: handler, n: maxBodyBytes}, logger),
|
||||||
return nil, errors.Errorf(
|
ReadTimeout: ReadTimeout,
|
||||||
"Invalid listening address %s (use fully formed addresses, including the tcp:// or unix:// prefix)",
|
WriteTimeout: WriteTimeout,
|
||||||
listenAddr,
|
MaxHeaderBytes: maxHeaderBytes,
|
||||||
)
|
|
||||||
}
|
}
|
||||||
proto, addr = parts[0], parts[1]
|
err := s.ServeTLS(listener, certFile, keyFile)
|
||||||
|
|
||||||
logger.Info(
|
|
||||||
fmt.Sprintf(
|
|
||||||
"Starting RPC HTTPS server on %s (cert: %q, key: %q)",
|
|
||||||
listenAddr,
|
|
||||||
certFile,
|
|
||||||
keyFile,
|
|
||||||
),
|
|
||||||
)
|
|
||||||
listener, err = net.Listen(proto, addr)
|
|
||||||
if err != nil {
|
|
||||||
return nil, errors.Errorf("Failed to listen on %v: %v", listenAddr, err)
|
|
||||||
}
|
|
||||||
if config.MaxOpenConnections > 0 {
|
|
||||||
listener = netutil.LimitListener(listener, config.MaxOpenConnections)
|
|
||||||
}
|
|
||||||
|
|
||||||
err = http.ServeTLS(
|
|
||||||
listener,
|
|
||||||
RecoverAndLogHandler(maxBytesHandler{h: handler, n: maxBodyBytes}, logger),
|
|
||||||
certFile,
|
|
||||||
keyFile,
|
|
||||||
)
|
|
||||||
if err != nil {
|
|
||||||
logger.Error("RPC HTTPS server stopped", "err", err)
|
logger.Error("RPC HTTPS server stopped", "err", err)
|
||||||
return nil, err
|
return err
|
||||||
}
|
|
||||||
return listener, nil
|
|
||||||
}
|
}
|
||||||
|
|
||||||
func WriteRPCResponseHTTPError(
|
func WriteRPCResponseHTTPError(
|
||||||
@@ -168,7 +132,7 @@ func RecoverAndLogHandler(handler http.Handler, logger log.Logger) http.Handler
|
|||||||
"Panic in RPC HTTP handler", "err", e, "stack",
|
"Panic in RPC HTTP handler", "err", e, "stack",
|
||||||
string(debug.Stack()),
|
string(debug.Stack()),
|
||||||
)
|
)
|
||||||
WriteRPCResponseHTTPError(rww, http.StatusInternalServerError, types.RPCInternalError("", e.(error)))
|
WriteRPCResponseHTTPError(rww, http.StatusInternalServerError, types.RPCInternalError(types.JSONRPCStringID(""), e.(error)))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -213,3 +177,25 @@ func (h maxBytesHandler) ServeHTTP(w http.ResponseWriter, r *http.Request) {
|
|||||||
r.Body = http.MaxBytesReader(w, r.Body, h.n)
|
r.Body = http.MaxBytesReader(w, r.Body, h.n)
|
||||||
h.h.ServeHTTP(w, r)
|
h.h.ServeHTTP(w, r)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Listen starts a new net.Listener on the given address.
|
||||||
|
// It returns an error if the address is invalid or the call to Listen() fails.
|
||||||
|
func Listen(addr string, config Config) (listener net.Listener, err error) {
|
||||||
|
parts := strings.SplitN(addr, "://", 2)
|
||||||
|
if len(parts) != 2 {
|
||||||
|
return nil, errors.Errorf(
|
||||||
|
"Invalid listening address %s (use fully formed addresses, including the tcp:// or unix:// prefix)",
|
||||||
|
addr,
|
||||||
|
)
|
||||||
|
}
|
||||||
|
proto, addr := parts[0], parts[1]
|
||||||
|
listener, err = net.Listen(proto, addr)
|
||||||
|
if err != nil {
|
||||||
|
return nil, errors.Errorf("Failed to listen on %v: %v", addr, err)
|
||||||
|
}
|
||||||
|
if config.MaxOpenConnections > 0 {
|
||||||
|
listener = netutil.LimitListener(listener, config.MaxOpenConnections)
|
||||||
|
}
|
||||||
|
|
||||||
|
return listener, nil
|
||||||
|
}
|
||||||
|
@@ -30,11 +30,10 @@ func TestMaxOpenConnections(t *testing.T) {
|
|||||||
time.Sleep(10 * time.Millisecond)
|
time.Sleep(10 * time.Millisecond)
|
||||||
fmt.Fprint(w, "some body")
|
fmt.Fprint(w, "some body")
|
||||||
})
|
})
|
||||||
l, err := StartHTTPServer("tcp://127.0.0.1:0", mux, log.TestingLogger(), Config{MaxOpenConnections: max})
|
l, err := Listen("tcp://127.0.0.1:0", Config{MaxOpenConnections: max})
|
||||||
if err != nil {
|
require.NoError(t, err)
|
||||||
t.Fatal(err)
|
|
||||||
}
|
|
||||||
defer l.Close()
|
defer l.Close()
|
||||||
|
go StartHTTPServer(l, mux, log.TestingLogger())
|
||||||
|
|
||||||
// Make N GET calls to the server.
|
// Make N GET calls to the server.
|
||||||
attempts := max * 2
|
attempts := max * 2
|
||||||
@@ -67,11 +66,14 @@ func TestMaxOpenConnections(t *testing.T) {
|
|||||||
func TestStartHTTPAndTLSServer(t *testing.T) {
|
func TestStartHTTPAndTLSServer(t *testing.T) {
|
||||||
// set up fixtures
|
// set up fixtures
|
||||||
listenerAddr := "tcp://0.0.0.0:0"
|
listenerAddr := "tcp://0.0.0.0:0"
|
||||||
|
listener, err := Listen(listenerAddr, Config{MaxOpenConnections: 1})
|
||||||
|
require.NoError(t, err)
|
||||||
mux := http.NewServeMux()
|
mux := http.NewServeMux()
|
||||||
mux.HandleFunc("/", func(w http.ResponseWriter, r *http.Request) {})
|
mux.HandleFunc("/", func(w http.ResponseWriter, r *http.Request) {})
|
||||||
|
|
||||||
// test failure
|
// test failure
|
||||||
gotListener, err := StartHTTPAndTLSServer(listenerAddr, mux, "", "", log.TestingLogger(), Config{MaxOpenConnections: 1})
|
err = StartHTTPAndTLSServer(listener, mux, "", "", log.TestingLogger())
|
||||||
require.Nil(t, gotListener)
|
|
||||||
require.IsType(t, (*os.PathError)(nil), err)
|
require.IsType(t, (*os.PathError)(nil), err)
|
||||||
|
|
||||||
|
// TODO: test that starting the server can actually work
|
||||||
}
|
}
|
||||||
|
@@ -28,11 +28,11 @@ func main() {
|
|||||||
cdc := amino.NewCodec()
|
cdc := amino.NewCodec()
|
||||||
logger := log.NewTMLogger(log.NewSyncWriter(os.Stdout))
|
logger := log.NewTMLogger(log.NewSyncWriter(os.Stdout))
|
||||||
rpcserver.RegisterRPCFuncs(mux, routes, cdc, logger)
|
rpcserver.RegisterRPCFuncs(mux, routes, cdc, logger)
|
||||||
_, err := rpcserver.StartHTTPServer("0.0.0.0:8008", mux, logger, rpcserver.Config{})
|
listener, err := rpcserver.Listen("0.0.0.0:8008", rpcserver.Config{})
|
||||||
if err != nil {
|
if err != nil {
|
||||||
cmn.Exit(err.Error())
|
cmn.Exit(err.Error())
|
||||||
}
|
}
|
||||||
|
go rpcserver.StartHTTPServer(listener, mux, logger)
|
||||||
// Wait forever
|
// Wait forever
|
||||||
cmn.TrapSignal(func() {
|
cmn.TrapSignal(func() {
|
||||||
})
|
})
|
||||||
|
@@ -4,6 +4,7 @@ import (
|
|||||||
"context"
|
"context"
|
||||||
"encoding/json"
|
"encoding/json"
|
||||||
"fmt"
|
"fmt"
|
||||||
|
"reflect"
|
||||||
"strings"
|
"strings"
|
||||||
|
|
||||||
"github.com/pkg/errors"
|
"github.com/pkg/errors"
|
||||||
@@ -13,17 +14,75 @@ import (
|
|||||||
tmpubsub "github.com/tendermint/tendermint/libs/pubsub"
|
tmpubsub "github.com/tendermint/tendermint/libs/pubsub"
|
||||||
)
|
)
|
||||||
|
|
||||||
|
// a wrapper to emulate a sum type: jsonrpcid = string | int
|
||||||
|
// TODO: refactor when Go 2.0 arrives https://github.com/golang/go/issues/19412
|
||||||
|
type jsonrpcid interface {
|
||||||
|
isJSONRPCID()
|
||||||
|
}
|
||||||
|
|
||||||
|
// JSONRPCStringID a wrapper for JSON-RPC string IDs
|
||||||
|
type JSONRPCStringID string
|
||||||
|
|
||||||
|
func (JSONRPCStringID) isJSONRPCID() {}
|
||||||
|
|
||||||
|
// JSONRPCIntID a wrapper for JSON-RPC integer IDs
|
||||||
|
type JSONRPCIntID int
|
||||||
|
|
||||||
|
func (JSONRPCIntID) isJSONRPCID() {}
|
||||||
|
|
||||||
|
func idFromInterface(idInterface interface{}) (jsonrpcid, error) {
|
||||||
|
switch id := idInterface.(type) {
|
||||||
|
case string:
|
||||||
|
return JSONRPCStringID(id), nil
|
||||||
|
case float64:
|
||||||
|
// json.Unmarshal uses float64 for all numbers
|
||||||
|
// (https://golang.org/pkg/encoding/json/#Unmarshal),
|
||||||
|
// but the JSONRPC2.0 spec says the id SHOULD NOT contain
|
||||||
|
// decimals - so we truncate the decimals here.
|
||||||
|
return JSONRPCIntID(int(id)), nil
|
||||||
|
default:
|
||||||
|
typ := reflect.TypeOf(id)
|
||||||
|
return nil, fmt.Errorf("JSON-RPC ID (%v) is of unknown type (%v)", id, typ)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
//----------------------------------------
|
//----------------------------------------
|
||||||
// REQUEST
|
// REQUEST
|
||||||
|
|
||||||
type RPCRequest struct {
|
type RPCRequest struct {
|
||||||
JSONRPC string `json:"jsonrpc"`
|
JSONRPC string `json:"jsonrpc"`
|
||||||
ID string `json:"id"`
|
ID jsonrpcid `json:"id"`
|
||||||
Method string `json:"method"`
|
Method string `json:"method"`
|
||||||
Params json.RawMessage `json:"params"` // must be map[string]interface{} or []interface{}
|
Params json.RawMessage `json:"params"` // must be map[string]interface{} or []interface{}
|
||||||
}
|
}
|
||||||
|
|
||||||
func NewRPCRequest(id string, method string, params json.RawMessage) RPCRequest {
|
// UnmarshalJSON custom JSON unmarshalling due to jsonrpcid being string or int
|
||||||
|
func (request *RPCRequest) UnmarshalJSON(data []byte) error {
|
||||||
|
unsafeReq := &struct {
|
||||||
|
JSONRPC string `json:"jsonrpc"`
|
||||||
|
ID interface{} `json:"id"`
|
||||||
|
Method string `json:"method"`
|
||||||
|
Params json.RawMessage `json:"params"` // must be map[string]interface{} or []interface{}
|
||||||
|
}{}
|
||||||
|
err := json.Unmarshal(data, &unsafeReq)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
request.JSONRPC = unsafeReq.JSONRPC
|
||||||
|
request.Method = unsafeReq.Method
|
||||||
|
request.Params = unsafeReq.Params
|
||||||
|
if unsafeReq.ID == nil {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
id, err := idFromInterface(unsafeReq.ID)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
request.ID = id
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func NewRPCRequest(id jsonrpcid, method string, params json.RawMessage) RPCRequest {
|
||||||
return RPCRequest{
|
return RPCRequest{
|
||||||
JSONRPC: "2.0",
|
JSONRPC: "2.0",
|
||||||
ID: id,
|
ID: id,
|
||||||
@@ -36,7 +95,7 @@ func (req RPCRequest) String() string {
|
|||||||
return fmt.Sprintf("[%s %s]", req.ID, req.Method)
|
return fmt.Sprintf("[%s %s]", req.ID, req.Method)
|
||||||
}
|
}
|
||||||
|
|
||||||
func MapToRequest(cdc *amino.Codec, id string, method string, params map[string]interface{}) (RPCRequest, error) {
|
func MapToRequest(cdc *amino.Codec, id jsonrpcid, method string, params map[string]interface{}) (RPCRequest, error) {
|
||||||
var params_ = make(map[string]json.RawMessage, len(params))
|
var params_ = make(map[string]json.RawMessage, len(params))
|
||||||
for name, value := range params {
|
for name, value := range params {
|
||||||
valueJSON, err := cdc.MarshalJSON(value)
|
valueJSON, err := cdc.MarshalJSON(value)
|
||||||
@@ -53,7 +112,7 @@ func MapToRequest(cdc *amino.Codec, id string, method string, params map[string]
|
|||||||
return request, nil
|
return request, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func ArrayToRequest(cdc *amino.Codec, id string, method string, params []interface{}) (RPCRequest, error) {
|
func ArrayToRequest(cdc *amino.Codec, id jsonrpcid, method string, params []interface{}) (RPCRequest, error) {
|
||||||
var params_ = make([]json.RawMessage, len(params))
|
var params_ = make([]json.RawMessage, len(params))
|
||||||
for i, value := range params {
|
for i, value := range params {
|
||||||
valueJSON, err := cdc.MarshalJSON(value)
|
valueJSON, err := cdc.MarshalJSON(value)
|
||||||
@@ -89,12 +148,38 @@ func (err RPCError) Error() string {
|
|||||||
|
|
||||||
type RPCResponse struct {
|
type RPCResponse struct {
|
||||||
JSONRPC string `json:"jsonrpc"`
|
JSONRPC string `json:"jsonrpc"`
|
||||||
ID string `json:"id"`
|
ID jsonrpcid `json:"id"`
|
||||||
Result json.RawMessage `json:"result,omitempty"`
|
Result json.RawMessage `json:"result,omitempty"`
|
||||||
Error *RPCError `json:"error,omitempty"`
|
Error *RPCError `json:"error,omitempty"`
|
||||||
}
|
}
|
||||||
|
|
||||||
func NewRPCSuccessResponse(cdc *amino.Codec, id string, res interface{}) RPCResponse {
|
// UnmarshalJSON custom JSON unmarshalling due to jsonrpcid being string or int
|
||||||
|
func (response *RPCResponse) UnmarshalJSON(data []byte) error {
|
||||||
|
unsafeResp := &struct {
|
||||||
|
JSONRPC string `json:"jsonrpc"`
|
||||||
|
ID interface{} `json:"id"`
|
||||||
|
Result json.RawMessage `json:"result,omitempty"`
|
||||||
|
Error *RPCError `json:"error,omitempty"`
|
||||||
|
}{}
|
||||||
|
err := json.Unmarshal(data, &unsafeResp)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
response.JSONRPC = unsafeResp.JSONRPC
|
||||||
|
response.Error = unsafeResp.Error
|
||||||
|
response.Result = unsafeResp.Result
|
||||||
|
if unsafeResp.ID == nil {
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
id, err := idFromInterface(unsafeResp.ID)
|
||||||
|
if err != nil {
|
||||||
|
return err
|
||||||
|
}
|
||||||
|
response.ID = id
|
||||||
|
return nil
|
||||||
|
}
|
||||||
|
|
||||||
|
func NewRPCSuccessResponse(cdc *amino.Codec, id jsonrpcid, res interface{}) RPCResponse {
|
||||||
var rawMsg json.RawMessage
|
var rawMsg json.RawMessage
|
||||||
|
|
||||||
if res != nil {
|
if res != nil {
|
||||||
@@ -109,7 +194,7 @@ func NewRPCSuccessResponse(cdc *amino.Codec, id string, res interface{}) RPCResp
|
|||||||
return RPCResponse{JSONRPC: "2.0", ID: id, Result: rawMsg}
|
return RPCResponse{JSONRPC: "2.0", ID: id, Result: rawMsg}
|
||||||
}
|
}
|
||||||
|
|
||||||
func NewRPCErrorResponse(id string, code int, msg string, data string) RPCResponse {
|
func NewRPCErrorResponse(id jsonrpcid, code int, msg string, data string) RPCResponse {
|
||||||
return RPCResponse{
|
return RPCResponse{
|
||||||
JSONRPC: "2.0",
|
JSONRPC: "2.0",
|
||||||
ID: id,
|
ID: id,
|
||||||
@@ -124,27 +209,27 @@ func (resp RPCResponse) String() string {
|
|||||||
return fmt.Sprintf("[%s %s]", resp.ID, resp.Error)
|
return fmt.Sprintf("[%s %s]", resp.ID, resp.Error)
|
||||||
}
|
}
|
||||||
|
|
||||||
func RPCParseError(id string, err error) RPCResponse {
|
func RPCParseError(id jsonrpcid, err error) RPCResponse {
|
||||||
return NewRPCErrorResponse(id, -32700, "Parse error. Invalid JSON", err.Error())
|
return NewRPCErrorResponse(id, -32700, "Parse error. Invalid JSON", err.Error())
|
||||||
}
|
}
|
||||||
|
|
||||||
func RPCInvalidRequestError(id string, err error) RPCResponse {
|
func RPCInvalidRequestError(id jsonrpcid, err error) RPCResponse {
|
||||||
return NewRPCErrorResponse(id, -32600, "Invalid Request", err.Error())
|
return NewRPCErrorResponse(id, -32600, "Invalid Request", err.Error())
|
||||||
}
|
}
|
||||||
|
|
||||||
func RPCMethodNotFoundError(id string) RPCResponse {
|
func RPCMethodNotFoundError(id jsonrpcid) RPCResponse {
|
||||||
return NewRPCErrorResponse(id, -32601, "Method not found", "")
|
return NewRPCErrorResponse(id, -32601, "Method not found", "")
|
||||||
}
|
}
|
||||||
|
|
||||||
func RPCInvalidParamsError(id string, err error) RPCResponse {
|
func RPCInvalidParamsError(id jsonrpcid, err error) RPCResponse {
|
||||||
return NewRPCErrorResponse(id, -32602, "Invalid params", err.Error())
|
return NewRPCErrorResponse(id, -32602, "Invalid params", err.Error())
|
||||||
}
|
}
|
||||||
|
|
||||||
func RPCInternalError(id string, err error) RPCResponse {
|
func RPCInternalError(id jsonrpcid, err error) RPCResponse {
|
||||||
return NewRPCErrorResponse(id, -32603, "Internal error", err.Error())
|
return NewRPCErrorResponse(id, -32603, "Internal error", err.Error())
|
||||||
}
|
}
|
||||||
|
|
||||||
func RPCServerError(id string, err error) RPCResponse {
|
func RPCServerError(id jsonrpcid, err error) RPCResponse {
|
||||||
return NewRPCErrorResponse(id, -32000, "Server error", err.Error())
|
return NewRPCErrorResponse(id, -32000, "Server error", err.Error())
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -15,25 +15,58 @@ type SampleResult struct {
|
|||||||
Value string
|
Value string
|
||||||
}
|
}
|
||||||
|
|
||||||
|
type responseTest struct {
|
||||||
|
id jsonrpcid
|
||||||
|
expected string
|
||||||
|
}
|
||||||
|
|
||||||
|
var responseTests = []responseTest{
|
||||||
|
{JSONRPCStringID("1"), `"1"`},
|
||||||
|
{JSONRPCStringID("alphabet"), `"alphabet"`},
|
||||||
|
{JSONRPCStringID(""), `""`},
|
||||||
|
{JSONRPCStringID("àáâ"), `"àáâ"`},
|
||||||
|
{JSONRPCIntID(-1), "-1"},
|
||||||
|
{JSONRPCIntID(0), "0"},
|
||||||
|
{JSONRPCIntID(1), "1"},
|
||||||
|
{JSONRPCIntID(100), "100"},
|
||||||
|
}
|
||||||
|
|
||||||
func TestResponses(t *testing.T) {
|
func TestResponses(t *testing.T) {
|
||||||
assert := assert.New(t)
|
assert := assert.New(t)
|
||||||
cdc := amino.NewCodec()
|
cdc := amino.NewCodec()
|
||||||
|
for _, tt := range responseTests {
|
||||||
a := NewRPCSuccessResponse(cdc, "1", &SampleResult{"hello"})
|
jsonid := tt.id
|
||||||
|
a := NewRPCSuccessResponse(cdc, jsonid, &SampleResult{"hello"})
|
||||||
b, _ := json.Marshal(a)
|
b, _ := json.Marshal(a)
|
||||||
s := `{"jsonrpc":"2.0","id":"1","result":{"Value":"hello"}}`
|
s := fmt.Sprintf(`{"jsonrpc":"2.0","id":%v,"result":{"Value":"hello"}}`, tt.expected)
|
||||||
assert.Equal(string(s), string(b))
|
assert.Equal(string(s), string(b))
|
||||||
|
|
||||||
d := RPCParseError("1", errors.New("Hello world"))
|
d := RPCParseError(jsonid, errors.New("Hello world"))
|
||||||
e, _ := json.Marshal(d)
|
e, _ := json.Marshal(d)
|
||||||
f := `{"jsonrpc":"2.0","id":"1","error":{"code":-32700,"message":"Parse error. Invalid JSON","data":"Hello world"}}`
|
f := fmt.Sprintf(`{"jsonrpc":"2.0","id":%v,"error":{"code":-32700,"message":"Parse error. Invalid JSON","data":"Hello world"}}`, tt.expected)
|
||||||
assert.Equal(string(f), string(e))
|
assert.Equal(string(f), string(e))
|
||||||
|
|
||||||
g := RPCMethodNotFoundError("2")
|
g := RPCMethodNotFoundError(jsonid)
|
||||||
h, _ := json.Marshal(g)
|
h, _ := json.Marshal(g)
|
||||||
i := `{"jsonrpc":"2.0","id":"2","error":{"code":-32601,"message":"Method not found"}}`
|
i := fmt.Sprintf(`{"jsonrpc":"2.0","id":%v,"error":{"code":-32601,"message":"Method not found"}}`, tt.expected)
|
||||||
assert.Equal(string(h), string(i))
|
assert.Equal(string(h), string(i))
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestUnmarshallResponses(t *testing.T) {
|
||||||
|
assert := assert.New(t)
|
||||||
|
cdc := amino.NewCodec()
|
||||||
|
for _, tt := range responseTests {
|
||||||
|
response := &RPCResponse{}
|
||||||
|
err := json.Unmarshal([]byte(fmt.Sprintf(`{"jsonrpc":"2.0","id":%v,"result":{"Value":"hello"}}`, tt.expected)), response)
|
||||||
|
assert.Nil(err)
|
||||||
|
a := NewRPCSuccessResponse(cdc, tt.id, &SampleResult{"hello"})
|
||||||
|
assert.Equal(*response, a)
|
||||||
|
}
|
||||||
|
response := &RPCResponse{}
|
||||||
|
err := json.Unmarshal([]byte(`{"jsonrpc":"2.0","id":true,"result":{"Value":"hello"}}`), response)
|
||||||
|
assert.NotNil(err)
|
||||||
|
}
|
||||||
|
|
||||||
func TestRPCError(t *testing.T) {
|
func TestRPCError(t *testing.T) {
|
||||||
assert.Equal(t, "RPC error 12 - Badness: One worse than a code 11",
|
assert.Equal(t, "RPC error 12 - Badness: One worse than a code 11",
|
||||||
|
@@ -2,6 +2,7 @@ package state
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"fmt"
|
"fmt"
|
||||||
|
"strings"
|
||||||
"time"
|
"time"
|
||||||
|
|
||||||
abci "github.com/tendermint/tendermint/abci/types"
|
abci "github.com/tendermint/tendermint/abci/types"
|
||||||
@@ -107,7 +108,7 @@ func (blockExec *BlockExecutor) ApplyBlock(state State, blockID types.BlockID, b
|
|||||||
fail.Fail() // XXX
|
fail.Fail() // XXX
|
||||||
|
|
||||||
// Update the state with the block and responses.
|
// Update the state with the block and responses.
|
||||||
state, err = updateState(state, blockID, &block.Header, abciResponses)
|
state, err = updateState(blockExec.logger, state, blockID, &block.Header, abciResponses)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return state, fmt.Errorf("Commit failed for application: %v", err)
|
return state, fmt.Errorf("Commit failed for application: %v", err)
|
||||||
}
|
}
|
||||||
@@ -225,8 +226,9 @@ func execBlockOnProxyApp(
|
|||||||
|
|
||||||
commitInfo, byzVals := getBeginBlockValidatorInfo(block, lastValSet, stateDB)
|
commitInfo, byzVals := getBeginBlockValidatorInfo(block, lastValSet, stateDB)
|
||||||
|
|
||||||
// Begin block.
|
// Begin block
|
||||||
_, err := proxyAppConn.BeginBlockSync(abci.RequestBeginBlock{
|
var err error
|
||||||
|
abciResponses.BeginBlock, err = proxyAppConn.BeginBlockSync(abci.RequestBeginBlock{
|
||||||
Hash: block.Hash(),
|
Hash: block.Hash(),
|
||||||
Header: types.TM2PB.Header(&block.Header),
|
Header: types.TM2PB.Header(&block.Header),
|
||||||
LastCommitInfo: commitInfo,
|
LastCommitInfo: commitInfo,
|
||||||
@@ -254,12 +256,6 @@ func execBlockOnProxyApp(
|
|||||||
|
|
||||||
logger.Info("Executed block", "height", block.Height, "validTxs", validTxs, "invalidTxs", invalidTxs)
|
logger.Info("Executed block", "height", block.Height, "validTxs", validTxs, "invalidTxs", invalidTxs)
|
||||||
|
|
||||||
valUpdates := abciResponses.EndBlock.ValidatorUpdates
|
|
||||||
if len(valUpdates) > 0 {
|
|
||||||
// TODO: cleanup the formatting
|
|
||||||
logger.Info("Updates to validators", "updates", valUpdates)
|
|
||||||
}
|
|
||||||
|
|
||||||
return abciResponses, nil
|
return abciResponses, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -315,16 +311,16 @@ func getBeginBlockValidatorInfo(block *types.Block, lastValSet *types.ValidatorS
|
|||||||
// If more or equal than 1/3 of total voting power changed in one block, then
|
// If more or equal than 1/3 of total voting power changed in one block, then
|
||||||
// a light client could never prove the transition externally. See
|
// a light client could never prove the transition externally. See
|
||||||
// ./lite/doc.go for details on how a light client tracks validators.
|
// ./lite/doc.go for details on how a light client tracks validators.
|
||||||
func updateValidators(currentSet *types.ValidatorSet, abciUpdates []abci.ValidatorUpdate) error {
|
func updateValidators(currentSet *types.ValidatorSet, abciUpdates []abci.ValidatorUpdate) ([]*types.Validator, error) {
|
||||||
updates, err := types.PB2TM.ValidatorUpdates(abciUpdates)
|
updates, err := types.PB2TM.ValidatorUpdates(abciUpdates)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return err
|
return nil, err
|
||||||
}
|
}
|
||||||
|
|
||||||
// these are tendermint types now
|
// these are tendermint types now
|
||||||
for _, valUpdate := range updates {
|
for _, valUpdate := range updates {
|
||||||
if valUpdate.VotingPower < 0 {
|
if valUpdate.VotingPower < 0 {
|
||||||
return fmt.Errorf("Voting power can't be negative %v", valUpdate)
|
return nil, fmt.Errorf("Voting power can't be negative %v", valUpdate)
|
||||||
}
|
}
|
||||||
|
|
||||||
address := valUpdate.Address
|
address := valUpdate.Address
|
||||||
@@ -333,27 +329,28 @@ func updateValidators(currentSet *types.ValidatorSet, abciUpdates []abci.Validat
|
|||||||
// remove val
|
// remove val
|
||||||
_, removed := currentSet.Remove(address)
|
_, removed := currentSet.Remove(address)
|
||||||
if !removed {
|
if !removed {
|
||||||
return fmt.Errorf("Failed to remove validator %X", address)
|
return nil, fmt.Errorf("Failed to remove validator %X", address)
|
||||||
}
|
}
|
||||||
} else if val == nil {
|
} else if val == nil {
|
||||||
// add val
|
// add val
|
||||||
added := currentSet.Add(valUpdate)
|
added := currentSet.Add(valUpdate)
|
||||||
if !added {
|
if !added {
|
||||||
return fmt.Errorf("Failed to add new validator %v", valUpdate)
|
return nil, fmt.Errorf("Failed to add new validator %v", valUpdate)
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
// update val
|
// update val
|
||||||
updated := currentSet.Update(valUpdate)
|
updated := currentSet.Update(valUpdate)
|
||||||
if !updated {
|
if !updated {
|
||||||
return fmt.Errorf("Failed to update validator %X to %v", address, valUpdate)
|
return nil, fmt.Errorf("Failed to update validator %X to %v", address, valUpdate)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return nil
|
return updates, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
// updateState returns a new State updated according to the header and responses.
|
// updateState returns a new State updated according to the header and responses.
|
||||||
func updateState(
|
func updateState(
|
||||||
|
logger log.Logger,
|
||||||
state State,
|
state State,
|
||||||
blockID types.BlockID,
|
blockID types.BlockID,
|
||||||
header *types.Header,
|
header *types.Header,
|
||||||
@@ -367,12 +364,14 @@ func updateState(
|
|||||||
// Update the validator set with the latest abciResponses.
|
// Update the validator set with the latest abciResponses.
|
||||||
lastHeightValsChanged := state.LastHeightValidatorsChanged
|
lastHeightValsChanged := state.LastHeightValidatorsChanged
|
||||||
if len(abciResponses.EndBlock.ValidatorUpdates) > 0 {
|
if len(abciResponses.EndBlock.ValidatorUpdates) > 0 {
|
||||||
err := updateValidators(nValSet, abciResponses.EndBlock.ValidatorUpdates)
|
validatorUpdates, err := updateValidators(nValSet, abciResponses.EndBlock.ValidatorUpdates)
|
||||||
if err != nil {
|
if err != nil {
|
||||||
return state, fmt.Errorf("Error changing validator set: %v", err)
|
return state, fmt.Errorf("Error changing validator set: %v", err)
|
||||||
}
|
}
|
||||||
// Change results from this height but only applies to the next next height.
|
// Change results from this height but only applies to the next next height.
|
||||||
lastHeightValsChanged = header.Height + 1 + 1
|
lastHeightValsChanged = header.Height + 1 + 1
|
||||||
|
|
||||||
|
logger.Info("Updates to validators", "updates", makeValidatorUpdatesLogString(validatorUpdates))
|
||||||
}
|
}
|
||||||
|
|
||||||
// Update validator accums and set state variables.
|
// Update validator accums and set state variables.
|
||||||
@@ -419,8 +418,16 @@ func updateState(
|
|||||||
// Fire TxEvent for every tx.
|
// Fire TxEvent for every tx.
|
||||||
// NOTE: if Tendermint crashes before commit, some or all of these events may be published again.
|
// NOTE: if Tendermint crashes before commit, some or all of these events may be published again.
|
||||||
func fireEvents(logger log.Logger, eventBus types.BlockEventPublisher, block *types.Block, abciResponses *ABCIResponses) {
|
func fireEvents(logger log.Logger, eventBus types.BlockEventPublisher, block *types.Block, abciResponses *ABCIResponses) {
|
||||||
eventBus.PublishEventNewBlock(types.EventDataNewBlock{block})
|
eventBus.PublishEventNewBlock(types.EventDataNewBlock{
|
||||||
eventBus.PublishEventNewBlockHeader(types.EventDataNewBlockHeader{block.Header})
|
Block: block,
|
||||||
|
ResultBeginBlock: *abciResponses.BeginBlock,
|
||||||
|
ResultEndBlock: *abciResponses.EndBlock,
|
||||||
|
})
|
||||||
|
eventBus.PublishEventNewBlockHeader(types.EventDataNewBlockHeader{
|
||||||
|
Header: block.Header,
|
||||||
|
ResultBeginBlock: *abciResponses.BeginBlock,
|
||||||
|
ResultEndBlock: *abciResponses.EndBlock,
|
||||||
|
})
|
||||||
|
|
||||||
for i, tx := range block.Data.Txs {
|
for i, tx := range block.Data.Txs {
|
||||||
eventBus.PublishEventTx(types.EventDataTx{types.TxResult{
|
eventBus.PublishEventTx(types.EventDataTx{types.TxResult{
|
||||||
@@ -466,3 +473,13 @@ func ExecCommitBlock(
|
|||||||
// ResponseCommit has no error or log, just data
|
// ResponseCommit has no error or log, just data
|
||||||
return res.Data, nil
|
return res.Data, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Make pretty string for validatorUpdates logging
|
||||||
|
func makeValidatorUpdatesLogString(vals []*types.Validator) string {
|
||||||
|
chunks := make([]string, len(vals))
|
||||||
|
for i, val := range vals {
|
||||||
|
chunks[i] = fmt.Sprintf("%s:%d", val.Address, val.VotingPower)
|
||||||
|
}
|
||||||
|
|
||||||
|
return strings.Join(chunks, ",")
|
||||||
|
}
|
||||||
|
@@ -218,7 +218,7 @@ func TestUpdateValidators(t *testing.T) {
|
|||||||
|
|
||||||
for _, tc := range testCases {
|
for _, tc := range testCases {
|
||||||
t.Run(tc.name, func(t *testing.T) {
|
t.Run(tc.name, func(t *testing.T) {
|
||||||
err := updateValidators(tc.currentSet, tc.abciUpdates)
|
_, err := updateValidators(tc.currentSet, tc.abciUpdates)
|
||||||
if tc.shouldErr {
|
if tc.shouldErr {
|
||||||
assert.Error(t, err)
|
assert.Error(t, err)
|
||||||
} else {
|
} else {
|
||||||
|
@@ -64,7 +64,8 @@ type State struct {
|
|||||||
// Validators are persisted to the database separately every time they change,
|
// Validators are persisted to the database separately every time they change,
|
||||||
// so we can query for historical validator sets.
|
// so we can query for historical validator sets.
|
||||||
// Note that if s.LastBlockHeight causes a valset change,
|
// Note that if s.LastBlockHeight causes a valset change,
|
||||||
// we set s.LastHeightValidatorsChanged = s.LastBlockHeight + 1
|
// we set s.LastHeightValidatorsChanged = s.LastBlockHeight + 1 + 1
|
||||||
|
// Extra +1 due to nextValSet delay.
|
||||||
NextValidators *types.ValidatorSet
|
NextValidators *types.ValidatorSet
|
||||||
Validators *types.ValidatorSet
|
Validators *types.ValidatorSet
|
||||||
LastValidators *types.ValidatorSet
|
LastValidators *types.ValidatorSet
|
||||||
|
@@ -5,6 +5,8 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
"testing"
|
"testing"
|
||||||
|
|
||||||
|
"github.com/tendermint/tendermint/libs/log"
|
||||||
|
|
||||||
"github.com/stretchr/testify/assert"
|
"github.com/stretchr/testify/assert"
|
||||||
"github.com/stretchr/testify/require"
|
"github.com/stretchr/testify/require"
|
||||||
abci "github.com/tendermint/tendermint/abci/types"
|
abci "github.com/tendermint/tendermint/abci/types"
|
||||||
@@ -228,7 +230,7 @@ func TestOneValidatorChangesSaveLoad(t *testing.T) {
|
|||||||
power++
|
power++
|
||||||
}
|
}
|
||||||
header, blockID, responses := makeHeaderPartsResponsesValPowerChange(state, i, power)
|
header, blockID, responses := makeHeaderPartsResponsesValPowerChange(state, i, power)
|
||||||
state, err = updateState(state, blockID, &header, responses)
|
state, err = updateState(log.TestingLogger(), state, blockID, &header, responses)
|
||||||
assert.Nil(t, err)
|
assert.Nil(t, err)
|
||||||
nextHeight := state.LastBlockHeight + 1
|
nextHeight := state.LastBlockHeight + 1
|
||||||
saveValidatorsInfo(stateDB, nextHeight+1, state.LastHeightValidatorsChanged, state.NextValidators)
|
saveValidatorsInfo(stateDB, nextHeight+1, state.LastHeightValidatorsChanged, state.NextValidators)
|
||||||
@@ -259,6 +261,27 @@ func TestOneValidatorChangesSaveLoad(t *testing.T) {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func TestStoreLoadValidatorsIncrementsAccum(t *testing.T) {
|
||||||
|
const valSetSize = 2
|
||||||
|
tearDown, stateDB, state := setupTestCase(t)
|
||||||
|
state.Validators = genValSet(valSetSize)
|
||||||
|
state.NextValidators = state.Validators.CopyIncrementAccum(1)
|
||||||
|
SaveState(stateDB, state)
|
||||||
|
defer tearDown(t)
|
||||||
|
|
||||||
|
nextHeight := state.LastBlockHeight + 1
|
||||||
|
|
||||||
|
v0, err := LoadValidators(stateDB, nextHeight)
|
||||||
|
assert.Nil(t, err)
|
||||||
|
acc0 := v0.Validators[0].Accum
|
||||||
|
|
||||||
|
v1, err := LoadValidators(stateDB, nextHeight+1)
|
||||||
|
assert.Nil(t, err)
|
||||||
|
acc1 := v1.Validators[0].Accum
|
||||||
|
|
||||||
|
assert.NotEqual(t, acc1, acc0, "expected Accum value to change between heights")
|
||||||
|
}
|
||||||
|
|
||||||
// TestValidatorChangesSaveLoad tests saving and loading a validator set with
|
// TestValidatorChangesSaveLoad tests saving and loading a validator set with
|
||||||
// changes.
|
// changes.
|
||||||
func TestManyValidatorChangesSaveLoad(t *testing.T) {
|
func TestManyValidatorChangesSaveLoad(t *testing.T) {
|
||||||
@@ -280,7 +303,7 @@ func TestManyValidatorChangesSaveLoad(t *testing.T) {
|
|||||||
|
|
||||||
// Save state etc.
|
// Save state etc.
|
||||||
var err error
|
var err error
|
||||||
state, err = updateState(state, blockID, &header, responses)
|
state, err = updateState(log.TestingLogger(), state, blockID, &header, responses)
|
||||||
require.Nil(t, err)
|
require.Nil(t, err)
|
||||||
nextHeight := state.LastBlockHeight + 1
|
nextHeight := state.LastBlockHeight + 1
|
||||||
saveValidatorsInfo(stateDB, nextHeight+1, state.LastHeightValidatorsChanged, state.NextValidators)
|
saveValidatorsInfo(stateDB, nextHeight+1, state.LastHeightValidatorsChanged, state.NextValidators)
|
||||||
@@ -359,7 +382,7 @@ func TestConsensusParamsChangesSaveLoad(t *testing.T) {
|
|||||||
cp = params[changeIndex]
|
cp = params[changeIndex]
|
||||||
}
|
}
|
||||||
header, blockID, responses := makeHeaderPartsResponsesParams(state, i, cp)
|
header, blockID, responses := makeHeaderPartsResponsesParams(state, i, cp)
|
||||||
state, err = updateState(state, blockID, &header, responses)
|
state, err = updateState(log.TestingLogger(), state, blockID, &header, responses)
|
||||||
|
|
||||||
require.Nil(t, err)
|
require.Nil(t, err)
|
||||||
nextHeight := state.LastBlockHeight + 1
|
nextHeight := state.LastBlockHeight + 1
|
||||||
|
@@ -89,7 +89,9 @@ func saveState(db dbm.DB, state State, key []byte) {
|
|||||||
nextHeight := state.LastBlockHeight + 1
|
nextHeight := state.LastBlockHeight + 1
|
||||||
// If first block, save validators for block 1.
|
// If first block, save validators for block 1.
|
||||||
if nextHeight == 1 {
|
if nextHeight == 1 {
|
||||||
lastHeightVoteChanged := int64(1) // Due to Tendermint validator set changes being delayed 1 block.
|
// This extra logic due to Tendermint validator set changes being delayed 1 block.
|
||||||
|
// It may get overwritten due to InitChain validator updates.
|
||||||
|
lastHeightVoteChanged := int64(1)
|
||||||
saveValidatorsInfo(db, nextHeight, lastHeightVoteChanged, state.Validators)
|
saveValidatorsInfo(db, nextHeight, lastHeightVoteChanged, state.Validators)
|
||||||
}
|
}
|
||||||
// Save next validators.
|
// Save next validators.
|
||||||
@@ -107,6 +109,7 @@ func saveState(db dbm.DB, state State, key []byte) {
|
|||||||
type ABCIResponses struct {
|
type ABCIResponses struct {
|
||||||
DeliverTx []*abci.ResponseDeliverTx
|
DeliverTx []*abci.ResponseDeliverTx
|
||||||
EndBlock *abci.ResponseEndBlock
|
EndBlock *abci.ResponseEndBlock
|
||||||
|
BeginBlock *abci.ResponseBeginBlock
|
||||||
}
|
}
|
||||||
|
|
||||||
// NewABCIResponses returns a new ABCIResponses
|
// NewABCIResponses returns a new ABCIResponses
|
||||||
@@ -191,12 +194,14 @@ func LoadValidators(db dbm.DB, height int64) (*types.ValidatorSet, error) {
|
|||||||
),
|
),
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
valInfo2.ValidatorSet.IncrementAccum(int(height - valInfo.LastHeightChanged)) // mutate
|
||||||
valInfo = valInfo2
|
valInfo = valInfo2
|
||||||
}
|
}
|
||||||
|
|
||||||
return valInfo.ValidatorSet, nil
|
return valInfo.ValidatorSet, nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// CONTRACT: Returned ValidatorsInfo can be mutated.
|
||||||
func loadValidatorsInfo(db dbm.DB, height int64) *ValidatorsInfo {
|
func loadValidatorsInfo(db dbm.DB, height int64) *ValidatorsInfo {
|
||||||
buf := db.Get(calcValidatorsKey(height))
|
buf := db.Get(calcValidatorsKey(height))
|
||||||
if len(buf) == 0 {
|
if len(buf) == 0 {
|
||||||
@@ -215,18 +220,22 @@ func loadValidatorsInfo(db dbm.DB, height int64) *ValidatorsInfo {
|
|||||||
return v
|
return v
|
||||||
}
|
}
|
||||||
|
|
||||||
// saveValidatorsInfo persists the validator set for the next block to disk.
|
// saveValidatorsInfo persists the validator set.
|
||||||
|
// `height` is the effective height for which the validator is responsible for signing.
|
||||||
// It should be called from s.Save(), right before the state itself is persisted.
|
// It should be called from s.Save(), right before the state itself is persisted.
|
||||||
// If the validator set did not change after processing the latest block,
|
// If the validator set did not change after processing the latest block,
|
||||||
// only the last height for which the validators changed is persisted.
|
// only the last height for which the validators changed is persisted.
|
||||||
func saveValidatorsInfo(db dbm.DB, nextHeight, changeHeight int64, valSet *types.ValidatorSet) {
|
func saveValidatorsInfo(db dbm.DB, height, lastHeightChanged int64, valSet *types.ValidatorSet) {
|
||||||
valInfo := &ValidatorsInfo{
|
if lastHeightChanged > height {
|
||||||
LastHeightChanged: changeHeight,
|
panic("LastHeightChanged cannot be greater than ValidatorsInfo height")
|
||||||
}
|
}
|
||||||
if changeHeight == nextHeight {
|
valInfo := &ValidatorsInfo{
|
||||||
|
LastHeightChanged: lastHeightChanged,
|
||||||
|
}
|
||||||
|
if lastHeightChanged == height {
|
||||||
valInfo.ValidatorSet = valSet
|
valInfo.ValidatorSet = valSet
|
||||||
}
|
}
|
||||||
db.Set(calcValidatorsKey(nextHeight), valInfo.Bytes())
|
db.Set(calcValidatorsKey(height), valInfo.Bytes())
|
||||||
}
|
}
|
||||||
|
|
||||||
//-----------------------------------------------------------------------------
|
//-----------------------------------------------------------------------------
|
||||||
|
@@ -207,8 +207,11 @@ func (txi *TxIndex) Search(q *query.Query) ([]*types.TxResult, error) {
|
|||||||
i++
|
i++
|
||||||
}
|
}
|
||||||
|
|
||||||
// sort by height by default
|
// sort by height & index by default
|
||||||
sort.Slice(results, func(i, j int) bool {
|
sort.Slice(results, func(i, j int) bool {
|
||||||
|
if results[i].Height == results[j].Height {
|
||||||
|
return results[i].Index < results[j].Index
|
||||||
|
}
|
||||||
return results[i].Height < results[j].Height
|
return results[i].Height < results[j].Height
|
||||||
})
|
})
|
||||||
|
|
||||||
@@ -225,9 +228,10 @@ func lookForHash(conditions []query.Condition) (hash []byte, err error, ok bool)
|
|||||||
return
|
return
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// lookForHeight returns a height if there is an "height=X" condition.
|
||||||
func lookForHeight(conditions []query.Condition) (height int64) {
|
func lookForHeight(conditions []query.Condition) (height int64) {
|
||||||
for _, c := range conditions {
|
for _, c := range conditions {
|
||||||
if c.Tag == types.TxHeightKey {
|
if c.Tag == types.TxHeightKey && c.Op == query.OpEqual {
|
||||||
return c.Operand.(int64)
|
return c.Operand.(int64)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -408,9 +412,9 @@ LOOP:
|
|||||||
func startKey(c query.Condition, height int64) []byte {
|
func startKey(c query.Condition, height int64) []byte {
|
||||||
var key string
|
var key string
|
||||||
if height > 0 {
|
if height > 0 {
|
||||||
key = fmt.Sprintf("%s/%v/%d", c.Tag, c.Operand, height)
|
key = fmt.Sprintf("%s/%v/%d/", c.Tag, c.Operand, height)
|
||||||
} else {
|
} else {
|
||||||
key = fmt.Sprintf("%s/%v", c.Tag, c.Operand)
|
key = fmt.Sprintf("%s/%v/", c.Tag, c.Operand)
|
||||||
}
|
}
|
||||||
return []byte(key)
|
return []byte(key)
|
||||||
}
|
}
|
||||||
|
@@ -73,6 +73,8 @@ func TestTxSearch(t *testing.T) {
|
|||||||
{"account.number = 1 AND account.owner = 'Ivan'", 1},
|
{"account.number = 1 AND account.owner = 'Ivan'", 1},
|
||||||
// search by exact match (two tags)
|
// search by exact match (two tags)
|
||||||
{"account.number = 1 AND account.owner = 'Vlad'", 0},
|
{"account.number = 1 AND account.owner = 'Vlad'", 0},
|
||||||
|
// search using a prefix of the stored value
|
||||||
|
{"account.owner = 'Iv'", 0},
|
||||||
// search by range
|
// search by range
|
||||||
{"account.number >= 1 AND account.number <= 5", 1},
|
{"account.number >= 1 AND account.number <= 5", 1},
|
||||||
// search by range (lower bound)
|
// search by range (lower bound)
|
||||||
@@ -133,6 +135,7 @@ func TestTxSearchMultipleTxs(t *testing.T) {
|
|||||||
})
|
})
|
||||||
txResult.Tx = types.Tx("Bob's account")
|
txResult.Tx = types.Tx("Bob's account")
|
||||||
txResult.Height = 2
|
txResult.Height = 2
|
||||||
|
txResult.Index = 1
|
||||||
err := indexer.Index(txResult)
|
err := indexer.Index(txResult)
|
||||||
require.NoError(t, err)
|
require.NoError(t, err)
|
||||||
|
|
||||||
@@ -142,14 +145,26 @@ func TestTxSearchMultipleTxs(t *testing.T) {
|
|||||||
})
|
})
|
||||||
txResult2.Tx = types.Tx("Alice's account")
|
txResult2.Tx = types.Tx("Alice's account")
|
||||||
txResult2.Height = 1
|
txResult2.Height = 1
|
||||||
|
txResult2.Index = 2
|
||||||
|
|
||||||
err = indexer.Index(txResult2)
|
err = indexer.Index(txResult2)
|
||||||
require.NoError(t, err)
|
require.NoError(t, err)
|
||||||
|
|
||||||
|
// indexed third (to test the order of transactions)
|
||||||
|
txResult3 := txResultWithTags([]cmn.KVPair{
|
||||||
|
{Key: []byte("account.number"), Value: []byte("3")},
|
||||||
|
})
|
||||||
|
txResult3.Tx = types.Tx("Jack's account")
|
||||||
|
txResult3.Height = 1
|
||||||
|
txResult3.Index = 1
|
||||||
|
err = indexer.Index(txResult3)
|
||||||
|
require.NoError(t, err)
|
||||||
|
|
||||||
results, err := indexer.Search(query.MustParse("account.number >= 1"))
|
results, err := indexer.Search(query.MustParse("account.number >= 1"))
|
||||||
assert.NoError(t, err)
|
assert.NoError(t, err)
|
||||||
|
|
||||||
require.Len(t, results, 2)
|
require.Len(t, results, 3)
|
||||||
assert.Equal(t, []*types.TxResult{txResult2, txResult}, results)
|
assert.Equal(t, []*types.TxResult{txResult3, txResult2, txResult}, results)
|
||||||
}
|
}
|
||||||
|
|
||||||
func TestIndexAllTags(t *testing.T) {
|
func TestIndexAllTags(t *testing.T) {
|
||||||
|
@@ -191,7 +191,7 @@ func (t *transacter) sendLoop(connIndex int) {
|
|||||||
c.SetWriteDeadline(now.Add(sendTimeout))
|
c.SetWriteDeadline(now.Add(sendTimeout))
|
||||||
err = c.WriteJSON(rpctypes.RPCRequest{
|
err = c.WriteJSON(rpctypes.RPCRequest{
|
||||||
JSONRPC: "2.0",
|
JSONRPC: "2.0",
|
||||||
ID: "tm-bench",
|
ID: rpctypes.JSONRPCStringID("tm-bench"),
|
||||||
Method: t.BroadcastTxMethod,
|
Method: t.BroadcastTxMethod,
|
||||||
Params: rawParamsJSON,
|
Params: rawParamsJSON,
|
||||||
})
|
})
|
||||||
|
@@ -48,13 +48,13 @@ Examples:
|
|||||||
logger = log.NewTMLogger(log.NewSyncWriter(os.Stdout))
|
logger = log.NewTMLogger(log.NewSyncWriter(os.Stdout))
|
||||||
}
|
}
|
||||||
|
|
||||||
m := startMonitor(flag.Arg(0))
|
monitor := startMonitor(flag.Arg(0))
|
||||||
|
|
||||||
startRPC(listenAddr, m, logger)
|
listener := startRPC(listenAddr, monitor, logger)
|
||||||
|
|
||||||
var ton *Ton
|
var ton *Ton
|
||||||
if !noton {
|
if !noton {
|
||||||
ton = NewTon(m)
|
ton = NewTon(monitor)
|
||||||
ton.Start()
|
ton.Start()
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -62,7 +62,8 @@ Examples:
|
|||||||
if !noton {
|
if !noton {
|
||||||
ton.Stop()
|
ton.Stop()
|
||||||
}
|
}
|
||||||
m.Stop()
|
monitor.Stop()
|
||||||
|
listener.Close()
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -34,7 +34,7 @@ func TestNodeNewBlockReceived(t *testing.T) {
|
|||||||
n.SendBlocksTo(blockCh)
|
n.SendBlocksTo(blockCh)
|
||||||
|
|
||||||
blockHeader := tmtypes.Header{Height: 5}
|
blockHeader := tmtypes.Header{Height: 5}
|
||||||
emMock.Call("eventCallback", &em.EventMetric{}, tmtypes.EventDataNewBlockHeader{blockHeader})
|
emMock.Call("eventCallback", &em.EventMetric{}, tmtypes.EventDataNewBlockHeader{Header: blockHeader})
|
||||||
|
|
||||||
assert.Equal(t, int64(5), n.Height)
|
assert.Equal(t, int64(5), n.Height)
|
||||||
assert.Equal(t, blockHeader, <-blockCh)
|
assert.Equal(t, blockHeader, <-blockCh)
|
||||||
|
@@ -2,6 +2,7 @@ package main
|
|||||||
|
|
||||||
import (
|
import (
|
||||||
"errors"
|
"errors"
|
||||||
|
"net"
|
||||||
"net/http"
|
"net/http"
|
||||||
|
|
||||||
"github.com/tendermint/tendermint/libs/log"
|
"github.com/tendermint/tendermint/libs/log"
|
||||||
@@ -9,16 +10,19 @@ import (
|
|||||||
monitor "github.com/tendermint/tendermint/tools/tm-monitor/monitor"
|
monitor "github.com/tendermint/tendermint/tools/tm-monitor/monitor"
|
||||||
)
|
)
|
||||||
|
|
||||||
func startRPC(listenAddr string, m *monitor.Monitor, logger log.Logger) {
|
func startRPC(listenAddr string, m *monitor.Monitor, logger log.Logger) net.Listener {
|
||||||
routes := routes(m)
|
routes := routes(m)
|
||||||
|
|
||||||
mux := http.NewServeMux()
|
mux := http.NewServeMux()
|
||||||
wm := rpc.NewWebsocketManager(routes, nil)
|
wm := rpc.NewWebsocketManager(routes, nil)
|
||||||
mux.HandleFunc("/websocket", wm.WebsocketHandler)
|
mux.HandleFunc("/websocket", wm.WebsocketHandler)
|
||||||
rpc.RegisterRPCFuncs(mux, routes, cdc, logger)
|
rpc.RegisterRPCFuncs(mux, routes, cdc, logger)
|
||||||
if _, err := rpc.StartHTTPServer(listenAddr, mux, logger, rpc.Config{}); err != nil {
|
listener, err := rpc.Listen(listenAddr, rpc.Config{})
|
||||||
|
if err != nil {
|
||||||
panic(err)
|
panic(err)
|
||||||
}
|
}
|
||||||
|
go rpc.StartHTTPServer(listener, mux, logger)
|
||||||
|
return listener
|
||||||
}
|
}
|
||||||
|
|
||||||
func routes(m *monitor.Monitor) map[string]*rpc.RPCFunc {
|
func routes(m *monitor.Monitor) map[string]*rpc.RPCFunc {
|
||||||
|
@@ -275,6 +275,28 @@ func (b *Block) StringShort() string {
|
|||||||
return fmt.Sprintf("Block#%v", b.Hash())
|
return fmt.Sprintf("Block#%v", b.Hash())
|
||||||
}
|
}
|
||||||
|
|
||||||
|
//-----------------------------------------------------------
|
||||||
|
// These methods are for Protobuf Compatibility
|
||||||
|
|
||||||
|
// Marshal returns the amino encoding.
|
||||||
|
func (b *Block) Marshal() ([]byte, error) {
|
||||||
|
return cdc.MarshalBinaryBare(b)
|
||||||
|
}
|
||||||
|
|
||||||
|
// MarshalTo calls Marshal and copies to the given buffer.
|
||||||
|
func (b *Block) MarshalTo(data []byte) (int, error) {
|
||||||
|
bs, err := b.Marshal()
|
||||||
|
if err != nil {
|
||||||
|
return -1, err
|
||||||
|
}
|
||||||
|
return copy(data, bs), nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Unmarshal deserializes from amino encoded form.
|
||||||
|
func (b *Block) Unmarshal(bs []byte) error {
|
||||||
|
return cdc.UnmarshalBinaryBare(bs, b)
|
||||||
|
}
|
||||||
|
|
||||||
//-----------------------------------------------------------------------------
|
//-----------------------------------------------------------------------------
|
||||||
|
|
||||||
// MaxDataBytes returns the maximum size of block's data.
|
// MaxDataBytes returns the maximum size of block's data.
|
||||||
|
@@ -13,3 +13,31 @@ func NewBlockMeta(block *Block, blockParts *PartSet) *BlockMeta {
|
|||||||
Header: block.Header,
|
Header: block.Header,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
//-----------------------------------------------------------
|
||||||
|
// These methods are for Protobuf Compatibility
|
||||||
|
|
||||||
|
// Size returns the size of the amino encoding, in bytes.
|
||||||
|
func (bm *BlockMeta) Size() int {
|
||||||
|
bs, _ := bm.Marshal()
|
||||||
|
return len(bs)
|
||||||
|
}
|
||||||
|
|
||||||
|
// Marshal returns the amino encoding.
|
||||||
|
func (bm *BlockMeta) Marshal() ([]byte, error) {
|
||||||
|
return cdc.MarshalBinaryBare(bm)
|
||||||
|
}
|
||||||
|
|
||||||
|
// MarshalTo calls Marshal and copies to the given buffer.
|
||||||
|
func (bm *BlockMeta) MarshalTo(data []byte) (int, error) {
|
||||||
|
bs, err := bm.Marshal()
|
||||||
|
if err != nil {
|
||||||
|
return -1, err
|
||||||
|
}
|
||||||
|
return copy(data, bs), nil
|
||||||
|
}
|
||||||
|
|
||||||
|
// Unmarshal deserializes from amino encoded form.
|
||||||
|
func (bm *BlockMeta) Unmarshal(bs []byte) error {
|
||||||
|
return cdc.UnmarshalBinaryBare(bs, bm)
|
||||||
|
}
|
||||||
|
@@ -71,12 +71,48 @@ func (b *EventBus) Publish(eventType string, eventData TMEventData) error {
|
|||||||
return nil
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func (b *EventBus) validateAndStringifyTags(tags []cmn.KVPair, logger log.Logger) map[string]string {
|
||||||
|
result := make(map[string]string)
|
||||||
|
for _, tag := range tags {
|
||||||
|
// basic validation
|
||||||
|
if len(tag.Key) == 0 {
|
||||||
|
logger.Debug("Got tag with an empty key (skipping)", "tag", tag)
|
||||||
|
continue
|
||||||
|
}
|
||||||
|
result[string(tag.Key)] = string(tag.Value)
|
||||||
|
}
|
||||||
|
return result
|
||||||
|
}
|
||||||
|
|
||||||
func (b *EventBus) PublishEventNewBlock(data EventDataNewBlock) error {
|
func (b *EventBus) PublishEventNewBlock(data EventDataNewBlock) error {
|
||||||
return b.Publish(EventNewBlock, data)
|
// no explicit deadline for publishing events
|
||||||
|
ctx := context.Background()
|
||||||
|
|
||||||
|
resultTags := append(data.ResultBeginBlock.Tags, data.ResultEndBlock.Tags...)
|
||||||
|
tags := b.validateAndStringifyTags(resultTags, b.Logger.With("block", data.Block.StringShort()))
|
||||||
|
|
||||||
|
// add predefined tags
|
||||||
|
logIfTagExists(EventTypeKey, tags, b.Logger)
|
||||||
|
tags[EventTypeKey] = EventNewBlock
|
||||||
|
|
||||||
|
b.pubsub.PublishWithTags(ctx, data, tmpubsub.NewTagMap(tags))
|
||||||
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func (b *EventBus) PublishEventNewBlockHeader(data EventDataNewBlockHeader) error {
|
func (b *EventBus) PublishEventNewBlockHeader(data EventDataNewBlockHeader) error {
|
||||||
return b.Publish(EventNewBlockHeader, data)
|
// no explicit deadline for publishing events
|
||||||
|
ctx := context.Background()
|
||||||
|
|
||||||
|
resultTags := append(data.ResultBeginBlock.Tags, data.ResultEndBlock.Tags...)
|
||||||
|
// TODO: Create StringShort method for Header and use it in logger.
|
||||||
|
tags := b.validateAndStringifyTags(resultTags, b.Logger.With("header", data.Header))
|
||||||
|
|
||||||
|
// add predefined tags
|
||||||
|
logIfTagExists(EventTypeKey, tags, b.Logger)
|
||||||
|
tags[EventTypeKey] = EventNewBlockHeader
|
||||||
|
|
||||||
|
b.pubsub.PublishWithTags(ctx, data, tmpubsub.NewTagMap(tags))
|
||||||
|
return nil
|
||||||
}
|
}
|
||||||
|
|
||||||
func (b *EventBus) PublishEventVote(data EventDataVote) error {
|
func (b *EventBus) PublishEventVote(data EventDataVote) error {
|
||||||
@@ -94,17 +130,7 @@ func (b *EventBus) PublishEventTx(data EventDataTx) error {
|
|||||||
// no explicit deadline for publishing events
|
// no explicit deadline for publishing events
|
||||||
ctx := context.Background()
|
ctx := context.Background()
|
||||||
|
|
||||||
tags := make(map[string]string)
|
tags := b.validateAndStringifyTags(data.Result.Tags, b.Logger.With("tx", data.Tx))
|
||||||
|
|
||||||
// validate and fill tags from tx result
|
|
||||||
for _, tag := range data.Result.Tags {
|
|
||||||
// basic validation
|
|
||||||
if len(tag.Key) == 0 {
|
|
||||||
b.Logger.Info("Got tag with an empty key (skipping)", "tag", tag, "tx", data.Tx)
|
|
||||||
continue
|
|
||||||
}
|
|
||||||
tags[string(tag.Key)] = string(tag.Value)
|
|
||||||
}
|
|
||||||
|
|
||||||
// add predefined tags
|
// add predefined tags
|
||||||
logIfTagExists(EventTypeKey, tags, b.Logger)
|
logIfTagExists(EventTypeKey, tags, b.Logger)
|
||||||
@@ -136,11 +162,11 @@ func (b *EventBus) PublishEventTimeoutWait(data EventDataRoundState) error {
|
|||||||
return b.Publish(EventTimeoutWait, data)
|
return b.Publish(EventTimeoutWait, data)
|
||||||
}
|
}
|
||||||
|
|
||||||
func (b *EventBus) PublishEventNewRound(data EventDataRoundState) error {
|
func (b *EventBus) PublishEventNewRound(data EventDataNewRound) error {
|
||||||
return b.Publish(EventNewRound, data)
|
return b.Publish(EventNewRound, data)
|
||||||
}
|
}
|
||||||
|
|
||||||
func (b *EventBus) PublishEventCompleteProposal(data EventDataRoundState) error {
|
func (b *EventBus) PublishEventCompleteProposal(data EventDataCompleteProposal) error {
|
||||||
return b.Publish(EventCompleteProposal, data)
|
return b.Publish(EventCompleteProposal, data)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@@ -58,6 +58,90 @@ func TestEventBusPublishEventTx(t *testing.T) {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
func TestEventBusPublishEventNewBlock(t *testing.T) {
|
||||||
|
eventBus := NewEventBus()
|
||||||
|
err := eventBus.Start()
|
||||||
|
require.NoError(t, err)
|
||||||
|
defer eventBus.Stop()
|
||||||
|
|
||||||
|
block := MakeBlock(0, []Tx{}, nil, []Evidence{})
|
||||||
|
resultBeginBlock := abci.ResponseBeginBlock{Tags: []cmn.KVPair{{Key: []byte("baz"), Value: []byte("1")}}}
|
||||||
|
resultEndBlock := abci.ResponseEndBlock{Tags: []cmn.KVPair{{Key: []byte("foz"), Value: []byte("2")}}}
|
||||||
|
|
||||||
|
txEventsCh := make(chan interface{})
|
||||||
|
|
||||||
|
// PublishEventNewBlock adds the tm.event tag, so the query below should work
|
||||||
|
query := "tm.event='NewBlock' AND baz=1 AND foz=2"
|
||||||
|
err = eventBus.Subscribe(context.Background(), "test", tmquery.MustParse(query), txEventsCh)
|
||||||
|
require.NoError(t, err)
|
||||||
|
|
||||||
|
done := make(chan struct{})
|
||||||
|
go func() {
|
||||||
|
for e := range txEventsCh {
|
||||||
|
edt := e.(EventDataNewBlock)
|
||||||
|
assert.Equal(t, block, edt.Block)
|
||||||
|
assert.Equal(t, resultBeginBlock, edt.ResultBeginBlock)
|
||||||
|
assert.Equal(t, resultEndBlock, edt.ResultEndBlock)
|
||||||
|
close(done)
|
||||||
|
}
|
||||||
|
}()
|
||||||
|
|
||||||
|
err = eventBus.PublishEventNewBlock(EventDataNewBlock{
|
||||||
|
Block: block,
|
||||||
|
ResultBeginBlock: resultBeginBlock,
|
||||||
|
ResultEndBlock: resultEndBlock,
|
||||||
|
})
|
||||||
|
assert.NoError(t, err)
|
||||||
|
|
||||||
|
select {
|
||||||
|
case <-done:
|
||||||
|
case <-time.After(1 * time.Second):
|
||||||
|
t.Fatal("did not receive a block after 1 sec.")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
func TestEventBusPublishEventNewBlockHeader(t *testing.T) {
|
||||||
|
eventBus := NewEventBus()
|
||||||
|
err := eventBus.Start()
|
||||||
|
require.NoError(t, err)
|
||||||
|
defer eventBus.Stop()
|
||||||
|
|
||||||
|
block := MakeBlock(0, []Tx{}, nil, []Evidence{})
|
||||||
|
resultBeginBlock := abci.ResponseBeginBlock{Tags: []cmn.KVPair{{Key: []byte("baz"), Value: []byte("1")}}}
|
||||||
|
resultEndBlock := abci.ResponseEndBlock{Tags: []cmn.KVPair{{Key: []byte("foz"), Value: []byte("2")}}}
|
||||||
|
|
||||||
|
txEventsCh := make(chan interface{})
|
||||||
|
|
||||||
|
// PublishEventNewBlockHeader adds the tm.event tag, so the query below should work
|
||||||
|
query := "tm.event='NewBlockHeader' AND baz=1 AND foz=2"
|
||||||
|
err = eventBus.Subscribe(context.Background(), "test", tmquery.MustParse(query), txEventsCh)
|
||||||
|
require.NoError(t, err)
|
||||||
|
|
||||||
|
done := make(chan struct{})
|
||||||
|
go func() {
|
||||||
|
for e := range txEventsCh {
|
||||||
|
edt := e.(EventDataNewBlockHeader)
|
||||||
|
assert.Equal(t, block.Header, edt.Header)
|
||||||
|
assert.Equal(t, resultBeginBlock, edt.ResultBeginBlock)
|
||||||
|
assert.Equal(t, resultEndBlock, edt.ResultEndBlock)
|
||||||
|
close(done)
|
||||||
|
}
|
||||||
|
}()
|
||||||
|
|
||||||
|
err = eventBus.PublishEventNewBlockHeader(EventDataNewBlockHeader{
|
||||||
|
Header: block.Header,
|
||||||
|
ResultBeginBlock: resultBeginBlock,
|
||||||
|
ResultEndBlock: resultEndBlock,
|
||||||
|
})
|
||||||
|
assert.NoError(t, err)
|
||||||
|
|
||||||
|
select {
|
||||||
|
case <-done:
|
||||||
|
case <-time.After(1 * time.Second):
|
||||||
|
t.Fatal("did not receive a block header after 1 sec.")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
func TestEventBusPublish(t *testing.T) {
|
func TestEventBusPublish(t *testing.T) {
|
||||||
eventBus := NewEventBus()
|
eventBus := NewEventBus()
|
||||||
err := eventBus.Start()
|
err := eventBus.Start()
|
||||||
@@ -96,9 +180,9 @@ func TestEventBusPublish(t *testing.T) {
|
|||||||
require.NoError(t, err)
|
require.NoError(t, err)
|
||||||
err = eventBus.PublishEventTimeoutWait(EventDataRoundState{})
|
err = eventBus.PublishEventTimeoutWait(EventDataRoundState{})
|
||||||
require.NoError(t, err)
|
require.NoError(t, err)
|
||||||
err = eventBus.PublishEventNewRound(EventDataRoundState{})
|
err = eventBus.PublishEventNewRound(EventDataNewRound{})
|
||||||
require.NoError(t, err)
|
require.NoError(t, err)
|
||||||
err = eventBus.PublishEventCompleteProposal(EventDataRoundState{})
|
err = eventBus.PublishEventCompleteProposal(EventDataCompleteProposal{})
|
||||||
require.NoError(t, err)
|
require.NoError(t, err)
|
||||||
err = eventBus.PublishEventPolka(EventDataRoundState{})
|
err = eventBus.PublishEventPolka(EventDataRoundState{})
|
||||||
require.NoError(t, err)
|
require.NoError(t, err)
|
||||||
|
@@ -4,6 +4,7 @@ import (
|
|||||||
"fmt"
|
"fmt"
|
||||||
|
|
||||||
amino "github.com/tendermint/go-amino"
|
amino "github.com/tendermint/go-amino"
|
||||||
|
abci "github.com/tendermint/tendermint/abci/types"
|
||||||
tmpubsub "github.com/tendermint/tendermint/libs/pubsub"
|
tmpubsub "github.com/tendermint/tendermint/libs/pubsub"
|
||||||
tmquery "github.com/tendermint/tendermint/libs/pubsub/query"
|
tmquery "github.com/tendermint/tendermint/libs/pubsub/query"
|
||||||
)
|
)
|
||||||
@@ -43,6 +44,8 @@ func RegisterEventDatas(cdc *amino.Codec) {
|
|||||||
cdc.RegisterConcrete(EventDataNewBlockHeader{}, "tendermint/event/NewBlockHeader", nil)
|
cdc.RegisterConcrete(EventDataNewBlockHeader{}, "tendermint/event/NewBlockHeader", nil)
|
||||||
cdc.RegisterConcrete(EventDataTx{}, "tendermint/event/Tx", nil)
|
cdc.RegisterConcrete(EventDataTx{}, "tendermint/event/Tx", nil)
|
||||||
cdc.RegisterConcrete(EventDataRoundState{}, "tendermint/event/RoundState", nil)
|
cdc.RegisterConcrete(EventDataRoundState{}, "tendermint/event/RoundState", nil)
|
||||||
|
cdc.RegisterConcrete(EventDataNewRound{}, "tendermint/event/NewRound", nil)
|
||||||
|
cdc.RegisterConcrete(EventDataCompleteProposal{}, "tendermint/event/CompleteProposal", nil)
|
||||||
cdc.RegisterConcrete(EventDataVote{}, "tendermint/event/Vote", nil)
|
cdc.RegisterConcrete(EventDataVote{}, "tendermint/event/Vote", nil)
|
||||||
cdc.RegisterConcrete(EventDataProposalHeartbeat{}, "tendermint/event/ProposalHeartbeat", nil)
|
cdc.RegisterConcrete(EventDataProposalHeartbeat{}, "tendermint/event/ProposalHeartbeat", nil)
|
||||||
cdc.RegisterConcrete(EventDataValidatorSetUpdates{}, "tendermint/event/ValidatorSetUpdates", nil)
|
cdc.RegisterConcrete(EventDataValidatorSetUpdates{}, "tendermint/event/ValidatorSetUpdates", nil)
|
||||||
@@ -54,11 +57,17 @@ func RegisterEventDatas(cdc *amino.Codec) {
|
|||||||
|
|
||||||
type EventDataNewBlock struct {
|
type EventDataNewBlock struct {
|
||||||
Block *Block `json:"block"`
|
Block *Block `json:"block"`
|
||||||
|
|
||||||
|
ResultBeginBlock abci.ResponseBeginBlock `json:"result_begin_block"`
|
||||||
|
ResultEndBlock abci.ResponseEndBlock `json:"result_end_block"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// light weight event for benchmarking
|
// light weight event for benchmarking
|
||||||
type EventDataNewBlockHeader struct {
|
type EventDataNewBlockHeader struct {
|
||||||
Header Header `json:"header"`
|
Header Header `json:"header"`
|
||||||
|
|
||||||
|
ResultBeginBlock abci.ResponseBeginBlock `json:"result_begin_block"`
|
||||||
|
ResultEndBlock abci.ResponseEndBlock `json:"result_end_block"`
|
||||||
}
|
}
|
||||||
|
|
||||||
// All txs fire EventDataTx
|
// All txs fire EventDataTx
|
||||||
@@ -80,6 +89,27 @@ type EventDataRoundState struct {
|
|||||||
RoundState interface{} `json:"-"`
|
RoundState interface{} `json:"-"`
|
||||||
}
|
}
|
||||||
|
|
||||||
|
type ValidatorInfo struct {
|
||||||
|
Address Address `json:"address"`
|
||||||
|
Index int `json:"index"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type EventDataNewRound struct {
|
||||||
|
Height int64 `json:"height"`
|
||||||
|
Round int `json:"round"`
|
||||||
|
Step string `json:"step"`
|
||||||
|
|
||||||
|
Proposer ValidatorInfo `json:"proposer"`
|
||||||
|
}
|
||||||
|
|
||||||
|
type EventDataCompleteProposal struct {
|
||||||
|
Height int64 `json:"height"`
|
||||||
|
Round int `json:"round"`
|
||||||
|
Step string `json:"step"`
|
||||||
|
|
||||||
|
BlockID BlockID `json:"block_id"`
|
||||||
|
}
|
||||||
|
|
||||||
type EventDataVote struct {
|
type EventDataVote struct {
|
||||||
Vote *Vote
|
Vote *Vote
|
||||||
}
|
}
|
||||||
|
@@ -200,6 +200,9 @@ func (ps *PartSet) Total() int {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func (ps *PartSet) AddPart(part *Part) (bool, error) {
|
func (ps *PartSet) AddPart(part *Part) (bool, error) {
|
||||||
|
if ps == nil {
|
||||||
|
return false, nil
|
||||||
|
}
|
||||||
ps.mtx.Lock()
|
ps.mtx.Lock()
|
||||||
defer ps.mtx.Unlock()
|
defer ps.mtx.Unlock()
|
||||||
|
|
||||||
|
@@ -84,8 +84,7 @@ func TestWrongProof(t *testing.T) {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
func TestPartSetHeaderSetValidateBasic(t *testing.T) {
|
func TestPartSetHeaderValidateBasic(t *testing.T) {
|
||||||
|
|
||||||
testCases := []struct {
|
testCases := []struct {
|
||||||
testName string
|
testName string
|
||||||
malleatePartSetHeader func(*PartSetHeader)
|
malleatePartSetHeader func(*PartSetHeader)
|
||||||
@@ -107,7 +106,6 @@ func TestPartSetHeaderSetValidateBasic(t *testing.T) {
|
|||||||
}
|
}
|
||||||
|
|
||||||
func TestPartValidateBasic(t *testing.T) {
|
func TestPartValidateBasic(t *testing.T) {
|
||||||
|
|
||||||
testCases := []struct {
|
testCases := []struct {
|
||||||
testName string
|
testName string
|
||||||
malleatePart func(*Part)
|
malleatePart func(*Part)
|
||||||
|
@@ -62,7 +62,11 @@ func (vals *ValidatorSet) CopyIncrementAccum(times int) *ValidatorSet {
|
|||||||
|
|
||||||
// IncrementAccum increments accum of each validator and updates the
|
// IncrementAccum increments accum of each validator and updates the
|
||||||
// proposer. Panics if validator set is empty.
|
// proposer. Panics if validator set is empty.
|
||||||
|
// `times` must be positive.
|
||||||
func (vals *ValidatorSet) IncrementAccum(times int) {
|
func (vals *ValidatorSet) IncrementAccum(times int) {
|
||||||
|
if times <= 0 {
|
||||||
|
panic("Cannot call IncrementAccum with non-positive times")
|
||||||
|
}
|
||||||
|
|
||||||
// Add VotingPower * times to each validator and order into heap.
|
// Add VotingPower * times to each validator and order into heap.
|
||||||
validatorsHeap := cmn.NewHeap()
|
validatorsHeap := cmn.NewHeap()
|
||||||
|
@@ -86,6 +86,19 @@ func TestCopy(t *testing.T) {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Test that IncrementAccum requires positive times.
|
||||||
|
func TestIncrementAccumPositiveTimes(t *testing.T) {
|
||||||
|
vset := NewValidatorSet([]*Validator{
|
||||||
|
newValidator([]byte("foo"), 1000),
|
||||||
|
newValidator([]byte("bar"), 300),
|
||||||
|
newValidator([]byte("baz"), 330),
|
||||||
|
})
|
||||||
|
|
||||||
|
assert.Panics(t, func() { vset.IncrementAccum(-1) })
|
||||||
|
assert.Panics(t, func() { vset.IncrementAccum(0) })
|
||||||
|
vset.IncrementAccum(1)
|
||||||
|
}
|
||||||
|
|
||||||
func BenchmarkValidatorSetCopy(b *testing.B) {
|
func BenchmarkValidatorSetCopy(b *testing.B) {
|
||||||
b.StopTimer()
|
b.StopTimer()
|
||||||
vset := NewValidatorSet([]*Validator{})
|
vset := NewValidatorSet([]*Validator{})
|
||||||
@@ -239,7 +252,7 @@ func TestProposerSelection3(t *testing.T) {
|
|||||||
mod := (cmn.RandInt() % 5) + 1
|
mod := (cmn.RandInt() % 5) + 1
|
||||||
if cmn.RandInt()%mod > 0 {
|
if cmn.RandInt()%mod > 0 {
|
||||||
// sometimes its up to 5
|
// sometimes its up to 5
|
||||||
times = cmn.RandInt() % 5
|
times = (cmn.RandInt() % 4) + 1
|
||||||
}
|
}
|
||||||
vset.IncrementAccum(times)
|
vset.IncrementAccum(times)
|
||||||
|
|
||||||
|
@@ -18,7 +18,7 @@ const (
|
|||||||
// TMCoreSemVer is the current version of Tendermint Core.
|
// TMCoreSemVer is the current version of Tendermint Core.
|
||||||
// It's the Semantic Version of the software.
|
// It's the Semantic Version of the software.
|
||||||
// Must be a string because scripts like dist.sh read this file.
|
// Must be a string because scripts like dist.sh read this file.
|
||||||
TMCoreSemVer = "0.26.2"
|
TMCoreSemVer = "0.26.4"
|
||||||
|
|
||||||
// ABCISemVer is the semantic version of the ABCI library
|
// ABCISemVer is the semantic version of the ABCI library
|
||||||
ABCISemVer = "0.15.0"
|
ABCISemVer = "0.15.0"
|
||||||
|
Reference in New Issue
Block a user